Organic phosphoric acids and derivatives
Filtered Search Results
Thermo Scientific Chemicals Adenosine-5'-monophosphoric acid, 99% (dry wt.), water <6%
CAS: 61-19-8 Molecular Formula: C10H14N5O7P Molecular Weight (g/mol): 347.22 MDL Number: MFCD00005750 InChI Key: UDMBCSSLTHHNCD-YPLCUDRINA-N Synonym: adenosine 5'-monophosphate,5'-adenylic acid,adenosine monophosphate,adenosine phosphate,adenylic acid,adenylate,phosphaden,5'-amp,adenosine 5'-phosphate,phosphentaside PubChem CID: 6083 ChEBI: CHEBI:16027 IUPAC Name: [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate SMILES: NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1
| PubChem CID | 6083 |
|---|---|
| CAS | 61-19-8 |
| Molecular Weight (g/mol) | 347.22 |
| ChEBI | CHEBI:16027 |
| MDL Number | MFCD00005750 |
| SMILES | NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 |
| Synonym | adenosine 5'-monophosphate,5'-adenylic acid,adenosine monophosphate,adenosine phosphate,adenylic acid,adenylate,phosphaden,5'-amp,adenosine 5'-phosphate,phosphentaside |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChI Key | UDMBCSSLTHHNCD-YPLCUDRINA-N |
| Molecular Formula | C10H14N5O7P |
Phosphoric Acid Dibenzyl Ester, TRC
CAS: 1623-08-1 Molecular Formula: C14H15O4P Molecular Weight (g/mol): 278.24 Synonym: Dibenzyl Hydrogen Phosphate,Dibenzyl Phosphate,Dibenzylphosphoric Acid IUPAC Name: dibenzyl hydrogen phosphate SMILES: OP(=O)(OCc1ccccc1)OCc2ccccc2
| CAS | 1623-08-1 |
|---|---|
| Molecular Weight (g/mol) | 278.24 |
| SMILES | OP(=O)(OCc1ccccc1)OCc2ccccc2 |
| Synonym | Dibenzyl Hydrogen Phosphate,Dibenzyl Phosphate,Dibenzylphosphoric Acid |
| IUPAC Name | dibenzyl hydrogen phosphate |
| Molecular Formula | C14H15O4P |
Phosphoric Acid Diethyl Ester, TRC
CAS: 598-02-7 Molecular Formula: C4 H11 O4 P Molecular Weight (g/mol): 154.1 Synonym: Phosphoric acid, diethyl ester,Phosphoric acid diethyl ester,Ethyl phosphate ((C2H5O)2(HO)PO) (6CI),DEP,Diethyl acid phosphate,Diethyl hydrogen phosphate,Diethyl phosphate,Diethyl phosphoric acid,JP 502,NSC 97178,O,O-Diethyl hydrogen phosphate IUPAC Name: diethyl hydrogen phosphate SMILES: CCOP(=O)(O)OCC
| CAS | 598-02-7 |
|---|---|
| Molecular Weight (g/mol) | 154.1 |
| SMILES | CCOP(=O)(O)OCC |
| Synonym | Phosphoric acid, diethyl ester,Phosphoric acid diethyl ester,Ethyl phosphate ((C2H5O)2(HO)PO) (6CI),DEP,Diethyl acid phosphate,Diethyl hydrogen phosphate,Diethyl phosphate,Diethyl phosphoric acid,JP 502,NSC 97178,O,O-Diethyl hydrogen phosphate |
| IUPAC Name | diethyl hydrogen phosphate |
| Molecular Formula | C4 H11 O4 P |
Phosphoric Acid Tributyl Ester, TRC
CAS: 126-73-8 Molecular Formula: C12 H27 O4 P Molecular Weight (g/mol): 266.31 Synonym: Tri-n-butyl phosphate,Phosphoric acid tributyl ester,Tributyl Phosphate,Butyl phosphate ((BuO)3PO) (6CI, 7CI),Tributyl phosphate (ACI),941PL,Calloway 6814,Celluphos 4,Degressal SD 40,Disflamoll TB,DL 1157,DU 155,Moussex 941PL,NSC 8484,Phosflex 4,Phosphoric acid, tributyl ester,TBP,TBPA,Tri-n-butyl phosphate,Tributoxyphosphine oxide,X 8054 IUPAC Name: tributyl phosphate SMILES: CCCCOP(=O)(OCCCC)OCCCC
| CAS | 126-73-8 |
|---|---|
| Molecular Weight (g/mol) | 266.31 |
| SMILES | CCCCOP(=O)(OCCCC)OCCCC |
| Synonym | Tri-n-butyl phosphate,Phosphoric acid tributyl ester,Tributyl Phosphate,Butyl phosphate ((BuO)3PO) (6CI, 7CI),Tributyl phosphate (ACI),941PL,Calloway 6814,Celluphos 4,Degressal SD 40,Disflamoll TB,DL 1157,DU 155,Moussex 941PL,NSC 8484,Phosflex 4,Phosphoric acid, tributyl ester,TBP,TBPA,Tri-n-butyl phosphate,Tributoxyphosphine oxide,X 8054 |
| IUPAC Name | tributyl phosphate |
| Molecular Formula | C12 H27 O4 P |
Di-Beta,Beta'-Chloroethylphosphoric Acid, TRC
CAS: 3040-56-0 Molecular Formula: C4H9Cl2O4P Molecular Weight (g/mol): 222.99 Synonym: Ethanol, 2-chloro-, hydrogen phosphate (7CI, 8CI, 9CI),Bis(2-chloroethyl) hydrogen phosphate,Bis(2-chloroethyl) phosphate,Bis(chloroethyl) phosphate,Bis(β-chloroethyl) phosphate,Bis(β-chloroethyl) phosphoric acid,Di-2-Chloroethyl phosphate,Di-β,β'-Chloroethylphosphoric acid IUPAC Name: bis(2-chloroethyl) hydrogen phosphate SMILES: OP(=O)(OCCCl)OCCCl
| CAS | 3040-56-0 |
|---|---|
| Molecular Weight (g/mol) | 222.99 |
| SMILES | OP(=O)(OCCCl)OCCCl |
| Synonym | Ethanol, 2-chloro-, hydrogen phosphate (7CI, 8CI, 9CI),Bis(2-chloroethyl) hydrogen phosphate,Bis(2-chloroethyl) phosphate,Bis(chloroethyl) phosphate,Bis(β-chloroethyl) phosphate,Bis(β-chloroethyl) phosphoric acid,Di-2-Chloroethyl phosphate,Di-β,β'-Chloroethylphosphoric acid |
| IUPAC Name | bis(2-chloroethyl) hydrogen phosphate |
| Molecular Formula | C4H9Cl2O4P |
Phosphoric Acid Tris(3-methylphenyl) Ester, TRC
CAS: 563-04-2 Molecular Formula: C21 H21 O4 P Molecular Weight (g/mol): 368.36 Synonym: Phosphoric acid, tris(3-methylphenyl) ester (9CI, ACI),m-Tolyl phosphate, (C7H7O)3PO (6CI),Phosphoric acid, tri-m-tolyl ester (8CI),NSC 4055,TMCP,Tri-m-cresyl phosphate,Tri-m-tolyl phosphate,Tris(3-methylphenyl) phosphate,Tris(m-tolyl) phosphate,Tris-m-cresyl phosphate,Tri-3-cresyl phosphate IUPAC Name: tris(3-methylphenyl) phosphate SMILES: Cc1cccc(OP(=O)(Oc2cccc(C)c2)Oc3cccc(C)c3)c1
| CAS | 563-04-2 |
|---|---|
| Molecular Weight (g/mol) | 368.36 |
| SMILES | Cc1cccc(OP(=O)(Oc2cccc(C)c2)Oc3cccc(C)c3)c1 |
| Synonym | Phosphoric acid, tris(3-methylphenyl) ester (9CI, ACI),m-Tolyl phosphate, (C7H7O)3PO (6CI),Phosphoric acid, tri-m-tolyl ester (8CI),NSC 4055,TMCP,Tri-m-cresyl phosphate,Tri-m-tolyl phosphate,Tris(3-methylphenyl) phosphate,Tris(m-tolyl) phosphate,Tris-m-cresyl phosphate,Tri-3-cresyl phosphate |
| IUPAC Name | tris(3-methylphenyl) phosphate |
| Molecular Formula | C21 H21 O4 P |
Phosphoric Acid Tris(2-methylpropyl) Ester, TRC
CAS: 126-71-6 Molecular Formula: C12 H27 O4 P Molecular Weight (g/mol): 266.31 Synonym: Phosphoric acid, tris(2-methylpropyl) ester,Isobutyl phosphate ((C4H9O)3PO) (6CI,7CI),Phosphoric acid, triisobutyl ester (8CI),Antifoam TIP,Daiguard 400,NSC 62222,Reomol TIBP,Triisobutyl phosphate IUPAC Name: tris(2-methylpropyl) phosphate SMILES: CC(C)COP(=O)(OCC(C)C)OCC(C)C
| CAS | 126-71-6 |
|---|---|
| Molecular Weight (g/mol) | 266.31 |
| SMILES | CC(C)COP(=O)(OCC(C)C)OCC(C)C |
| Synonym | Phosphoric acid, tris(2-methylpropyl) ester,Isobutyl phosphate ((C4H9O)3PO) (6CI,7CI),Phosphoric acid, triisobutyl ester (8CI),Antifoam TIP,Daiguard 400,NSC 62222,Reomol TIBP,Triisobutyl phosphate |
| IUPAC Name | tris(2-methylpropyl) phosphate |
| Molecular Formula | C12 H27 O4 P |
Phosphoric Acid Tris(2-methylphenyl) Ester, TRC
CAS: 78-30-8 Molecular Formula: C21 H21 O4 P Molecular Weight (g/mol): 368.36 Synonym: Phosphoric acid, tris(2-methylphenyl) ester (9CI, ACI),Phosphoric acid, tri-o-tolyl ester (8CI),NSC 438,o-Cresyl phosphate,P(o-Tolyl)3,Phosflex 179C,TOCP,TOKF,TOTP,Tri-o-cresyl phosphate,Tri-o-tolyl phosphate,Tris(2-methylphenyl) phosphate,Tris(2-tolyl) phosphate,Tris(o-cresyl) phosphate,Tris(o-methylphenyl) phosphate,Tris(o-tolyl) phosphate,Tri-2-cresyl phosphate IUPAC Name: tris(2-methylphenyl) phosphate SMILES: Cc1ccccc1OP(=O)(Oc2ccccc2C)Oc3ccccc3C
| CAS | 78-30-8 |
|---|---|
| Molecular Weight (g/mol) | 368.36 |
| SMILES | Cc1ccccc1OP(=O)(Oc2ccccc2C)Oc3ccccc3C |
| Synonym | Phosphoric acid, tris(2-methylphenyl) ester (9CI, ACI),Phosphoric acid, tri-o-tolyl ester (8CI),NSC 438,o-Cresyl phosphate,P(o-Tolyl)3,Phosflex 179C,TOCP,TOKF,TOTP,Tri-o-cresyl phosphate,Tri-o-tolyl phosphate,Tris(2-methylphenyl) phosphate,Tris(2-tolyl) phosphate,Tris(o-cresyl) phosphate,Tris(o-methylphenyl) phosphate,Tris(o-tolyl) phosphate,Tri-2-cresyl phosphate |
| IUPAC Name | tris(2-methylphenyl) phosphate |
| Molecular Formula | C21 H21 O4 P |
Phosphoric Acid Tris(2-methylpropyl) Ester, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
Triethyl phosphate, 99+%
CAS: 78-40-0 Molecular Formula: C6H15O4P Molecular Weight (g/mol): 182.16 MDL Number: MFCD00009077 InChI Key: DQWPFSLDHJDLRL-UHFFFAOYSA-N Synonym: triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester PubChem CID: 6535 ChEBI: CHEBI:45927 IUPAC Name: triethyl phosphate SMILES: CCOP(=O)(OCC)OCC
| PubChem CID | 6535 |
|---|---|
| CAS | 78-40-0 |
| Molecular Weight (g/mol) | 182.16 |
| ChEBI | CHEBI:45927 |
| MDL Number | MFCD00009077 |
| SMILES | CCOP(=O)(OCC)OCC |
| Synonym | triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester |
| IUPAC Name | triethyl phosphate |
| InChI Key | DQWPFSLDHJDLRL-UHFFFAOYSA-N |
| Molecular Formula | C6H15O4P |
Triethyl phosphate, 99%
CAS: 78-40-0 Molecular Formula: C6H15O4P Molecular Weight (g/mol): 182.16 MDL Number: MFCD00009077 InChI Key: DQWPFSLDHJDLRL-UHFFFAOYSA-N Synonym: triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester PubChem CID: 6535 ChEBI: CHEBI:45927 IUPAC Name: triethyl phosphate SMILES: CCOP(=O)(OCC)OCC
| PubChem CID | 6535 |
|---|---|
| CAS | 78-40-0 |
| Molecular Weight (g/mol) | 182.16 |
| ChEBI | CHEBI:45927 |
| MDL Number | MFCD00009077 |
| SMILES | CCOP(=O)(OCC)OCC |
| Synonym | triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester |
| IUPAC Name | triethyl phosphate |
| InChI Key | DQWPFSLDHJDLRL-UHFFFAOYSA-N |
| Molecular Formula | C6H15O4P |
Tributyl phosphate, 99+%, Thermo Scientific Chemicals
CAS: 126-73-8 Molecular Formula: C12H27O4P Molecular Weight (g/mol): 266.32 MDL Number: MFCD00009436 InChI Key: STCOOQWBFONSKY-UHFFFAOYSA-N Synonym: tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de PubChem CID: 31357 ChEBI: CHEBI:35019 IUPAC Name: tributyl phosphate SMILES: CCCCOP(=O)(OCCCC)OCCCC
| PubChem CID | 31357 |
|---|---|
| CAS | 126-73-8 |
| Molecular Weight (g/mol) | 266.32 |
| ChEBI | CHEBI:35019 |
| MDL Number | MFCD00009436 |
| SMILES | CCCCOP(=O)(OCCCC)OCCCC |
| Synonym | tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de |
| IUPAC Name | tributyl phosphate |
| InChI Key | STCOOQWBFONSKY-UHFFFAOYSA-N |
| Molecular Formula | C12H27O4P |
Diphenyl phosphate, 97%
CAS: 838-85-7 Molecular Formula: C12H11O4P Molecular Weight (g/mol): 250.19 MDL Number: MFCD00003033 InChI Key: ASMQGLCHMVWBQR-UHFFFAOYSA-N Synonym: diphenyl phosphate,phosphoric acid, diphenyl ester,phenyl hydrogen phosphate,phenyl phosphate pho 2 ho po,diphenoxyphosphinic acid,phosphoric acid diphenyl ester,diphenylphosphoric acid,phosphoric acid diphenyl,dsstox_cid_28182 PubChem CID: 13282 IUPAC Name: diphenyl hydrogen phosphate SMILES: OP(=O)(OC1=CC=CC=C1)OC1=CC=CC=C1
| PubChem CID | 13282 |
|---|---|
| CAS | 838-85-7 |
| Molecular Weight (g/mol) | 250.19 |
| MDL Number | MFCD00003033 |
| SMILES | OP(=O)(OC1=CC=CC=C1)OC1=CC=CC=C1 |
| Synonym | diphenyl phosphate,phosphoric acid, diphenyl ester,phenyl hydrogen phosphate,phenyl phosphate pho 2 ho po,diphenoxyphosphinic acid,phosphoric acid diphenyl ester,diphenylphosphoric acid,phosphoric acid diphenyl,dsstox_cid_28182 |
| IUPAC Name | diphenyl hydrogen phosphate |
| InChI Key | ASMQGLCHMVWBQR-UHFFFAOYSA-N |
| Molecular Formula | C12H11O4P |
Thermo Scientific Chemicals 2'-Deoxycytidine-5'-monophosphate, 99%
CAS: 1032-65-1 Molecular Formula: C9H14N3O7P Molecular Weight (g/mol): 307.199 MDL Number: MFCD00006546 InChI Key: NCMVOABPESMRCP-SHYZEUOFSA-N Synonym: dcmp,deoxycytidylic acid,deoxycytidine monophosphate,2'-deoxycytidine-5'-monophosphate,2'-deoxycytidine-5'-monophosphoric acid,5'-cytidylic acid, 2'-deoxy,2'-deoxycytidine 5'-monophosphate,deoxycytidylate,polydeoxycytidylic acid,deoxycytidine-5'-monophosphoric acid PubChem CID: 13945 ChEBI: CHEBI:15918 IUPAC Name: [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate SMILES: C1C(C(OC1N2C=CC(=NC2=O)N)COP(=O)(O)O)O
| PubChem CID | 13945 |
|---|---|
| CAS | 1032-65-1 |
| Molecular Weight (g/mol) | 307.199 |
| ChEBI | CHEBI:15918 |
| MDL Number | MFCD00006546 |
| SMILES | C1C(C(OC1N2C=CC(=NC2=O)N)COP(=O)(O)O)O |
| Synonym | dcmp,deoxycytidylic acid,deoxycytidine monophosphate,2'-deoxycytidine-5'-monophosphate,2'-deoxycytidine-5'-monophosphoric acid,5'-cytidylic acid, 2'-deoxy,2'-deoxycytidine 5'-monophosphate,deoxycytidylate,polydeoxycytidylic acid,deoxycytidine-5'-monophosphoric acid |
| IUPAC Name | [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChI Key | NCMVOABPESMRCP-SHYZEUOFSA-N |
| Molecular Formula | C9H14N3O7P |
Bis(2-ethylhexyl) phosphate, 95%
CAS: 298-07-7 Molecular Formula: C16H35O4P Molecular Weight (g/mol): 322.43 MDL Number: MFCD00009492 InChI Key: SEGLCEQVOFDUPX-UHFFFAOYNA-N Synonym: bis 2-ethylhexyl hydrogen phosphate,bis 2-ethylhexyl phosphate,hdehp,di 2-ethylhexyl phosphate,dehpa extractant,di 2-ethylhexyl phosphoric acid,escaid 100,d 2ehpa,bis 2-ethylhexyl phosphoric acid PubChem CID: 9275 IUPAC Name: bis(2-ethylhexyl) hydrogen phosphate SMILES: CCCCC(CC)COP(O)(=O)OCC(CC)CCCC
| PubChem CID | 9275 |
|---|---|
| CAS | 298-07-7 |
| Molecular Weight (g/mol) | 322.43 |
| MDL Number | MFCD00009492 |
| SMILES | CCCCC(CC)COP(O)(=O)OCC(CC)CCCC |
| Synonym | bis 2-ethylhexyl hydrogen phosphate,bis 2-ethylhexyl phosphate,hdehp,di 2-ethylhexyl phosphate,dehpa extractant,di 2-ethylhexyl phosphoric acid,escaid 100,d 2ehpa,bis 2-ethylhexyl phosphoric acid |
| IUPAC Name | bis(2-ethylhexyl) hydrogen phosphate |
| InChI Key | SEGLCEQVOFDUPX-UHFFFAOYNA-N |
| Molecular Formula | C16H35O4P |