Learn More
Prilocaine hydrochloride, 98%, Thermo Scientific™
A local anesthetic
Brand: Thermo Scientific Alfa Aesar J60648.03
| Quantity | 1g |
|---|
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 1786-81-8 | |
| 256.774 | |
| BJPJNTKRKALCPP-UHFFFAOYSA-N | |
| 92163 | |
| N-(2-methylphenyl)-2-(propylamino)propanamide;hydrochloride |
| C13H21ClN2O | |
| MFCD00079279 | |
| prilocaine hydrochloride, propitocaine hydrochloride, prilocaine hcl, xylonest, prilocaine chloride, citanest hydrochloride, citanest plain, n-2-methylphenyl-2-propylamino propanamide hydrochloride, 2-propylamino | |
| CHEBI:32053 | |
| CCCNC(C)C(=O)NC1=CC=CC=C1C.Cl |
Specifications
| 1786-81-8 | |
| MFCD00079279 | |
| 14,7743 | |
| BJPJNTKRKALCPP-UHFFFAOYSA-N | |
| N-(2-methylphenyl)-2-(propylamino)propanamide;hydrochloride | |
| 92163 | |
| 256.77 | |
| Prilocaine hydrochloride |
| C13H21ClN2O | |
| 1g | |
| prilocaine hydrochloride, propitocaine hydrochloride, prilocaine hcl, xylonest, prilocaine chloride, citanest hydrochloride, citanest plain, n-2-methylphenyl-2-propylamino propanamide hydrochloride, 2-propylamino | |
| CCCNC(C)C(=O)NC1=CC=CC=C1C.Cl | |
| 256.774 | |
| CHEBI:32053 | |
| 98% |
Your input is important to us. Please complete this form to provide feedback related to the content on this product.