Benzenoids
Filtered Search Results
3-Chloroperoxybenzoic Acid, 70-75%, balance 3-Chlorobenzoic Acid and water
3-Chloroperoxybenzoic acid, 70-75%, C7H5ClO3, CAS Number-937-14-4, 535-80-8, 7732-18-5 | CAS: 937-14-4 | C7H5ClO3 | 172.56 g/mol
| Linear Formula | ClC6H4CO3H |
|---|---|
| Molecular Weight (g/mol) | 172.56 |
| ChEBI | CHEBI:52091 |
| CAS Min % | 25.0 |
| InChI Key | NHQDETIJWKXCTC-UHFFFAOYSA-N |
| Density | 0.5600g/mL |
| PubChem CID | 70297 |
| Name Note | 70 - 75% |
| Percent Purity | 70-75% |
| Fieser | 01,135; 02,68; 03,49; 04,85; 05,120; 06,110; 07,62; 08,97; 09,108; 10,92; 11,122; 12,118; 13,76; 15,86; 16,80; 17,76 |
| RTECS Number | SD9470000 |
| Formula Weight | 172.57 |
| Melting Point | 92.0°C to 94.0°C |
| CAS Max % | 30.0 |
| Color | White |
| Physical Form | Moist Powder |
| SMILES | OOC(=O)C1=CC=CC(Cl)=C1 |
| Merck Index | 15,2154 |
| Assay Percent Range | di-m-Chlorobenzoyl peroxide: < 0.1% Typical (HPLC) |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Keep/Store away from clothing/ combustible materials. IF SWALLOWED: rin |
| MDL Number | MFCD00002127 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. Heating may cause a fire. |
| Solubility Information | Solubility in water: insoluble. Other solubilities: soluble in koh, soluble in chloroform and acetone |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | 3-chloroperoxybenzoic acid,3-chloroperbenzoic acid,mcpba,m-chloroperbenzoic acid,m-chloroperoxybenzoic acid,meta-chloroperoxybenzoic acid,benzenecarboperoxoic acid, 3-chloro,m-chlorobenzoyl hydroperoxide,meta-chloroperbenzoic acid,3-chlorobenzoperoxoic acid |
| TSCA | TSCA |
| IUPAC Name | 3-chlorobenzenecarboperoxoic acid |
| Beilstein | 09,IV,972 |
| Molecular Formula | C7H5ClO3 |
| EINECS Number | 213-322-3 |
| Specific Gravity | 0.56 |
1,4-Naphthoquinone, 99%, contains up to 6% water
CAS: 130-15-4 Molecular Formula: C10H6O2 Molecular Weight (g/mol): 158.16 MDL Number: MFCD00001676 InChI Key: FRASJONUBLZVQX-UHFFFAOYSA-N Synonym: 1,4-naphthoquinone,1,4-naphthalenedione,p-naphthoquinone,naphthoquinone,alpha-naphthoquinone,1,4-naphthylquinone,usaf cy-10,1,4-dihydronaphthalene-1,4-dione,1,4-dihydro-1,4-diketonaphthalene,1,4-naftochinon PubChem CID: 8530 ChEBI: CHEBI:27418 IUPAC Name: naphthalene-1,4-dione SMILES: C1=CC=C2C(=O)C=CC(=O)C2=C1
| PubChem CID | 8530 |
|---|---|
| CAS | 130-15-4 |
| Molecular Weight (g/mol) | 158.16 |
| ChEBI | CHEBI:27418 |
| MDL Number | MFCD00001676 |
| SMILES | C1=CC=C2C(=O)C=CC(=O)C2=C1 |
| Synonym | 1,4-naphthoquinone,1,4-naphthalenedione,p-naphthoquinone,naphthoquinone,alpha-naphthoquinone,1,4-naphthylquinone,usaf cy-10,1,4-dihydronaphthalene-1,4-dione,1,4-dihydro-1,4-diketonaphthalene,1,4-naftochinon |
| IUPAC Name | naphthalene-1,4-dione |
| InChI Key | FRASJONUBLZVQX-UHFFFAOYSA-N |
| Molecular Formula | C10H6O2 |
Hematoxylin hydrate, 80% (dry wt.), water <8%
CAS: 517-28-2 Molecular Formula: C16H14O6 Molecular Weight (g/mol): 302.28 MDL Number: MFCD00078111 InChI Key: WZUVPPKBWHMQCE-WKTCHCBJNA-N Synonym: hematoxylin,hydroxybrasilin PubChem CID: 45029742 IUPAC Name: (6aR)-7,11b-dihydro-6H-indeno[2,1-c]chromene-3,4,6a,9,10-pentol SMILES: [H][C@]12C3=C(C[C@@]1(O)COC1=C2C=CC(O)=C1O)C=C(O)C(O)=C3
| PubChem CID | 45029742 |
|---|---|
| CAS | 517-28-2 |
| Molecular Weight (g/mol) | 302.28 |
| MDL Number | MFCD00078111 |
| SMILES | [H][C@]12C3=C(C[C@@]1(O)COC1=C2C=CC(O)=C1O)C=C(O)C(O)=C3 |
| Synonym | hematoxylin,hydroxybrasilin |
| IUPAC Name | (6aR)-7,11b-dihydro-6H-indeno[2,1-c]chromene-3,4,6a,9,10-pentol |
| InChI Key | WZUVPPKBWHMQCE-WKTCHCBJNA-N |
| Molecular Formula | C16H14O6 |
Dibenzoyl peroxide, 97% (dry wt.), wet with 25% water
CAS: 94-36-0 Molecular Formula: C14H10O4 Molecular Weight (g/mol): 242.23 MDL Number: MFCD00003071 InChI Key: OMPJBNCRMGITSC-UHFFFAOYSA-N Synonym: benzoyl peroxide,dibenzoyl peroxide,peroxide, dibenzoyl,benzoperoxide,benzoyl superoxide,acetoxyl,lucidol,benoxyl,panoxyl,benzol peroxide PubChem CID: 7187 ChEBI: CHEBI:82405 IUPAC Name: benzoyl benzenecarboperoxoate SMILES: C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2
| PubChem CID | 7187 |
|---|---|
| CAS | 94-36-0 |
| Molecular Weight (g/mol) | 242.23 |
| ChEBI | CHEBI:82405 |
| MDL Number | MFCD00003071 |
| SMILES | C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2 |
| Synonym | benzoyl peroxide,dibenzoyl peroxide,peroxide, dibenzoyl,benzoperoxide,benzoyl superoxide,acetoxyl,lucidol,benoxyl,panoxyl,benzol peroxide |
| IUPAC Name | benzoyl benzenecarboperoxoate |
| InChI Key | OMPJBNCRMGITSC-UHFFFAOYSA-N |
| Molecular Formula | C14H10O4 |
Sodium tetrakis[3,5-bis(trifluoromethyl)phenyl]borate, 97%, may cont. 1-5% water
CAS: 79060-88-1 Molecular Formula: C32H12BF24Na Molecular Weight (g/mol): 886.209 MDL Number: MFCD00043323 InChI Key: LTGMONZOZHXAHO-UHFFFAOYSA-N Synonym: sodium tetrakis 3,5-bis trifluoromethyl phenyl borate,nabarf,sodium tetrakis 3,5-bis trifluoromethyl phenyl boranuide,sodium2-sulfonatoethylmethacrylate,sodium tetrakis 3,5-bis trifluoromethyl phenyl bor,sodium tetrakis 3,5-bis-trifluoromethylphenyl borate,sodiotetrakis 3,5-bis trifluoromethyl phenyl boron v,sodium tetrakis 3,5-bis trifluoromethyl phenyl-borate,sodium tetrakis 3,5-bis trifluoromethyl phenyl borate 1- PubChem CID: 23681909 IUPAC Name: sodium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide SMILES: [B-](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)(C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)(C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)C4=CC(=CC(=C4)C(F)(F)F)C(F)(F)F.[Na+]
| PubChem CID | 23681909 |
|---|---|
| CAS | 79060-88-1 |
| Molecular Weight (g/mol) | 886.209 |
| MDL Number | MFCD00043323 |
| SMILES | [B-](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)(C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)(C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)C4=CC(=CC(=C4)C(F)(F)F)C(F)(F)F.[Na+] |
| Synonym | sodium tetrakis 3,5-bis trifluoromethyl phenyl borate,nabarf,sodium tetrakis 3,5-bis trifluoromethyl phenyl boranuide,sodium2-sulfonatoethylmethacrylate,sodium tetrakis 3,5-bis trifluoromethyl phenyl bor,sodium tetrakis 3,5-bis-trifluoromethylphenyl borate,sodiotetrakis 3,5-bis trifluoromethyl phenyl boron v,sodium tetrakis 3,5-bis trifluoromethyl phenyl-borate,sodium tetrakis 3,5-bis trifluoromethyl phenyl borate 1- |
| IUPAC Name | sodium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
| InChI Key | LTGMONZOZHXAHO-UHFFFAOYSA-N |
| Molecular Formula | C32H12BF24Na |
1,4-Naphthoquinone, 97+% (dry wt.), cont. up to 5% water
CAS: 130-15-4 Molecular Formula: C10H6O2 Molecular Weight (g/mol): 158.156 MDL Number: MFCD00001676 InChI Key: FRASJONUBLZVQX-UHFFFAOYSA-N Synonym: 1,4-naphthoquinone,1,4-naphthalenedione,p-naphthoquinone,naphthoquinone,alpha-naphthoquinone,1,4-naphthylquinone,usaf cy-10,1,4-dihydronaphthalene-1,4-dione,1,4-dihydro-1,4-diketonaphthalene,1,4-naftochinon PubChem CID: 8530 ChEBI: CHEBI:27418 IUPAC Name: naphthalene-1,4-dione SMILES: C1=CC=C2C(=O)C=CC(=O)C2=C1
| PubChem CID | 8530 |
|---|---|
| CAS | 130-15-4 |
| Molecular Weight (g/mol) | 158.156 |
| ChEBI | CHEBI:27418 |
| MDL Number | MFCD00001676 |
| SMILES | C1=CC=C2C(=O)C=CC(=O)C2=C1 |
| Synonym | 1,4-naphthoquinone,1,4-naphthalenedione,p-naphthoquinone,naphthoquinone,alpha-naphthoquinone,1,4-naphthylquinone,usaf cy-10,1,4-dihydronaphthalene-1,4-dione,1,4-dihydro-1,4-diketonaphthalene,1,4-naftochinon |
| IUPAC Name | naphthalene-1,4-dione |
| InChI Key | FRASJONUBLZVQX-UHFFFAOYSA-N |
| Molecular Formula | C10H6O2 |
(Formylmethylene)triphenylphosphorane, 97%, may cont. up to ca 3% water
CAS: 2136-75-6 Molecular Formula: C20H17OP Molecular Weight (g/mol): 304.329 MDL Number: MFCD00006994 InChI Key: CQCAYWAIRTVXIY-UHFFFAOYSA-N Synonym: 2-triphenylphosphoranylidene acetaldehyde,formylmethylene triphenylphosphorane,triphenylphosphoranylidene acetaldehyde,formylmethylenetriphenylphosphorane,acetaldehyde, triphenylphosphoranylidene,2-triphenyl-??-phosphanylidene acetaldehyde,acmc-209fjg,ksc492c5l PubChem CID: 75051 IUPAC Name: 2-(triphenyl-$l^{5}-phosphanylidene)acetaldehyde SMILES: C1=CC=C(C=C1)P(=CC=O)(C2=CC=CC=C2)C3=CC=CC=C3
| PubChem CID | 75051 |
|---|---|
| CAS | 2136-75-6 |
| Molecular Weight (g/mol) | 304.329 |
| MDL Number | MFCD00006994 |
| SMILES | C1=CC=C(C=C1)P(=CC=O)(C2=CC=CC=C2)C3=CC=CC=C3 |
| Synonym | 2-triphenylphosphoranylidene acetaldehyde,formylmethylene triphenylphosphorane,triphenylphosphoranylidene acetaldehyde,formylmethylenetriphenylphosphorane,acetaldehyde, triphenylphosphoranylidene,2-triphenyl-??-phosphanylidene acetaldehyde,acmc-209fjg,ksc492c5l |
| IUPAC Name | 2-(triphenyl-$l^{5}-phosphanylidene)acetaldehyde |
| InChI Key | CQCAYWAIRTVXIY-UHFFFAOYSA-N |
| Molecular Formula | C20H17OP |
2,4-Dinitroaniline, 99% (dry wt.), cont. up to 15% water
CAS: 97-02-9 Molecular Formula: C6H5N3O4 Molecular Weight (g/mol): 183.12 MDL Number: MFCD00007151 InChI Key: LXQOQPGNCGEELI-UHFFFAOYSA-N Synonym: benzenamine, 2,4-dinitro,1-amino-2,4-dinitrobenzene,2,4-dinitroanilin,2,4-dinitrobenzenamine,2,4-dinitroanilina,2,4-dinitraniline,2,4-dinitrophenylamine,aniline, 2,4-dinitro,2,4-dinitroaminobenzene,2,4-nitroaniline PubChem CID: 7321 ChEBI: CHEBI:34242 IUPAC Name: 2,4-dinitroaniline SMILES: NC1=CC=C(C=C1[N+]([O-])=O)[N+]([O-])=O
| PubChem CID | 7321 |
|---|---|
| CAS | 97-02-9 |
| Molecular Weight (g/mol) | 183.12 |
| ChEBI | CHEBI:34242 |
| MDL Number | MFCD00007151 |
| SMILES | NC1=CC=C(C=C1[N+]([O-])=O)[N+]([O-])=O |
| Synonym | benzenamine, 2,4-dinitro,1-amino-2,4-dinitrobenzene,2,4-dinitroanilin,2,4-dinitrobenzenamine,2,4-dinitroanilina,2,4-dinitraniline,2,4-dinitrophenylamine,aniline, 2,4-dinitro,2,4-dinitroaminobenzene,2,4-nitroaniline |
| IUPAC Name | 2,4-dinitroaniline |
| InChI Key | LXQOQPGNCGEELI-UHFFFAOYSA-N |
| Molecular Formula | C6H5N3O4 |
Ellagic acid hydrate, 97%, may cont. up to 12% water
CAS: 476-66-4 Molecular Formula: C14H6O8 Molecular Weight (g/mol): 302.19 MDL Number: MFCD00006914 InChI Key: AFSDNFLWKVMVRB-UHFFFAOYSA-N Synonym: ellagic acid,benzoaric acid,lagistase,eleagic acid,alizarine yellow,elagostasine,2,3,7,8-tetrahydroxychromeno 5,4,3-cde chromene-5,10-dione,ellagic acid dihydrate,llagic acid,acide ellagique PubChem CID: 5281855 ChEBI: CHEBI:4775 IUPAC Name: 6,7,13,14-tetrahydroxy-2,9-dioxatetracyclo[6.6.2.0⁴,¹⁶.0¹¹,¹⁵]hexadeca-1(15),4(16),5,7,11,13-hexaene-3,10-dione SMILES: OC1=CC2=C3C(OC(=O)C4=CC(O)=C(O)C(OC2=O)=C34)=C1O
| PubChem CID | 5281855 |
|---|---|
| CAS | 476-66-4 |
| Molecular Weight (g/mol) | 302.19 |
| ChEBI | CHEBI:4775 |
| MDL Number | MFCD00006914 |
| SMILES | OC1=CC2=C3C(OC(=O)C4=CC(O)=C(O)C(OC2=O)=C34)=C1O |
| Synonym | ellagic acid,benzoaric acid,lagistase,eleagic acid,alizarine yellow,elagostasine,2,3,7,8-tetrahydroxychromeno 5,4,3-cde chromene-5,10-dione,ellagic acid dihydrate,llagic acid,acide ellagique |
| IUPAC Name | 6,7,13,14-tetrahydroxy-2,9-dioxatetracyclo[6.6.2.0⁴,¹⁶.0¹¹,¹⁵]hexadeca-1(15),4(16),5,7,11,13-hexaene-3,10-dione |
| InChI Key | AFSDNFLWKVMVRB-UHFFFAOYSA-N |
| Molecular Formula | C14H6O8 |
Bis(triphenylphosphoranylidene)ammonium chloride, 97% (dry wt.), water <3%
CAS: 21050-13-5 Molecular Formula: C36H30ClNP2 Molecular Weight (g/mol): 574.04 MDL Number: MFCD00151523 InChI Key: LVRCYPYRKNAAMX-UHFFFAOYSA-M Synonym: 1,1,1-triphenyl-n-triphenylphosphoranylidene phosphoraniminium chloride,bis triphenylphosphoranylidene ammonium chloride,bis triphenylphosphoranylidene ammonium,triphenyl p,p,p-triphenylphosphine imidato-n phosphorus 1+ tetracarbonylcobaltate 1-,bis triphenylphosphine iminium chloride∼ppncl,ppn chloride,ppn cl,ksc491c1r,parent,triphenyl p,p,p-triphenylphosphine imidato phosphorus 1+ chloride PubChem CID: 3036656 IUPAC Name: triphenyl-[(triphenyl-$l^{5}-phosphanylidene)amino]phosphanium;chloride SMILES: [Cl-].C1=CC=C(C=C1)P(=[N+]=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 3036656 |
|---|---|
| CAS | 21050-13-5 |
| Molecular Weight (g/mol) | 574.04 |
| MDL Number | MFCD00151523 |
| SMILES | [Cl-].C1=CC=C(C=C1)P(=[N+]=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 1,1,1-triphenyl-n-triphenylphosphoranylidene phosphoraniminium chloride,bis triphenylphosphoranylidene ammonium chloride,bis triphenylphosphoranylidene ammonium,triphenyl p,p,p-triphenylphosphine imidato-n phosphorus 1+ tetracarbonylcobaltate 1-,bis triphenylphosphine iminium chloride∼ppncl,ppn chloride,ppn cl,ksc491c1r,parent,triphenyl p,p,p-triphenylphosphine imidato phosphorus 1+ chloride |
| IUPAC Name | triphenyl-[(triphenyl-$l^{5}-phosphanylidene)amino]phosphanium;chloride |
| InChI Key | LVRCYPYRKNAAMX-UHFFFAOYSA-M |
| Molecular Formula | C36H30ClNP2 |
4,4'-Diaminobiphenyl-2,2'-disulfonic acid hydrate, cont. up to 30% water
CAS: 117-61-3 Molecular Formula: C12H12N2O6S2 Molecular Weight (g/mol): 344.36 MDL Number: MFCD00041885 InChI Key: MBJAPGAZEWPEFB-UHFFFAOYSA-N Synonym: 2,2'-benzidinedisulfonic acid,2,2'-disulfobenzidine,benzidine-2,2'-disulfonic acid,6,6'-bimetanilic acid,4,4'-diaminobiphenyl-2,2'-disulfonic acid,benzidine-2,2'-disulphonic acid,4,4'-diamino-1,1'-biphenyl-2,2'-disulfonic acid,unii-alf643n2eq,benzidine, 2,2'-disulfo,4,4'-diamino-2,2'-biphenyldisulfonic acid PubChem CID: 8337 IUPAC Name: 5-amino-2-(4-amino-2-sulfophenyl)benzenesulfonic acid SMILES: NC1=CC=C(C2=CC=C(N)C=C2S(O)(=O)=O)C(=C1)S(O)(=O)=O
| PubChem CID | 8337 |
|---|---|
| CAS | 117-61-3 |
| Molecular Weight (g/mol) | 344.36 |
| MDL Number | MFCD00041885 |
| SMILES | NC1=CC=C(C2=CC=C(N)C=C2S(O)(=O)=O)C(=C1)S(O)(=O)=O |
| Synonym | 2,2'-benzidinedisulfonic acid,2,2'-disulfobenzidine,benzidine-2,2'-disulfonic acid,6,6'-bimetanilic acid,4,4'-diaminobiphenyl-2,2'-disulfonic acid,benzidine-2,2'-disulphonic acid,4,4'-diamino-1,1'-biphenyl-2,2'-disulfonic acid,unii-alf643n2eq,benzidine, 2,2'-disulfo,4,4'-diamino-2,2'-biphenyldisulfonic acid |
| IUPAC Name | 5-amino-2-(4-amino-2-sulfophenyl)benzenesulfonic acid |
| InChI Key | MBJAPGAZEWPEFB-UHFFFAOYSA-N |
| Molecular Formula | C12H12N2O6S2 |
Phenol Liquified 80% (w/w) In Water, Certified AR, for Analysis, Fisher Chemical™
C6H6O, CAS Number-108-95-2, benzenol, carbolic acid, hydroxybenzene, monophenol, oxybenzene, phenic acid, phenyl hydrate, phenyl hydroxide, phenylic acid, phenylic alcohol, 2.5L, CHEBI:15882, Red, 94.0414g/mol, ISWSIDIOOBJBQZ-UHFFFAOYSA-N, 40.5 deg.C, 2143, 94.113, Plastic Coated Glass bottle
Sodium 3-nitrobenzoate, 94%, may contain up to ca 10% water
CAS: 827-95-2 Molecular Formula: C7H4NNaO4 Molecular Weight (g/mol): 189.10 MDL Number: MFCD00150535,MFCD00051097 InChI Key: MUADFEZFSKAZLT-UHFFFAOYSA-M Synonym: sodium 3-nitrobenzoate,3-nitrobenzoic acid sodium salt,benzoic acid, 3-nitro-, sodium salt,unii-i1eq837b3j,m-nitrobenzoic acid sodium salt,sodium m-nitrobenzoate,benzoic acid, 3-nitro-, sodium salt 1:1,3-nitrobenzoic acid, sodium salt,acmc-209pqe,dsstox_cid_24733 PubChem CID: 70014 IUPAC Name: sodium;3-nitrobenzoate SMILES: [Na+].[O-]C(=O)C1=CC=CC(=C1)[N+]([O-])=O
| PubChem CID | 70014 |
|---|---|
| CAS | 827-95-2 |
| Molecular Weight (g/mol) | 189.10 |
| MDL Number | MFCD00150535,MFCD00051097 |
| SMILES | [Na+].[O-]C(=O)C1=CC=CC(=C1)[N+]([O-])=O |
| Synonym | sodium 3-nitrobenzoate,3-nitrobenzoic acid sodium salt,benzoic acid, 3-nitro-, sodium salt,unii-i1eq837b3j,m-nitrobenzoic acid sodium salt,sodium m-nitrobenzoate,benzoic acid, 3-nitro-, sodium salt 1:1,3-nitrobenzoic acid, sodium salt,acmc-209pqe,dsstox_cid_24733 |
| IUPAC Name | sodium;3-nitrobenzoate |
| InChI Key | MUADFEZFSKAZLT-UHFFFAOYSA-M |
| Molecular Formula | C7H4NNaO4 |
3-Amino-2,4,6-triiodobenzoic acid, 99% (dry wt.), water <4%
CAS: 3119-15-1 Molecular Formula: C7H3I3NNaO2 Molecular Weight (g/mol): 536.81 MDL Number: MFCD00007681 InChI Key: CTXRMWPLTDAHOR-UHFFFAOYSA-M Synonym: unii-99h77d8mtd,3-amino-2,4,6-triiodo-benzoic acid,acido 3-amino-2,4,6-triiodobenzoico italian,benzoic acid, 3-amino-2,4,6-triiodo,3-amino-2,4,6-triiodo-benzoicacid,acido 3-amino-2,4,6-triiodobenzoico,pubchem4987,acmc-1co9w,4-14-00-01118 beilstein handbook reference,2,4,6-triiodo-3-aminobenzoic acid PubChem CID: 18387 IUPAC Name: 3-amino-2,4,6-triiodobenzoic acid SMILES: [Na+].NC1=C(I)C=C(I)C(C([O-])=O)=C1I
| PubChem CID | 18387 |
|---|---|
| CAS | 3119-15-1 |
| Molecular Weight (g/mol) | 536.81 |
| MDL Number | MFCD00007681 |
| SMILES | [Na+].NC1=C(I)C=C(I)C(C([O-])=O)=C1I |
| Synonym | unii-99h77d8mtd,3-amino-2,4,6-triiodo-benzoic acid,acido 3-amino-2,4,6-triiodobenzoico italian,benzoic acid, 3-amino-2,4,6-triiodo,3-amino-2,4,6-triiodo-benzoicacid,acido 3-amino-2,4,6-triiodobenzoico,pubchem4987,acmc-1co9w,4-14-00-01118 beilstein handbook reference,2,4,6-triiodo-3-aminobenzoic acid |
| IUPAC Name | 3-amino-2,4,6-triiodobenzoic acid |
| InChI Key | CTXRMWPLTDAHOR-UHFFFAOYSA-M |
| Molecular Formula | C7H3I3NNaO2 |