Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
EDTA (Di Sodium Salt) Solution, EU Pharmacopoeia, Fisher Chemical™
SureTRACE
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
N-(2-Cyanoethyl)glycine, 98%, Thermo Scientific™
CAS: 3088-42-4 Molecular Formula: C5H8N2O2 Molecular Weight (g/mol): 128.13 MDL Number: MFCD00066903 InChI Key: KZUBZCHAWPDYQX-UHFFFAOYSA-N Synonym: n-2-cyanoethyl glycine,glycine, n-2-cyanoethyl,n-2-cyanoethyl aminoacetic acid,2-2-cyanoethyl amino acetic acid,2-2-cyanoethylamino acetic acid,2-cyanoethyl amino acetic acid,wln: qv1m2cn,.alpha.-.beta.'-cyanoethyl-aminoacetic acid PubChem CID: 76526 IUPAC Name: 2-(2-cyanoethylamino)acetic acid SMILES: OC(=O)CNCCC#N
| PubChem CID | 76526 |
|---|---|
| CAS | 3088-42-4 |
| Molecular Weight (g/mol) | 128.13 |
| MDL Number | MFCD00066903 |
| SMILES | OC(=O)CNCCC#N |
| Synonym | n-2-cyanoethyl glycine,glycine, n-2-cyanoethyl,n-2-cyanoethyl aminoacetic acid,2-2-cyanoethyl amino acetic acid,2-2-cyanoethylamino acetic acid,2-cyanoethyl amino acetic acid,wln: qv1m2cn,.alpha.-.beta.'-cyanoethyl-aminoacetic acid |
| IUPAC Name | 2-(2-cyanoethylamino)acetic acid |
| InChI Key | KZUBZCHAWPDYQX-UHFFFAOYSA-N |
| Molecular Formula | C5H8N2O2 |
Iso-Amyl Alcohol, Extra Pure, SLR, for Determination Of Fat In Milk, Fisher Chemical™
CAS: 123-51-3 Molecular Weight (g/mol): 88.15 MDL Number: 2934 InChI Key: PHTQWCKDNZKARW-UHFFFAOYSA-N IUPAC Name: 3-methylbutan-1-ol SMILES: CC(C)CCO
| CAS | 123-51-3 |
|---|---|
| Molecular Weight (g/mol) | 88.15 |
| MDL Number | 2934 |
| SMILES | CC(C)CCO |
| IUPAC Name | 3-methylbutan-1-ol |
| InChI Key | PHTQWCKDNZKARW-UHFFFAOYSA-N |
4-Cyanopyridine, 98%
CAS: 100-48-1 Molecular Formula: C6H4N2 Molecular Weight (g/mol): 104.11 MDL Number: MFCD00006417 InChI Key: GPHQHTOMRSGBNZ-UHFFFAOYSA-N Synonym: 4-cyanopyridine,isonicotinonitrile,4-pyridinecarbonitrile,isonicotinic acid nitrile,4-pyridinenitrile,4-cyano pyridine,.gamma.-cyanopyridine,gamma-cyanopyridine,p-cyanopyridine,pubchem11155 PubChem CID: 7506 ChEBI: CHEBI:28020 IUPAC Name: pyridine-4-carbonitrile SMILES: C1=CN=CC=C1C#N
| PubChem CID | 7506 |
|---|---|
| CAS | 100-48-1 |
| Molecular Weight (g/mol) | 104.11 |
| ChEBI | CHEBI:28020 |
| MDL Number | MFCD00006417 |
| SMILES | C1=CN=CC=C1C#N |
| Synonym | 4-cyanopyridine,isonicotinonitrile,4-pyridinecarbonitrile,isonicotinic acid nitrile,4-pyridinenitrile,4-cyano pyridine,.gamma.-cyanopyridine,gamma-cyanopyridine,p-cyanopyridine,pubchem11155 |
| IUPAC Name | pyridine-4-carbonitrile |
| InChI Key | GPHQHTOMRSGBNZ-UHFFFAOYSA-N |
| Molecular Formula | C6H4N2 |
1,1-Cyclobutanedicarboxylic acid, 99%
CAS: 5445-51-2 Molecular Formula: C6H8O4 Molecular Weight (g/mol): 144.13 MDL Number: MFCD00001325 InChI Key: CCQPAEQGAVNNIA-UHFFFAOYSA-N Synonym: 1,1-cyclobutanedicarboxylic acid,h2cbdca,1,1-cyclobutanedicarboxylicacid,cyclobutanedicarboxylic acid,1,1-cyclobutane dicarboxylic acid,1,1-cyclobutanedicarboxylate,cyclobutanedicarbonic acid,zlchem 254,pubchem14151,acmc-1am73 PubChem CID: 2568 ChEBI: CHEBI:35691 IUPAC Name: cyclobutane-1,1-dicarboxylic acid SMILES: C1CC(C1)(C(=O)O)C(=O)O
| PubChem CID | 2568 |
|---|---|
| CAS | 5445-51-2 |
| Molecular Weight (g/mol) | 144.13 |
| ChEBI | CHEBI:35691 |
| MDL Number | MFCD00001325 |
| SMILES | C1CC(C1)(C(=O)O)C(=O)O |
| Synonym | 1,1-cyclobutanedicarboxylic acid,h2cbdca,1,1-cyclobutanedicarboxylicacid,cyclobutanedicarboxylic acid,1,1-cyclobutane dicarboxylic acid,1,1-cyclobutanedicarboxylate,cyclobutanedicarbonic acid,zlchem 254,pubchem14151,acmc-1am73 |
| IUPAC Name | cyclobutane-1,1-dicarboxylic acid |
| InChI Key | CCQPAEQGAVNNIA-UHFFFAOYSA-N |
| Molecular Formula | C6H8O4 |
Dextran, for biochemistry, high fraction
CAS: 9004-54-0 Molecular Formula: (C6H9O5)n(C6H10O5)m Molecular Weight (g/mol): 504.44 MDL Number: MFCD00130935 InChI Key: FZWBNHMXJMCXLU-UHFFFAOYNA-N Synonym: dextran,dextran, mw-86.000 aver.,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydro-2h-pyran-2-yl oxy methyl tetrahydro-2h-pyran-2-yl oxy hexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxymethyl oxan-2-yl oxyhexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxymethyl tetrahydropyran-2-yl oxy-hexanal PubChem CID: 4125253 IUPAC Name: Dextran SMILES: O[C@@H]1[C@@H](O)[C@@H](-*)O[C@H](CO[C@H]2O[C@H](CO-*)[C@@H](O)[C@H](O-*)[C@H]2O)[C@H]1O
| PubChem CID | 4125253 |
|---|---|
| CAS | 9004-54-0 |
| Molecular Weight (g/mol) | 504.44 |
| MDL Number | MFCD00130935 |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](-*)O[C@H](CO[C@H]2O[C@H](CO-*)[C@@H](O)[C@H](O-*)[C@H]2O)[C@H]1O |
| Synonym | dextran,dextran, mw-86.000 aver.,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydro-2h-pyran-2-yl oxy methyl tetrahydro-2h-pyran-2-yl oxy hexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxymethyl oxan-2-yl oxyhexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxymethyl tetrahydropyran-2-yl oxy-hexanal |
| IUPAC Name | Dextran |
| InChI Key | FZWBNHMXJMCXLU-UHFFFAOYNA-N |
| Molecular Formula | (C6H9O5)n(C6H10O5)m |
trans-1,2-Cyclohexanediol, 97%
CAS: 1460-57-7 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00063611 InChI Key: PFURGBBHAOXLIO-PHDIDXHHSA-N Synonym: trans-1,2-cyclohexanediol,trans-cyclohexane-1,2-diol,1r,2r-cyclohexane-1,2-diol,1r,2r-trans-1,2-cyclohexanediol,1,2-cyclohexanediol, 1r,2r-rel,trans-1,2-dihydroxycyclohexane,1,2-cyclohexanediol, trans,l6tj aq bq & trans,trans-1,2-cyclohexandiol,1r,2r-1,2-cyclohexanediol PubChem CID: 92886 ChEBI: CHEBI:16931 IUPAC Name: (1R,2R)-cyclohexane-1,2-diol SMILES: O[C@@H]1CCCC[C@H]1O
| PubChem CID | 92886 |
|---|---|
| CAS | 1460-57-7 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:16931 |
| MDL Number | MFCD00063611 |
| SMILES | O[C@@H]1CCCC[C@H]1O |
| Synonym | trans-1,2-cyclohexanediol,trans-cyclohexane-1,2-diol,1r,2r-cyclohexane-1,2-diol,1r,2r-trans-1,2-cyclohexanediol,1,2-cyclohexanediol, 1r,2r-rel,trans-1,2-dihydroxycyclohexane,1,2-cyclohexanediol, trans,l6tj aq bq & trans,trans-1,2-cyclohexandiol,1r,2r-1,2-cyclohexanediol |
| IUPAC Name | (1R,2R)-cyclohexane-1,2-diol |
| InChI Key | PFURGBBHAOXLIO-PHDIDXHHSA-N |
| Molecular Formula | C6H12O2 |
Tetraethylammonium tetrafluoroborate, 99%
CAS: 429-06-1 Molecular Formula: C8H20BF4N Molecular Weight (g/mol): 217.06 MDL Number: MFCD00011827 InChI Key: XJRAKUDXACGCHA-UHFFFAOYSA-N Synonym: tetraethylammonium tetrafluoroborate,tetraethylazanium tetrafluoroborate,tetraethylammoniumtetrafluoroborate,acmc-1ago3,ksc238k1t,ethanaminium, n,n,n-triethyl-, tetrafluoroborate 1-,ethanaminium, n,n,n-triethyl-, tetrafluoroborate 1-1:1,tetraethyl ammonium tetrafluoroborate,tetraethylammonium tetra fluoro borate PubChem CID: 2724277 SMILES: F[B-](F)(F)F.CC[N+](CC)(CC)CC
| PubChem CID | 2724277 |
|---|---|
| CAS | 429-06-1 |
| Molecular Weight (g/mol) | 217.06 |
| MDL Number | MFCD00011827 |
| SMILES | F[B-](F)(F)F.CC[N+](CC)(CC)CC |
| Synonym | tetraethylammonium tetrafluoroborate,tetraethylazanium tetrafluoroborate,tetraethylammoniumtetrafluoroborate,acmc-1ago3,ksc238k1t,ethanaminium, n,n,n-triethyl-, tetrafluoroborate 1-,ethanaminium, n,n,n-triethyl-, tetrafluoroborate 1-1:1,tetraethyl ammonium tetrafluoroborate,tetraethylammonium tetra fluoro borate |
| InChI Key | XJRAKUDXACGCHA-UHFFFAOYSA-N |
| Molecular Formula | C8H20BF4N |
Decafluorobiphenyl, 99%
CAS: 434-90-2 Molecular Formula: C12F10 Molecular Weight (g/mol): 334.12 MDL Number: MFCD00000292 InChI Key: ONUFSRWQCKNVSL-UHFFFAOYSA-N Synonym: decafluorobiphenyl,perfluorobiphenyl,biphenyl, decafluoro,perfluorodiphenyl,1,1'-biphenyl, 2,2',3,3',4,4',5,5',6,6'-decafluoro,1,2,3,4,5-pentafluoro-6-2,3,4,5,6-pentafluorophenyl benzene,decafluoro biphenyl,pubchem9114,acmc-1ctuw PubChem CID: 67949 IUPAC Name: 1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene SMILES: C1(=C(C(=C(C(=C1F)F)F)F)F)C2=C(C(=C(C(=C2F)F)F)F)F
| PubChem CID | 67949 |
|---|---|
| CAS | 434-90-2 |
| Molecular Weight (g/mol) | 334.12 |
| MDL Number | MFCD00000292 |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)C2=C(C(=C(C(=C2F)F)F)F)F |
| Synonym | decafluorobiphenyl,perfluorobiphenyl,biphenyl, decafluoro,perfluorodiphenyl,1,1'-biphenyl, 2,2',3,3',4,4',5,5',6,6'-decafluoro,1,2,3,4,5-pentafluoro-6-2,3,4,5,6-pentafluorophenyl benzene,decafluoro biphenyl,pubchem9114,acmc-1ctuw |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene |
| InChI Key | ONUFSRWQCKNVSL-UHFFFAOYSA-N |
| Molecular Formula | C12F10 |
Methyl p-tolyl sulfoxide, 98%
CAS: 934-72-5 Molecular Formula: C8H10OS Molecular Weight (g/mol): 154.23 MDL Number: MFCD00075175 InChI Key: FEVALTJSQBFLEU-UHFFFAOYNA-N Synonym: 1-methyl-4-methylsulfinyl benzene,methyl 4-methylphenylsulfoxide,methyl p-tolyl sulfoxide,1-methanesulfinyl-4-methylbenzene,methyl p-methylphenylsulfoxide,1-methyl-4-methylsulphinyl benzene,benzene, 1-methyl-4-methylsulfinyl,acmc-20aotg,acmc-20apjq,methyl p-tolylsulfoxide PubChem CID: 136743 IUPAC Name: 1-methyl-4-methylsulfinylbenzene SMILES: CC1=CC=C(C=C1)S(C)=O
| PubChem CID | 136743 |
|---|---|
| CAS | 934-72-5 |
| Molecular Weight (g/mol) | 154.23 |
| MDL Number | MFCD00075175 |
| SMILES | CC1=CC=C(C=C1)S(C)=O |
| Synonym | 1-methyl-4-methylsulfinyl benzene,methyl 4-methylphenylsulfoxide,methyl p-tolyl sulfoxide,1-methanesulfinyl-4-methylbenzene,methyl p-methylphenylsulfoxide,1-methyl-4-methylsulphinyl benzene,benzene, 1-methyl-4-methylsulfinyl,acmc-20aotg,acmc-20apjq,methyl p-tolylsulfoxide |
| IUPAC Name | 1-methyl-4-methylsulfinylbenzene |
| InChI Key | FEVALTJSQBFLEU-UHFFFAOYNA-N |
| Molecular Formula | C8H10OS |
4-Acetylpyridine, 98%
CAS: 1122-54-9 Molecular Formula: C7H7NO Molecular Weight (g/mol): 121.14 MDL Number: MFCD00006433 InChI Key: WMQUKDQWMMOHSA-UHFFFAOYSA-N Synonym: 4-acetylpyridine,methyl 4-pyridyl ketone,ethanone, 1-4-pyridinyl,ketone, methyl 4-pyridyl,1-pyridin-4-yl ethan-1-one,1-pyridin-4-yl ethanone,pyridine, 4-acetyl,4-acetyl pyridine,4-pyridyl methyl ketone,unii-g47437iow7 PubChem CID: 14282 IUPAC Name: 1-pyridin-4-ylethanone SMILES: CC(=O)C1=CC=NC=C1
| PubChem CID | 14282 |
|---|---|
| CAS | 1122-54-9 |
| Molecular Weight (g/mol) | 121.14 |
| MDL Number | MFCD00006433 |
| SMILES | CC(=O)C1=CC=NC=C1 |
| Synonym | 4-acetylpyridine,methyl 4-pyridyl ketone,ethanone, 1-4-pyridinyl,ketone, methyl 4-pyridyl,1-pyridin-4-yl ethan-1-one,1-pyridin-4-yl ethanone,pyridine, 4-acetyl,4-acetyl pyridine,4-pyridyl methyl ketone,unii-g47437iow7 |
| IUPAC Name | 1-pyridin-4-ylethanone |
| InChI Key | WMQUKDQWMMOHSA-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO |
2-Amino-3-bromopyridine, 98%
CAS: 13534-99-1 Molecular Formula: C5H5BrN2 Molecular Weight (g/mol): 173.01 MDL Number: MFCD03095187 InChI Key: RBCARPJOEUEZLS-UHFFFAOYSA-N Synonym: 2-amino-3-bromopyridine,3-bromo-2-pyridinamine,2-pyridinamine, 3-bromo,3-bromo-2-pyridylamine,3-bromo-pyridin-2-ylamine,3-bromanylpyridin-2-amine,bromo-aminopyridine,bromopyridin-2-amine,pubchem1241,3-bromo-2-aminopyridine PubChem CID: 817700 IUPAC Name: 3-bromopyridin-2-amine SMILES: C1=CC(=C(N=C1)N)Br
| PubChem CID | 817700 |
|---|---|
| CAS | 13534-99-1 |
| Molecular Weight (g/mol) | 173.01 |
| MDL Number | MFCD03095187 |
| SMILES | C1=CC(=C(N=C1)N)Br |
| Synonym | 2-amino-3-bromopyridine,3-bromo-2-pyridinamine,2-pyridinamine, 3-bromo,3-bromo-2-pyridylamine,3-bromo-pyridin-2-ylamine,3-bromanylpyridin-2-amine,bromo-aminopyridine,bromopyridin-2-amine,pubchem1241,3-bromo-2-aminopyridine |
| IUPAC Name | 3-bromopyridin-2-amine |
| InChI Key | RBCARPJOEUEZLS-UHFFFAOYSA-N |
| Molecular Formula | C5H5BrN2 |
Thermo Scientific Chemicals 2'-Deoxyguanosine 5'-monophosphate, sodium salt hydrate, 99%
CAS: 52558-16-4 Molecular Formula: C10H12N5Na2O7P Molecular Weight (g/mol): 391.19 MDL Number: MFCD00150780 InChI Key: CTPAMSRBXKGZCJ-WJQTVUBHNA-L Synonym: deoxyguanosine monophosphate tetrahydrate sodium salt PubChem CID: 131854716 IUPAC Name: [(2R,3S,5R)-5-(2-amino-6-oxo-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate;sodium;tetrahydrate SMILES: [Na+].[Na+].NC1=NC2=C(N=CN2[C@H]2C[C@H](O)[C@@H](COP([O-])([O-])=O)O2)C(=O)N1
| PubChem CID | 131854716 |
|---|---|
| CAS | 52558-16-4 |
| Molecular Weight (g/mol) | 391.19 |
| MDL Number | MFCD00150780 |
| SMILES | [Na+].[Na+].NC1=NC2=C(N=CN2[C@H]2C[C@H](O)[C@@H](COP([O-])([O-])=O)O2)C(=O)N1 |
| Synonym | deoxyguanosine monophosphate tetrahydrate sodium salt |
| IUPAC Name | [(2R,3S,5R)-5-(2-amino-6-oxo-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate;sodium;tetrahydrate |
| InChI Key | CTPAMSRBXKGZCJ-WJQTVUBHNA-L |
| Molecular Formula | C10H12N5Na2O7P |
Chloroacetic acid, 99%, flakes
CAS: 79-11-8 Molecular Formula: C2H3ClO2 Molecular Weight (g/mol): 94.5 MDL Number: MFCD00002683 InChI Key: FOCAUTSVDIKZOP-UHFFFAOYSA-N Synonym: chloroacetic acid,monochloroacetic acid,chloracetic acid,acetic acid, chloro,acide chloracetique,chloroethanoic acid,monochloroethanoic acid,monochloracetic acid,monochloorazijnzuur,monochloressigsaeure PubChem CID: 300 ChEBI: CHEBI:27869 IUPAC Name: 2-chloroacetic acid SMILES: C(C(=O)O)Cl
| PubChem CID | 300 |
|---|---|
| CAS | 79-11-8 |
| Molecular Weight (g/mol) | 94.5 |
| ChEBI | CHEBI:27869 |
| MDL Number | MFCD00002683 |
| SMILES | C(C(=O)O)Cl |
| Synonym | chloroacetic acid,monochloroacetic acid,chloracetic acid,acetic acid, chloro,acide chloracetique,chloroethanoic acid,monochloroethanoic acid,monochloracetic acid,monochloorazijnzuur,monochloressigsaeure |
| IUPAC Name | 2-chloroacetic acid |
| InChI Key | FOCAUTSVDIKZOP-UHFFFAOYSA-N |
| Molecular Formula | C2H3ClO2 |