Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Copper(I) trifluoromethanesulfonate toluene complex (2:1), 98%
CAS: 48209-28-5 Molecular Formula: C9H8Cu2F6O6S2 Molecular Weight (g/mol): 517.359 MDL Number: MFCD01863766 InChI Key: ATUUSMBCJWYMEG-UHFFFAOYSA-L Synonym: copper i trifluoromethanesulfonate toluene complex,cuotf-toluene,copper i triflate toluene complex,cuprous trifluoromethanesulfonate toluene complex,trifluoromethanesulfonic acid copper i salt toluene complex,copper i trifluoromethanesulfonate toluene complex 2:1 PubChem CID: 11656500 IUPAC Name: copper(1+);toluene;trifluoromethanesulfonate SMILES: CC1=CC=CC=C1.C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Cu+].[Cu+]
| PubChem CID | 11656500 |
|---|---|
| CAS | 48209-28-5 |
| Molecular Weight (g/mol) | 517.359 |
| MDL Number | MFCD01863766 |
| SMILES | CC1=CC=CC=C1.C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Cu+].[Cu+] |
| Synonym | copper i trifluoromethanesulfonate toluene complex,cuotf-toluene,copper i triflate toluene complex,cuprous trifluoromethanesulfonate toluene complex,trifluoromethanesulfonic acid copper i salt toluene complex,copper i trifluoromethanesulfonate toluene complex 2:1 |
| IUPAC Name | copper(1+);toluene;trifluoromethanesulfonate |
| InChI Key | ATUUSMBCJWYMEG-UHFFFAOYSA-L |
| Molecular Formula | C9H8Cu2F6O6S2 |
3-(1H-Tetrazol-5-yl)phenol, 97%
CAS: 96859-34-6 Molecular Formula: C7H6N4O Molecular Weight (g/mol): 162.15 MDL Number: MFCD06797247 InChI Key: IZORRBUQWFSCII-UHFFFAOYSA-N Synonym: 3-1h-tetrazol-5-yl phenol,5-3-hydroxyphenyl tetrazole,3-2h-tetrazol-5-yl phenol,3-2h-1,2,3,4-tetrazol-5-yl phenol,3-1h-1,2,3,4-tetrazol-5-yl phenol,m-tetrazolylphenol,3-2h-tetrazol-5-yl-phenol,5-3-hydroxyphenyl-1h-tetrazole PubChem CID: 13455763 SMILES: OC1=CC=CC(=C1)C1=NNN=N1
| PubChem CID | 13455763 |
|---|---|
| CAS | 96859-34-6 |
| Molecular Weight (g/mol) | 162.15 |
| MDL Number | MFCD06797247 |
| SMILES | OC1=CC=CC(=C1)C1=NNN=N1 |
| Synonym | 3-1h-tetrazol-5-yl phenol,5-3-hydroxyphenyl tetrazole,3-2h-tetrazol-5-yl phenol,3-2h-1,2,3,4-tetrazol-5-yl phenol,3-1h-1,2,3,4-tetrazol-5-yl phenol,m-tetrazolylphenol,3-2h-tetrazol-5-yl-phenol,5-3-hydroxyphenyl-1h-tetrazole |
| InChI Key | IZORRBUQWFSCII-UHFFFAOYSA-N |
| Molecular Formula | C7H6N4O |
4-Bromothiazole, 97%
CAS: 34259-99-9 Molecular Formula: C3H2BrNS Molecular Weight (g/mol): 164.02 MDL Number: MFCD06657592 InChI Key: VDTIGYKLTROQAH-UHFFFAOYSA-N Synonym: 4-bromothiazole,4-bromo-thiazole,4-bromo thiazole,thiazole, 4-bromo,4-bromothiazol,zlchem 498,pubchem4040,ksc222g1h PubChem CID: 2763218 IUPAC Name: 4-bromo-1,3-thiazole SMILES: BrC1=CSC=N1
| PubChem CID | 2763218 |
|---|---|
| CAS | 34259-99-9 |
| Molecular Weight (g/mol) | 164.02 |
| MDL Number | MFCD06657592 |
| SMILES | BrC1=CSC=N1 |
| Synonym | 4-bromothiazole,4-bromo-thiazole,4-bromo thiazole,thiazole, 4-bromo,4-bromothiazol,zlchem 498,pubchem4040,ksc222g1h |
| IUPAC Name | 4-bromo-1,3-thiazole |
| InChI Key | VDTIGYKLTROQAH-UHFFFAOYSA-N |
| Molecular Formula | C3H2BrNS |
4-Chloro-3-methylpyridine hydrochloride, 97%, Thermo Scientific Chemicals
CAS: 19524-08-4 Molecular Formula: C6H7Cl2N Molecular Weight (g/mol): 164.029 MDL Number: MFCD03092890 InChI Key: WPIUSHWGBZMBHZ-UHFFFAOYSA-N Synonym: 4-chloro-3-methylpyridine hydrochloride,4-chloro-3-picoline hcl,4-chloro-3-methylpyridine hcl,4-chloro-3-picoline hydrochloride,pyridine, 4-chloro-3-methyl-, hydrochloride,4-chloro-3-methylpyridinehydrochloride,acmc-20amlc,pubchem9218,ksc495e6r,4-chloro-3methylpyridine hydrochloride PubChem CID: 16217655 IUPAC Name: 4-chloro-3-methylpyridine;hydrochloride SMILES: CC1=C(C=CN=C1)Cl.Cl
| PubChem CID | 16217655 |
|---|---|
| CAS | 19524-08-4 |
| Molecular Weight (g/mol) | 164.029 |
| MDL Number | MFCD03092890 |
| SMILES | CC1=C(C=CN=C1)Cl.Cl |
| Synonym | 4-chloro-3-methylpyridine hydrochloride,4-chloro-3-picoline hcl,4-chloro-3-methylpyridine hcl,4-chloro-3-picoline hydrochloride,pyridine, 4-chloro-3-methyl-, hydrochloride,4-chloro-3-methylpyridinehydrochloride,acmc-20amlc,pubchem9218,ksc495e6r,4-chloro-3methylpyridine hydrochloride |
| IUPAC Name | 4-chloro-3-methylpyridine;hydrochloride |
| InChI Key | WPIUSHWGBZMBHZ-UHFFFAOYSA-N |
| Molecular Formula | C6H7Cl2N |
4-Fluoro-2-methylbenzenesulfonyl chloride, 97%
CAS: 7079-48-3 Molecular Formula: C7H6ClFO2S Molecular Weight (g/mol): 208.631 MDL Number: MFCD03094390 InChI Key: XLPGWKNCWMFHOD-UHFFFAOYSA-N Synonym: 4-fluoro-2-methylbenzene-1-sulfonyl chloride,4-fluoro-2-methylbenzenesulfonylchloride,4-fluoro-2-methylbenzenesulphonyl chloride,4-fluoro-2-methyl-benzenesulfonyl chloride,chloro 4-fluoro-2-methylphenyl sulfone,pubchem11719,ablock ab-12-8862,4-fluoro-2-methylphenylsulfonyl chloride,4-fluoro-2-methylbenzene-1-sulfonylchloride,benzenesulfonylchloride, 4-fluoro-2-methyl PubChem CID: 2778602 IUPAC Name: 4-fluoro-2-methylbenzenesulfonyl chloride SMILES: CC1=C(C=CC(=C1)F)S(=O)(=O)Cl
| PubChem CID | 2778602 |
|---|---|
| CAS | 7079-48-3 |
| Molecular Weight (g/mol) | 208.631 |
| MDL Number | MFCD03094390 |
| SMILES | CC1=C(C=CC(=C1)F)S(=O)(=O)Cl |
| Synonym | 4-fluoro-2-methylbenzene-1-sulfonyl chloride,4-fluoro-2-methylbenzenesulfonylchloride,4-fluoro-2-methylbenzenesulphonyl chloride,4-fluoro-2-methyl-benzenesulfonyl chloride,chloro 4-fluoro-2-methylphenyl sulfone,pubchem11719,ablock ab-12-8862,4-fluoro-2-methylphenylsulfonyl chloride,4-fluoro-2-methylbenzene-1-sulfonylchloride,benzenesulfonylchloride, 4-fluoro-2-methyl |
| IUPAC Name | 4-fluoro-2-methylbenzenesulfonyl chloride |
| InChI Key | XLPGWKNCWMFHOD-UHFFFAOYSA-N |
| Molecular Formula | C7H6ClFO2S |
Polydimethylsiloxane, trimethylsiloxy terminated, M.W. 14,000
CAS: 9016-00-6 Molecular Formula: (C2H6OSi)n Molecular Weight (g/mol): 74.15 MDL Number: MFCD00084411 InChI Key: SEUDSDUUJXTXSV-UHFFFAOYSA-N IUPAC Name: dimethylsilanone SMILES: C[Si](C)(-*)O-*
| CAS | 9016-00-6 |
|---|---|
| Molecular Weight (g/mol) | 74.15 |
| MDL Number | MFCD00084411 |
| SMILES | C[Si](C)(-*)O-* |
| IUPAC Name | dimethylsilanone |
| InChI Key | SEUDSDUUJXTXSV-UHFFFAOYSA-N |
| Molecular Formula | (C2H6OSi)n |
3-Bromobenzeneboronic acid, 98+%
CAS: 89598-96-9 Molecular Formula: C6H6BBrO2 Molecular Weight (g/mol): 200.83 MDL Number: MFCD00239386 InChI Key: AFSSVCNPDKKSRR-UHFFFAOYSA-N Synonym: 3-bromophenyl boronic acid,3-bromobenzeneboronic acid,3-bromophenylboronicacid,boronic acid, 3-bromophenyl,pubchem1758,3-bromo-phenylboronic acid,acmc-209r1w,3-bromo-benzeneboronic acid,3-bromobenzene boronic acid PubChem CID: 2734318 IUPAC Name: (3-bromophenyl)boronic acid SMILES: OB(O)C1=CC=CC(Br)=C1
| PubChem CID | 2734318 |
|---|---|
| CAS | 89598-96-9 |
| Molecular Weight (g/mol) | 200.83 |
| MDL Number | MFCD00239386 |
| SMILES | OB(O)C1=CC=CC(Br)=C1 |
| Synonym | 3-bromophenyl boronic acid,3-bromobenzeneboronic acid,3-bromophenylboronicacid,boronic acid, 3-bromophenyl,pubchem1758,3-bromo-phenylboronic acid,acmc-209r1w,3-bromo-benzeneboronic acid,3-bromobenzene boronic acid |
| IUPAC Name | (3-bromophenyl)boronic acid |
| InChI Key | AFSSVCNPDKKSRR-UHFFFAOYSA-N |
| Molecular Formula | C6H6BBrO2 |
4-n-Butoxybenzeneboronic acid, 98%
CAS: 105365-51-3 Molecular Formula: C10H15BO3 Molecular Weight (g/mol): 194.04 MDL Number: MFCD03427054 InChI Key: QUPFQMXWFNJUNJ-UHFFFAOYSA-N Synonym: 4-n-butoxyphenylboronic acid,4-butoxyphenyl boronic acid,4-n-butoxyphenyl boronic acid,p-butoxyphenylboronic acid,4-butyloxyphenylboronic acid,4-n-butoxy benzeneboronic acid,4-butoxymethylboronic acid,boronic acid, 4-butoxyphenyl,pubchem9549,4-butoxybenzeneboronic acid PubChem CID: 3836310 IUPAC Name: (4-butoxyphenyl)boronic acid SMILES: CCCCOC1=CC=C(C=C1)B(O)O
| PubChem CID | 3836310 |
|---|---|
| CAS | 105365-51-3 |
| Molecular Weight (g/mol) | 194.04 |
| MDL Number | MFCD03427054 |
| SMILES | CCCCOC1=CC=C(C=C1)B(O)O |
| Synonym | 4-n-butoxyphenylboronic acid,4-butoxyphenyl boronic acid,4-n-butoxyphenyl boronic acid,p-butoxyphenylboronic acid,4-butyloxyphenylboronic acid,4-n-butoxy benzeneboronic acid,4-butoxymethylboronic acid,boronic acid, 4-butoxyphenyl,pubchem9549,4-butoxybenzeneboronic acid |
| IUPAC Name | (4-butoxyphenyl)boronic acid |
| InChI Key | QUPFQMXWFNJUNJ-UHFFFAOYSA-N |
| Molecular Formula | C10H15BO3 |
N-Boc-4-bromoaniline, 97%
CAS: 131818-17-2 Molecular Formula: C11H14BrNO2 Molecular Weight (g/mol): 272.14 MDL Number: MFCD01006612 InChI Key: VLGPDTPSKUUHKR-UHFFFAOYSA-N Synonym: tert-butyl 4-bromophenyl carbamate,tert-butyl n-4-bromophenyl carbamate,tert-butyl 4-bromophenylcarbamate,n-boc-4-bromoaniline,n-tert-butoxycarbonyl-4-bromoaniline,metronidazolebenzoate,n-boc 4-bromoaniline,4-bromo-n-boc aniline,acmc-1c4z5,t-butyl 4-bromophenylcarbamate PubChem CID: 2773608 IUPAC Name: tert-butyl N-(4-bromophenyl)carbamate SMILES: CC(C)(C)OC(=O)NC1=CC=C(Br)C=C1
| PubChem CID | 2773608 |
|---|---|
| CAS | 131818-17-2 |
| Molecular Weight (g/mol) | 272.14 |
| MDL Number | MFCD01006612 |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(Br)C=C1 |
| Synonym | tert-butyl 4-bromophenyl carbamate,tert-butyl n-4-bromophenyl carbamate,tert-butyl 4-bromophenylcarbamate,n-boc-4-bromoaniline,n-tert-butoxycarbonyl-4-bromoaniline,metronidazolebenzoate,n-boc 4-bromoaniline,4-bromo-n-boc aniline,acmc-1c4z5,t-butyl 4-bromophenylcarbamate |
| IUPAC Name | tert-butyl N-(4-bromophenyl)carbamate |
| InChI Key | VLGPDTPSKUUHKR-UHFFFAOYSA-N |
| Molecular Formula | C11H14BrNO2 |
5,6-Dichloropyridine-2-carboxylic acid, 98%
CAS: 88912-24-7 Molecular Formula: C6H3Cl2NO2 Molecular Weight (g/mol): 191.995 MDL Number: MFCD13185546 InChI Key: QOJNAEPFSUYAFL-UHFFFAOYSA-N Synonym: 5,6-dichloropicolinic acid,5,6-dichloro-2-pyridinecarboxylic acid,2-pyridinecarboxylic acid, 5,6-dichloro,2,3-dichloro-6-carboxypyridine,2-pyridinecarboxylicacid, 5,6-dichloro,acmc-209vdz,2,3-dichloro-6-pyridinecarboxylicacid,5,6-dichloro-pyridine-2-carboxylic acid PubChem CID: 13278016 IUPAC Name: 5,6-dichloropyridine-2-carboxylic acid SMILES: C1=CC(=NC(=C1Cl)Cl)C(=O)O
| PubChem CID | 13278016 |
|---|---|
| CAS | 88912-24-7 |
| Molecular Weight (g/mol) | 191.995 |
| MDL Number | MFCD13185546 |
| SMILES | C1=CC(=NC(=C1Cl)Cl)C(=O)O |
| Synonym | 5,6-dichloropicolinic acid,5,6-dichloro-2-pyridinecarboxylic acid,2-pyridinecarboxylic acid, 5,6-dichloro,2,3-dichloro-6-carboxypyridine,2-pyridinecarboxylicacid, 5,6-dichloro,acmc-209vdz,2,3-dichloro-6-pyridinecarboxylicacid,5,6-dichloro-pyridine-2-carboxylic acid |
| IUPAC Name | 5,6-dichloropyridine-2-carboxylic acid |
| InChI Key | QOJNAEPFSUYAFL-UHFFFAOYSA-N |
| Molecular Formula | C6H3Cl2NO2 |
4-Chloro-2-fluoropyridine, 95%
CAS: 34941-92-9 Molecular Formula: C5H3ClFN Molecular Weight (g/mol): 131.534 MDL Number: MFCD04112503 InChI Key: GNJKJKBURMCLOR-UHFFFAOYSA-N Synonym: 2-fluoro-4-chloropyridine,4-chloro-2-fluoro-pyridine,pyridine, 4-chloro-2-fluoro,pubchem13535,pyridine,4-chloro-2-fluoro PubChem CID: 2762839 IUPAC Name: 4-chloro-2-fluoropyridine SMILES: C1=CN=C(C=C1Cl)F
| PubChem CID | 2762839 |
|---|---|
| CAS | 34941-92-9 |
| Molecular Weight (g/mol) | 131.534 |
| MDL Number | MFCD04112503 |
| SMILES | C1=CN=C(C=C1Cl)F |
| Synonym | 2-fluoro-4-chloropyridine,4-chloro-2-fluoro-pyridine,pyridine, 4-chloro-2-fluoro,pubchem13535,pyridine,4-chloro-2-fluoro |
| IUPAC Name | 4-chloro-2-fluoropyridine |
| InChI Key | GNJKJKBURMCLOR-UHFFFAOYSA-N |
| Molecular Formula | C5H3ClFN |
1,6-Bis(diphenylphosphino)hexane, 97%
CAS: 19845-69-3 Molecular Formula: C30H32P2 Molecular Weight (g/mol): 454.53 MDL Number: MFCD00003053 InChI Key: GPORFKPYXATYNX-UHFFFAOYSA-N Synonym: 1,6-bis diphenylphosphino hexane,6-diphenylphosphanylhexyl diphenyl phosphane,hexamethylenebis diphenylphosphine,phosphine, 1,6-hexanediylbis diphenyl,phosphine,1,1'-1,6-hexanediyl bis 1,1-diphenyl,6-diphenylphosphanyl hexyl diphenylphosphane,acmc-1ca9e,ksc491k2l,1,6-bis diphenylphosino hexane PubChem CID: 2754312 IUPAC Name: 6-diphenylphosphanylhexyl(diphenyl)phosphane SMILES: C(CCCP(C1=CC=CC=C1)C1=CC=CC=C1)CCP(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 2754312 |
|---|---|
| CAS | 19845-69-3 |
| Molecular Weight (g/mol) | 454.53 |
| MDL Number | MFCD00003053 |
| SMILES | C(CCCP(C1=CC=CC=C1)C1=CC=CC=C1)CCP(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 1,6-bis diphenylphosphino hexane,6-diphenylphosphanylhexyl diphenyl phosphane,hexamethylenebis diphenylphosphine,phosphine, 1,6-hexanediylbis diphenyl,phosphine,1,1'-1,6-hexanediyl bis 1,1-diphenyl,6-diphenylphosphanyl hexyl diphenylphosphane,acmc-1ca9e,ksc491k2l,1,6-bis diphenylphosino hexane |
| IUPAC Name | 6-diphenylphosphanylhexyl(diphenyl)phosphane |
| InChI Key | GPORFKPYXATYNX-UHFFFAOYSA-N |
| Molecular Formula | C30H32P2 |
5-Bromo-2,3-difluoropyridine, 97%
CAS: 89402-44-8 Molecular Formula: C5H2BrF2N Molecular Weight (g/mol): 193.98 MDL Number: MFCD06659525 InChI Key: QVIQXJRQVOPYGI-UHFFFAOYSA-N PubChem CID: 14549654 IUPAC Name: 5-bromo-2,3-difluoropyridine SMILES: FC1=CC(Br)=CN=C1F
| PubChem CID | 14549654 |
|---|---|
| CAS | 89402-44-8 |
| Molecular Weight (g/mol) | 193.98 |
| MDL Number | MFCD06659525 |
| SMILES | FC1=CC(Br)=CN=C1F |
| IUPAC Name | 5-bromo-2,3-difluoropyridine |
| InChI Key | QVIQXJRQVOPYGI-UHFFFAOYSA-N |
| Molecular Formula | C5H2BrF2N |
Diethylbenzene, mixture of isomers
CAS: 25340-17-4 Molecular Formula: C10H14 MDL Number: MFCD00792900 Synonym: Dowex J
| CAS | 25340-17-4 |
|---|---|
| MDL Number | MFCD00792900 |
| Synonym | Dowex J |
| Molecular Formula | C10H14 |
Carboplatin
CAS: 41575-94-4 Molecular Formula: C6H12N2O4Pt Molecular Weight (g/mol): 371.26 MDL Number: MFCD00070464 InChI Key: BHKICZDKIIDMNR-UHFFFAOYSA-L Synonym: carboplatin PubChem CID: 122130863 IUPAC Name: azanide;cyclobutane-1,1-dicarboxylate;platinum(4+) SMILES: N.N.O=C1O[Pt++]OC(=O)C11CCC1
| PubChem CID | 122130863 |
|---|---|
| CAS | 41575-94-4 |
| Molecular Weight (g/mol) | 371.26 |
| MDL Number | MFCD00070464 |
| SMILES | N.N.O=C1O[Pt++]OC(=O)C11CCC1 |
| Synonym | carboplatin |
| IUPAC Name | azanide;cyclobutane-1,1-dicarboxylate;platinum(4+) |
| InChI Key | BHKICZDKIIDMNR-UHFFFAOYSA-L |
| Molecular Formula | C6H12N2O4Pt |