Inorganic Salts
Filtered Search Results
Sodium Thiosulfate Solution 0.1M (0.1N), NIST Standard Solution Ready To Use, for Volumetric Analysis, Fisher Chemical™
CAS: 7772-98-7 Molecular Formula: Na2O3S2 Molecular Weight (g/mol): 158.10 MDL Number: MFCD00003499 InChI Key: AKHNMLFCWUSKQB-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium sulfanidesulfonate SMILES: [Na+].[Na+].[O-]S([S-])(=O)=O
| PubChem CID | 61475 |
|---|---|
| CAS | 7772-98-7 |
| Molecular Weight (g/mol) | 158.10 |
| ChEBI | CHEBI:32150 |
| MDL Number | MFCD00003499 |
| SMILES | [Na+].[Na+].[O-]S([S-])(=O)=O |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium sulfanidesulfonate |
| InChI Key | AKHNMLFCWUSKQB-UHFFFAOYSA-L |
| Molecular Formula | Na2O3S2 |
Potassium hydrogen phthalate, primary standard, ACS, 99.95-100.05%
CAS: 877-24-7 Molecular Formula: C8H5KO4 Molecular Weight (g/mol): 204.222 MDL Number: MFCD00013070 InChI Key: IWZKICVEHNUQTL-UHFFFAOYSA-M Synonym: potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic PubChem CID: 23676735 IUPAC Name: potassium;2-carboxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+]
| PubChem CID | 23676735 |
|---|---|
| CAS | 877-24-7 |
| Molecular Weight (g/mol) | 204.222 |
| MDL Number | MFCD00013070 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| Synonym | potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic |
| IUPAC Name | potassium;2-carboxybenzoate |
| InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
| Molecular Formula | C8H5KO4 |
Iodine, 0.1N (0.05M) standard solution
CAS: 7553-56-2 Molecular Formula: I2 Molecular Weight (g/mol): 253.81 MDL Number: MFCD00011355 MFCD00164163 InChI Key: PNDPGZBMCMUPRI-UHFFFAOYSA-N Synonym: iodine,diiodine,iodine crystals,iodine sublimed,tincture iodine,vistarin,eranol,iodio,iodine solution,iode PubChem CID: 807 ChEBI: CHEBI:17606 IUPAC Name: diiodine SMILES: II
| PubChem CID | 807 |
|---|---|
| CAS | 7553-56-2 |
| Molecular Weight (g/mol) | 253.81 |
| ChEBI | CHEBI:17606 |
| MDL Number | MFCD00011355 MFCD00164163 |
| SMILES | II |
| Synonym | iodine,diiodine,iodine crystals,iodine sublimed,tincture iodine,vistarin,eranol,iodio,iodine solution,iode |
| IUPAC Name | diiodine |
| InChI Key | PNDPGZBMCMUPRI-UHFFFAOYSA-N |
| Molecular Formula | I2 |
Calcium carbonate, chelometric standard, ACS, 99.95-100.05%
CAS: 471-34-1 Molecular Formula: CCaO3 Molecular Weight (g/mol): 100.09 MDL Number: MFCD00010906 InChI Key: VTYYLEPIZMXCLO-UHFFFAOYSA-L Synonym: calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama PubChem CID: 10112 ChEBI: CHEBI:3311 SMILES: [Ca++].[O-]C([O-])=O
| PubChem CID | 10112 |
|---|---|
| CAS | 471-34-1 |
| Molecular Weight (g/mol) | 100.09 |
| ChEBI | CHEBI:3311 |
| MDL Number | MFCD00010906 |
| SMILES | [Ca++].[O-]C([O-])=O |
| Synonym | calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama |
| InChI Key | VTYYLEPIZMXCLO-UHFFFAOYSA-L |
| Molecular Formula | CCaO3 |
| Linear Formula | Na2S2O3 |
|---|---|
| Molecular Weight (g/mol) | 158.10 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Sodium thiosulfate |
| SMILES | [Na+].[Na+].[O-]S([S-])(=O)=O |
| Merck Index | 15, 8821 |
| InChI Key | AKHNMLFCWUSKQB-UHFFFAOYSA-L |
| PubChem CID | 24477 |
| Concentration or Composition (by Analyte or Components) | 0.0950 to 0.1050N (20°C) |
| CAS | 7732-18-5 |
| MDL Number | MFCD00003499 |
| Health Hazard 1 | |
| Synonym | sodium thiosulfate,sodium thiosulphate,disodium thiosulfate,sodium thiosulfate anhydrous,hypo,sodiumthiosulfate,chlorine cure,chlorine control,declor-it,thiosulfuric acid, disodium salt |
| Molecular Formula | Na2O3S2 |
| Formula Weight | 158.11 |
Ethylenediaminetetraacetic Acid Disodium Salt Solution 0.01M (0.02N), NIST Standard Solution ready to use, for volumetric analysis, Fisher Chemical™
CAS: 139-33-3 Molecular Formula: C10H14N2Na2O8 Molecular Weight (g/mol): 336.21 MDL Number: MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 InChI Key: ZGTMUACCHSMWAC-UHFFFAOYSA-L Synonym: ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid PubChem CID: 57339238 ChEBI: CHEBI:64734 IUPAC Name: disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate SMILES: [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 57339238 |
|---|---|
| CAS | 139-33-3 |
| Molecular Weight (g/mol) | 336.21 |
| ChEBI | CHEBI:64734 |
| MDL Number | MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 |
| SMILES | [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid |
| IUPAC Name | disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate |
| InChI Key | ZGTMUACCHSMWAC-UHFFFAOYSA-L |
| Molecular Formula | C10H14N2Na2O8 |
Ethylenediaminetetraacetic Acid Trisodium Salt Solution 0.1M (0.2N), NIST Standard Concentrate, for volumetric analysis, Fisher Chemical™
CAS: 150-38-9 Molecular Formula: C10H19N2Na3O11 Molecular Weight (g/mol): 412.23 MDL Number: MFCD00149685,MFCD02253006 (.3H2O) InChI Key: FXNQQEVEDZAAJM-UHFFFAOYSA-K Synonym: ethylenediaminetetraacetic acid trisodium salt,trisodium ethylene diamine tetraacetic acid PubChem CID: 131711402 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;sodium SMILES: O.O.O.[Na+].[Na+].[Na+].OC(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 131711402 |
|---|---|
| CAS | 150-38-9 |
| Molecular Weight (g/mol) | 412.23 |
| MDL Number | MFCD00149685,MFCD02253006 (.3H2O) |
| SMILES | O.O.O.[Na+].[Na+].[Na+].OC(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | ethylenediaminetetraacetic acid trisodium salt,trisodium ethylene diamine tetraacetic acid |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;sodium |
| InChI Key | FXNQQEVEDZAAJM-UHFFFAOYSA-K |
| Molecular Formula | C10H19N2Na3O11 |
Sodium Thiosulfate Solution 0.1M (0.1N), NIST Standard Solution Ready To Use, for Volumetric Analysis, Fisher Chemical™
H10Na2O8S2, CAS Number-10102-17-7, ametox, antichlor, ccris 3952, disodium thiosulfate pentahydrate, sodium hyposulfite pentahydrate, sodium thiosulfate pentahydrate, sodium thiosulfate, pentahydrate, thiosulfuric acid, disodium salt, pentahydrate, tinver, unii-hx1032v43m, 1L, CHEBI:32150 | CAS: 10102-17-7 | H10Na2O8S2 | 248.172 g/mol
Sodium thiosulfate, 0.1N Standardized Solution
CAS: 7772-98-7 Molecular Formula: Na2O3S2 Molecular Weight (g/mol): 158.10 MDL Number: MFCD00003499 InChI Key: AKHNMLFCWUSKQB-UHFFFAOYSA-L Synonym: sodium thiosulfate,sodium thiosulphate,disodium thiosulfate,sodium thiosulfate anhydrous,hypo,sodiumthiosulfate,chlorine cure,chlorine control,declor-it,thiosulfuric acid, disodium salt PubChem CID: 24477 SMILES: [Na+].[Na+].[O-]S([S-])(=O)=O
| PubChem CID | 24477 |
|---|---|
| CAS | 7772-98-7 |
| Molecular Weight (g/mol) | 158.10 |
| MDL Number | MFCD00003499 |
| SMILES | [Na+].[Na+].[O-]S([S-])(=O)=O |
| Synonym | sodium thiosulfate,sodium thiosulphate,disodium thiosulfate,sodium thiosulfate anhydrous,hypo,sodiumthiosulfate,chlorine cure,chlorine control,declor-it,thiosulfuric acid, disodium salt |
| InChI Key | AKHNMLFCWUSKQB-UHFFFAOYSA-L |
| Molecular Formula | Na2O3S2 |
| Linear Formula | AgNO3 |
|---|---|
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Density | 1.0150g/mL |
| PubChem CID | 24470 |
| Name Note | 0.1 N Standard Solution |
| Fieser | 01,1008; 02,366; 03,252; 04,429; 05,582; 07,321; 09,411; 10,350; 11,268; 12,257; 14,350; 15,39 |
| Formula Weight | 169.87 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Silver nitrate |
| Grade | Pure |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Merck Index | 15, 8657 |
| Concentration or Composition (by Analyte or Components) | 0.0998 to 0.1002N (20°C) |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF ON SKIN: Wash with plenty of soap and water. If skin irritation occurs: Get medical advice/attention. IF IN EYES: Rinse cautiously with wa |
| MDL Number | MFCD00003414 |
| Health Hazard 2 | GHS H Statement May be corrosive to metals. Causes skin irritation. Causes serious eye irritation. Very toxic to aquatic life with long lasting effects. |
| Packaging | HDPE Bottle |
| Solubility Information | Solubility in water: miscible. |
| Health Hazard 1 | GHS Signal Word: Warning |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| Molecular Formula | AgNO3 |
| EINECS Number | 231-853-9 |
| Specific Gravity | 1.015 |
Potassium thiocyanate, 0.1N Standardized Solution
CAS: 333-20-0 Molecular Formula: CKNS Molecular Weight (g/mol): 97.176 MDL Number: MFCD00011413 InChI Key: ZNNZYHKDIALBAK-UHFFFAOYSA-M Synonym: potassium thiocyanate,potassium rhodanate,potassium rhodanide,rodanca,potassium sulfocyanate,rhodanide,rhocya,potassium thiocyanide,kscn,thiocyanic acid, potassium salt PubChem CID: 516872 ChEBI: CHEBI:30951 IUPAC Name: potassium;thiocyanate SMILES: C(#N)[S-].[K+]
| PubChem CID | 516872 |
|---|---|
| CAS | 333-20-0 |
| Molecular Weight (g/mol) | 97.176 |
| ChEBI | CHEBI:30951 |
| MDL Number | MFCD00011413 |
| SMILES | C(#N)[S-].[K+] |
| Synonym | potassium thiocyanate,potassium rhodanate,potassium rhodanide,rodanca,potassium sulfocyanate,rhodanide,rhocya,potassium thiocyanide,kscn,thiocyanic acid, potassium salt |
| IUPAC Name | potassium;thiocyanate |
| InChI Key | ZNNZYHKDIALBAK-UHFFFAOYSA-M |
| Molecular Formula | CKNS |
Sodium arsenite, 0.1N Standardized Solution
CAS: 7784-46-5 Molecular Formula: AsNaO2 Molecular Weight (g/mol): 129.909 MDL Number: MFCD00003472 InChI Key: PTLRDCMBXHILCL-UHFFFAOYSA-M Synonym: sodium arsenite,sodium metaarsenite,sodium dioxoarsenate,prodalumnol,sodanit,penite,kill-all,prodalumnol double,rat death liquid,chem pels c PubChem CID: 443495 ChEBI: CHEBI:29678 IUPAC Name: sodium;oxoarsinite SMILES: [O-][As]=O.[Na+]
| PubChem CID | 443495 |
|---|---|
| CAS | 7784-46-5 |
| Molecular Weight (g/mol) | 129.909 |
| ChEBI | CHEBI:29678 |
| MDL Number | MFCD00003472 |
| SMILES | [O-][As]=O.[Na+] |
| Synonym | sodium arsenite,sodium metaarsenite,sodium dioxoarsenate,prodalumnol,sodanit,penite,kill-all,prodalumnol double,rat death liquid,chem pels c |
| IUPAC Name | sodium;oxoarsinite |
| InChI Key | PTLRDCMBXHILCL-UHFFFAOYSA-M |
| Molecular Formula | AsNaO2 |
| Packaging | Plastic bottle |
|---|---|
| Physical Form | Liquid |
| Chemical Name or Material | Ringer's Solution |
| Synonym | dihydrogen oxide,dihydrogen monoxide |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |