Learn More
Rutin, 97+%, ACROS Organics™
Brand: Acros Organics 132390050
Code : 29
Additional Details : CAS Number : 153-18-4 Weight : 0.06000kg
| Packaging | Glass Bottle |
|---|---|
| Quantity | 5g |
Chemical Identifiers
| 153-18-4 | |
| 610.52 | |
| IKGXIBQEEMLURG-NVPNHPEKSA-N | |
| 5280805 | |
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
| C27H30O16 | |
| MFCD00006830 | |
| rutin, rutoside, phytomelin, quercetin 3-rutinoside, birutan, eldrin, myrticolorin, venoruton, 3-rutinosyl quercetin, bioflavonoid | |
| CHEBI:28527 | |
| C[C@@H]1O[C@@H](OC[C@H]2O[C@@H](OC3=C(OC4=CC(O)=CC(O)=C4C3=O)C3=CC=C(O)C(O)=C3)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
Specifications
| Rutin | |
| 5.5 % to 9.0 % (500mg, 130°C, 3 hrs) (vacuum) | |
| 0.5 % max. | |
| 195.0°C | |
| 97.0-102.0% | |
| 97+% | |
| MFCD00006830 | |
| rutin, rutoside, phytomelin, quercetin 3-rutinoside, birutan, eldrin, myrticolorin, venoruton, 3-rutinosyl quercetin, bioflavonoid | |
| IKGXIBQEEMLURG-NVPNHPEKSA-N | |
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one | |
| 5280805 | |
| 664.58 | |
| 97+% |
| Authentic | |
| Glass Bottle | |
| White | |
| 5g | |
| 153-18-4 | |
| C27H30O16 | |
| 15, 8438 | |
| Solubility in water: 1g/8l. Other solubilities: soluble in alkaline solutions,soluble in pyridine and formamide,slightly soluble in alcohol and acetone,practically insoluble in chloroform,carbone,disulfide and benzene | |
| C[C@@H]1O[C@@H](OC[C@H]2O[C@@H](OC3=C(OC4=CC(O)=CC(O)=C4C3=O)C3=CC=C(O)C(O)=C3)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O | |
| 610.52 | |
| CHEBI:28527 | |
| Powder |