Learn More
Minocycline hydrochloride, 890-950μg/mg, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar J66429.03
| Quantity | 1g |
|---|
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
- A broad spectrum antibiotic commonly used against bacteria which cause upper respiratory tract infections
Chemical Identifiers
| 13614-98-7 | |
| 493.94 | |
| KDLQIOPKJDNQIM-WUURTAMISA-N | |
| hydrogen (2Z,4S,4aS,5aR,12aS)-2-[amino(hydroxy)methylidene]-4,7-bis(dimethylamino)-10,11,12a-trihydroxy-1,2,3,4,4a,5,5a,6,12,12a-decahydrotetracene-1,3,12-trione chloride |
| C23H28ClN3O7 | |
| MFCD00083669 | |
| 54685925 | |
| [H+].[Cl-].CN(C)[C@H]1[C@@H]2C[C@@H]3CC4=C(C=CC(O)=C4C(O)=C3C(=O)[C@]2(O)C(=O)\C(=C(\N)O)C1=O)N(C)C |
Specifications
| 13614-98-7 | |
| 1g | |
| C23H28ClN3O7 | |
| 813°C | |
| Freely soluble in water | |
| [H+].[Cl-].CN(C)[C@H]1[C@@H]2C[C@@H]3CC4=C(C=CC(O)=C4C(O)=C3C(=O)[C@]2(O)C(=O)\C(=C(\N)O)C1=O)N(C)C | |
| 493.94 | |
| 493.94 |
| Yellow | |
| >110°C (230°F) | |
| MFCD00083669 | |
| 14,6202 | |
| KDLQIOPKJDNQIM-WUURTAMISA-N | |
| hydrogen (2Z,4S,4aS,5aR,12aS)-2-[amino(hydroxy)methylidene]-4,7-bis(dimethylamino)-10,11,12a-trihydroxy-1,2,3,4,4a,5,5a,6,12,12a-decahydrotetracene-1,3,12-trione chloride | |
| 54685925 | |
| Minocycline hydrochloride, 890 to 950μg/mg |
Your input is important to us. Please complete this form to provide feedback related to the content on this product.