Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Dimethyl Sulfoxide-d6, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| CAS | 2206-27-1 |
|---|---|
| Molecular Weight (g/mol) | 84.17 |
| InChI Formula | InChI=1S/C2H6OS/c1-4(2)3/h1-2H3/i1D3,2D3 |
| Chemical Name or Material | Dimethyl Sulfoxide-d6 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | Sulfinylbismethane-d3,(Methyl Sulfoxide)-d6,Bis(trideuteriomethyl) Sulfoxide,Bis(trideuteromethyl) Sulfoxide,DMSO-d6,Deuterated-DMSO,Di(methyl-d3) Sulfoxide,Dimethyl-d6 Sulfoxide,Hexadeuteriodimethyl Sulfoxide,Perdeuterated Dimethyl Sulfoxide,Perdeuteriodimethyl Sulfoxide,Sulfinylbis(methane-d3) |
| Recommended Storage | +4°C |
| IUPAC Name | trideuterio(trideuteriomethylsulfinyl)methane |
| Molecular Formula | C2 2H6 O S |
| Formula Weight | 84.0516 |
Dimethyl Sulfoxide (13C2, 99%), TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
Dimethyl Sulfoxide (13C2, 99%), TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
Dimethyl Sulfoxide (13C2, 99%), TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
Trametinib (DMSO solvate), MedChemExpress
MedChemExpress Trametinib (DMSO solvate) (GSK-1120212 (DMSO solvate);JTP-74057 (DMSO solvate)) is an orally active MEK inhibitor that inhibits MEK1 and MEK2 with IC50s of about 2 nM. Trametinib (DMSO solvate) activates autophagy and induces apoptosis.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Molecular Weight (g/mol) | 693.53 |
|---|---|
| Color | Off-White |
| Physical Form | Solid |
| Chemical Name or Material | Trametinib (DMSO solvate) |
| Grade | Research |
| SMILES | CN1C(C(C)=C(N(C(N(C2=O)C3CC3)=O)C4=CC=CC(NC(C)=O)=C4)C2=C1NC5=CC=C(C=C5F)I)=O.CS(C)=O |
| For Use With (Application) | Cancer-Kinase/protease |
| Percent Purity | 98.51% |
| CAS | 1187431-43-1 |
| Solubility Information | DMSO : 69 mg/mL (99.49 mM; Need ultrasonic) |
| Synonym | GSK-1120212 (DMSO solvate) JTP-74057 (DMSO solvate) |
| Purity Grade Notes | Research |
| Recommended Storage | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Shelf Life | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Molecular Formula | C28H29FIN5O5S |
| Formula Weight | 693.53 |
Taurine, 99%
CAS: 107-35-7 Molecular Formula: C2H7NO3S Molecular Weight (g/mol): 125.14 MDL Number: MFCD00008197 InChI Key: XOAAWQZATWQOTB-UHFFFAOYSA-N Synonym: taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid PubChem CID: 1123 ChEBI: CHEBI:15891 IUPAC Name: 2-aminoethanesulfonic acid SMILES: NCCS(O)(=O)=O
| PubChem CID | 1123 |
|---|---|
| CAS | 107-35-7 |
| Molecular Weight (g/mol) | 125.14 |
| ChEBI | CHEBI:15891 |
| MDL Number | MFCD00008197 |
| SMILES | NCCS(O)(=O)=O |
| Synonym | taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid |
| IUPAC Name | 2-aminoethanesulfonic acid |
| InChI Key | XOAAWQZATWQOTB-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO3S |
beta-Carotene, 99%
CAS: 7235-40-7 Molecular Formula: C40H56 Molecular Weight (g/mol): 536.89 MDL Number: MFCD00001556 InChI Key: OENHQHLEOONYIE-JLTXGRSLSA-N Synonym: beta-carotene,beta carotene,betacarotene,beta,beta-carotene,provitamin a,solatene,carotaben,provatene,all-trans-beta-carotene,serlabo PubChem CID: 5280489 ChEBI: CHEBI:17579 IUPAC Name: 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene SMILES: C\C(\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(C)CCCC1(C)C
| PubChem CID | 5280489 |
|---|---|
| CAS | 7235-40-7 |
| Molecular Weight (g/mol) | 536.89 |
| ChEBI | CHEBI:17579 |
| MDL Number | MFCD00001556 |
| SMILES | C\C(\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(C)CCCC1(C)C |
| Synonym | beta-carotene,beta carotene,betacarotene,beta,beta-carotene,provitamin a,solatene,carotaben,provatene,all-trans-beta-carotene,serlabo |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene |
| InChI Key | OENHQHLEOONYIE-JLTXGRSLSA-N |
| Molecular Formula | C40H56 |
D-(+)-Biotin, 98+%
CAS: 58-85-5 Molecular Formula: C10H16N2O3S Molecular Weight (g/mol): 244.31 MDL Number: MFCD00005541 InChI Key: YBJHBAHKTGYVGT-UHFFFAOYNA-N Synonym: biotin,d-biotin,vitamin h,coenzyme r,vitamin b7,bios ii,factor s,bioepiderm,d +-biotin,biodermatin PubChem CID: 171548 ChEBI: CHEBI:15956 IUPAC Name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid SMILES: OC(=O)CCCCC1SCC2NC(=O)NC12
| PubChem CID | 171548 |
|---|---|
| CAS | 58-85-5 |
| Molecular Weight (g/mol) | 244.31 |
| ChEBI | CHEBI:15956 |
| MDL Number | MFCD00005541 |
| SMILES | OC(=O)CCCCC1SCC2NC(=O)NC12 |
| Synonym | biotin,d-biotin,vitamin h,coenzyme r,vitamin b7,bios ii,factor s,bioepiderm,d +-biotin,biodermatin |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid |
| InChI Key | YBJHBAHKTGYVGT-UHFFFAOYNA-N |
| Molecular Formula | C10H16N2O3S |
L-Glutathione, reduced, 98+%
CAS: 70-18-8 Molecular Formula: C10H17N3O6S Molecular Weight (g/mol): 307.321 MDL Number: MFCD00065939 InChI Key: RWSXRVCMGQZWBV-WDSKDSINSA-N Synonym: glutathione,l-glutathione,glutathion,glutathione-sh,glutinal,isethion,tathion,reduced glutathione,deltathione,neuthion PubChem CID: 124886 ChEBI: CHEBI:16856 IUPAC Name: (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid SMILES: C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N
| PubChem CID | 124886 |
|---|---|
| CAS | 70-18-8 |
| Molecular Weight (g/mol) | 307.321 |
| ChEBI | CHEBI:16856 |
| MDL Number | MFCD00065939 |
| SMILES | C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N |
| Synonym | glutathione,l-glutathione,glutathion,glutathione-sh,glutinal,isethion,tathion,reduced glutathione,deltathione,neuthion |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| InChI Key | RWSXRVCMGQZWBV-WDSKDSINSA-N |
| Molecular Formula | C10H17N3O6S |
Riboflavin, 98%
CAS: 83-88-5 Molecular Formula: C17H20N4O6 Molecular Weight (g/mol): 376.37 MDL Number: MFCD00005022 InChI Key: AUNGANRZJHBGPY-QTZZOOGMNA-N Synonym: riboflavin,vitamin b2,lactoflavin,riboflavine,vitamin g,lactoflavine,--riboflavin,beflavin,beflavine,flavaxin PubChem CID: 71310809 IUPAC Name: 7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione SMILES: CC1=C(C)C=C2N(C[C@H](O)[C@H](O)[C@H](O)CO)C3=NC(=O)NC(=O)C3=NC2=C1
| PubChem CID | 71310809 |
|---|---|
| CAS | 83-88-5 |
| Molecular Weight (g/mol) | 376.37 |
| MDL Number | MFCD00005022 |
| SMILES | CC1=C(C)C=C2N(C[C@H](O)[C@H](O)[C@H](O)CO)C3=NC(=O)NC(=O)C3=NC2=C1 |
| Synonym | riboflavin,vitamin b2,lactoflavin,riboflavine,vitamin g,lactoflavine,--riboflavin,beflavin,beflavine,flavaxin |
| IUPAC Name | 7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione |
| InChI Key | AUNGANRZJHBGPY-QTZZOOGMNA-N |
| Molecular Formula | C17H20N4O6 |
Hydroxyurea, 98%
CAS: 127-07-1 Molecular Formula: CH4N2O2 Molecular Weight (g/mol): 76.055 MDL Number: MFCD00007943 InChI Key: VSNHCAURESNICA-UHFFFAOYSA-N Synonym: hydroxycarbamide,n-hydroxyurea,hydrea,1-hydroxyurea,oxyurea,carbamoyl oxime,biosupressin,hydroxycarbamine,onco-carbide,carbamohydroxamic acid PubChem CID: 3657 ChEBI: CHEBI:44423 IUPAC Name: hydroxyurea SMILES: C(=O)(N)NO
| PubChem CID | 3657 |
|---|---|
| CAS | 127-07-1 |
| Molecular Weight (g/mol) | 76.055 |
| ChEBI | CHEBI:44423 |
| MDL Number | MFCD00007943 |
| SMILES | C(=O)(N)NO |
| Synonym | hydroxycarbamide,n-hydroxyurea,hydrea,1-hydroxyurea,oxyurea,carbamoyl oxime,biosupressin,hydroxycarbamine,onco-carbide,carbamohydroxamic acid |
| IUPAC Name | hydroxyurea |
| InChI Key | VSNHCAURESNICA-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O2 |
Thermo Scientific Chemicals Phenolphthalein, 98%
CAS: 77-09-8 Molecular Formula: C20H14O4 Molecular Weight (g/mol): 318.33 MDL Number: MFCD00005913 InChI Key: KJFMBFZCATUALV-UHFFFAOYSA-N Synonym: phenolphthalein,phthalimetten,euchessina,phthalin,espotabs,phenolax,purgophen,koprol,laxogen,trilax PubChem CID: 4764 ChEBI: CHEBI:34914 SMILES: OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1
| PubChem CID | 4764 |
|---|---|
| CAS | 77-09-8 |
| Molecular Weight (g/mol) | 318.33 |
| ChEBI | CHEBI:34914 |
| MDL Number | MFCD00005913 |
| SMILES | OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 |
| Synonym | phenolphthalein,phthalimetten,euchessina,phthalin,espotabs,phenolax,purgophen,koprol,laxogen,trilax |
| InChI Key | KJFMBFZCATUALV-UHFFFAOYSA-N |
| Molecular Formula | C20H14O4 |
Ethyl palmitate, 97%
CAS: 628-97-7 Molecular Formula: C18H36O2 Molecular Weight (g/mol): 284.48 MDL Number: MFCD00008996 InChI Key: XIRNKXNNONJFQO-UHFFFAOYSA-N Synonym: ethyl palmitate,hexadecanoic acid, ethyl ester,palmitic acid ethyl ester,ethyl cetylate,palmitic acid, ethyl ester,ethylpalmitate,unii-ird3m534zm,hexadecanoic acid ethyl ester,ethyl n-hexadecanoate,ird3m534zm PubChem CID: 12366 ChEBI: CHEBI:84932 IUPAC Name: ethyl hexadecanoate SMILES: CCCCCCCCCCCCCCCC(=O)OCC
| PubChem CID | 12366 |
|---|---|
| CAS | 628-97-7 |
| Molecular Weight (g/mol) | 284.48 |
| ChEBI | CHEBI:84932 |
| MDL Number | MFCD00008996 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCC |
| Synonym | ethyl palmitate,hexadecanoic acid, ethyl ester,palmitic acid ethyl ester,ethyl cetylate,palmitic acid, ethyl ester,ethylpalmitate,unii-ird3m534zm,hexadecanoic acid ethyl ester,ethyl n-hexadecanoate,ird3m534zm |
| IUPAC Name | ethyl hexadecanoate |
| InChI Key | XIRNKXNNONJFQO-UHFFFAOYSA-N |
| Molecular Formula | C18H36O2 |
Dopamine hydrochloride, 99%
CAS: 62-31-7 Molecular Formula: C8H12ClNO2 Molecular Weight (g/mol): 189.64 MDL Number: MFCD00012898 InChI Key: CTENFNNZBMHDDG-UHFFFAOYSA-N Synonym: dopamine hydrochloride,3-hydroxytyramine hydrochloride,dopamine hcl,4-2-aminoethyl benzene-1,2-diol hydrochloride,intropin,dopastat,revivan,dynatra,3,4-dihydroxyphenethylamine hydrochloride,cardiosteril PubChem CID: 65340 IUPAC Name: 4-(2-aminoethyl)benzene-1,2-diol;hydrochloride SMILES: [H+].[Cl-].NCCC1=CC=C(O)C(O)=C1
| PubChem CID | 65340 |
|---|---|
| CAS | 62-31-7 |
| Molecular Weight (g/mol) | 189.64 |
| MDL Number | MFCD00012898 |
| SMILES | [H+].[Cl-].NCCC1=CC=C(O)C(O)=C1 |
| Synonym | dopamine hydrochloride,3-hydroxytyramine hydrochloride,dopamine hcl,4-2-aminoethyl benzene-1,2-diol hydrochloride,intropin,dopastat,revivan,dynatra,3,4-dihydroxyphenethylamine hydrochloride,cardiosteril |
| IUPAC Name | 4-(2-aminoethyl)benzene-1,2-diol;hydrochloride |
| InChI Key | CTENFNNZBMHDDG-UHFFFAOYSA-N |
| Molecular Formula | C8H12ClNO2 |