Filtered Search Results
HEPES (Fine White Crystals/Molecular Biology), Fisher BioReagents™
Commonly used buffering agent | CAS: 7365-45-9 | C8H18N2O4S | 238.30 g/mol
| Molecular Weight (g/mol) | 238.30 |
|---|---|
| ChEBI | CHEBI:42334 |
| Color | White |
| Chemical Name or Material | HEPES |
| Grade | Molecular Biology |
| SMILES | OCCN1CCN(CCS(O)(=O)=O)CC1 |
| Identification | Pass Test |
| DNase | DNase free |
| Merck Index | 15, 4689 |
| InChI Key | JKMHFZQWWAIEOD-UHFFFAOYSA-N |
| ChemAlert Storage Symbol | Gray |
| Assay Percent Range | ≥99 % |
| PubChem CID | 23831 |
| Absorbance | 0.01 max. (0.1M solution) at 280nm |
| Percent Purity | ≥99% |
| CAS | 7365-45-9 |
| Protease | Protease free |
| Health Hazard 3 | Emergency Overview Causes eye, skin, and respiratory tract irritation. Use personal protective equipment. Ensure adequate ventilation. Wash off immediately with plenty of water for at least 15 minutes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Obtain medical attention. Do not induce vomiting. Obtain medical attention. Obtain medical attention. . NFPA Health:2 Flammability:1 Instability:1 |
| MDL Number | MFCD00006158 |
| Health Hazard 2 | WARNING! |
| Solubility Information | Soluble in water |
| pH | 5.0 to 6.5 |
| Purity Grade Notes | DNase-, RNase- and Protease-Free |
| Recommended Storage | RT |
| Molecular Formula | C8H18N2O4S |
HEPES Buffer, 1M Solution, pH 7.3 (Molecular Biology), Fisher BioReagents™
Commonly used buffering agent
| Color | Undesignated |
|---|---|
| Physical Form | Liquid |
| Chemical Name or Material | HEPES Buffer |
| Grade | Molecular Biology |
| Identification | Pass Test |
| DNase | DNase free |
| Merck Index | 15, 4689 |
| Concentration | 0.95 to 1.05 M |
| ChemAlert Storage Symbol | Gray |
| Absorbance | ≤0.01(0.1M solution) at 260nm,0.004 max. (0.1M solution) at 280nm |
| Name Note | 1M Solution, pH 7.3 |
| CAS | 7732-18-5 |
| Protease | Protease free |
| pH | 7.2 to 7.5 |
| Synonym | N-(2-Hydroxyethyl)piperazine-N«-2-ethanesulfonic Acid |
| Purity Grade Notes | DNase-, RNase- and Protease-Free |
| Recommended Storage | RT |
| Molecular Formula | C8H18N2O4S |
| Formula Weight | 238.197 |
Invitrogen™ NuPAGE™ MOPS SDS Running Buffer (20X)
Made with high-purity reagents and are strictly quality controlled.
| Formulation | 50 mM MOPS, 50 mM Tris Base, 0.1% SDS, 1 mM EDTA, pH 7.7, 0.01-0.09% N,N-dimethylformamide |
|---|---|
| Physical Form | Liquid |
| pH | 7.7 |
| Chemical Name or Material | Running Buffer |
| Recommended Storage | Contents: NuPAGE™ MOPS SDS Running Buffer (20X) Storage: +4°C to 25°C |
| Concentration | 20X |
| Product Line | NuPAGE |
Thermo Scientific Chemicals MES monohydrate, 98%
CAS: 145224-94-8 Molecular Formula: C6H15NO5S Molecular Weight (g/mol): 213.248 MDL Number: MFCD00149409 InChI Key: MIIIXQJBDGSIKL-UHFFFAOYSA-N PubChem CID: 16218417 IUPAC Name: 2-morpholin-4-ylethanesulfonic acid;hydrate SMILES: C1COCCN1CCS(=O)(=O)O.O
| PubChem CID | 16218417 |
|---|---|
| CAS | 145224-94-8 |
| Molecular Weight (g/mol) | 213.248 |
| MDL Number | MFCD00149409 |
| SMILES | C1COCCN1CCS(=O)(=O)O.O |
| IUPAC Name | 2-morpholin-4-ylethanesulfonic acid;hydrate |
| InChI Key | MIIIXQJBDGSIKL-UHFFFAOYSA-N |
| Molecular Formula | C6H15NO5S |
Thermo Scientific Chemicals HEPES, 1.0M buffer soln., pH 7.5
CAS: 7365-45-9 Molecular Formula: C8H18N2O4S Molecular Weight (g/mol): 238.30 MDL Number: MFCD00006158 InChI Key: JKMHFZQWWAIEOD-UHFFFAOYSA-N PubChem CID: 23831 ChEBI: CHEBI:42334 SMILES: OCCN1CCN(CCS(O)(=O)=O)CC1
| PubChem CID | 23831 |
|---|---|
| CAS | 7365-45-9 |
| Molecular Weight (g/mol) | 238.30 |
| ChEBI | CHEBI:42334 |
| MDL Number | MFCD00006158 |
| SMILES | OCCN1CCN(CCS(O)(=O)=O)CC1 |
| InChI Key | JKMHFZQWWAIEOD-UHFFFAOYSA-N |
| Molecular Formula | C8H18N2O4S |
Thermo Scientific Chemicals HEPES, 1.0M buffer soln., pH 8.0
CAS: 7365-45-9 Molecular Formula: C8H18N2O4S Molecular Weight (g/mol): 238.30 MDL Number: MFCD00006158 InChI Key: JKMHFZQWWAIEOD-UHFFFAOYSA-N PubChem CID: 23831 ChEBI: CHEBI:42334 IUPAC Name: 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid SMILES: OCCN1CCN(CCS(O)(=O)=O)CC1
| PubChem CID | 23831 |
|---|---|
| CAS | 7365-45-9 |
| Molecular Weight (g/mol) | 238.30 |
| ChEBI | CHEBI:42334 |
| MDL Number | MFCD00006158 |
| SMILES | OCCN1CCN(CCS(O)(=O)=O)CC1 |
| IUPAC Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid |
| InChI Key | JKMHFZQWWAIEOD-UHFFFAOYSA-N |
| Molecular Formula | C8H18N2O4S |
Thermo Scientific Chemicals MES, 0.5M buffer soln., pH 6.0
CAS: 145224-94-8 Molecular Formula: C6H15NO5S Molecular Weight (g/mol): 213.248 MDL Number: MFCD00283848 InChI Key: MIIIXQJBDGSIKL-UHFFFAOYSA-N PubChem CID: 16218417 IUPAC Name: 2-morpholin-4-ylethanesulfonic acid;hydrate SMILES: C1COCCN1CCS(=O)(=O)O.O
| PubChem CID | 16218417 |
|---|---|
| CAS | 145224-94-8 |
| Molecular Weight (g/mol) | 213.248 |
| MDL Number | MFCD00283848 |
| SMILES | C1COCCN1CCS(=O)(=O)O.O |
| IUPAC Name | 2-morpholin-4-ylethanesulfonic acid;hydrate |
| InChI Key | MIIIXQJBDGSIKL-UHFFFAOYSA-N |
| Molecular Formula | C6H15NO5S |
Thermo Scientific Chemicals Krebs-Ringer Solution, HEPES-buffered
Standard physiological buffer that is suitable for various calcium imaging experiments. It is also used as a preserving agent.
| Solubility Information | Not miscible or difficult to mix in water. |
|---|---|
| Packaging | Plastic bottle |
| Physical Form | Liquid |
| Chemical Name or Material | Krebs-Ringer Solution |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
MOPS, 99%
CAS: 1132-61-2 Molecular Formula: C7H15NO4S Molecular Weight (g/mol): 209.26 MDL Number: MFCD00006183 InChI Key: DVLFYONBTKHTER-UHFFFAOYSA-N Synonym: 4-Morpholinepropanesulfonic acid; 3-(4-Morpholinyl)propanesulfonic acid PubChem CID: 70807 ChEBI: CHEBI:44115 SMILES: [O-]S(=O)(=O)CCC[NH+]1CCOCC1
| PubChem CID | 70807 |
|---|---|
| CAS | 1132-61-2 |
| Molecular Weight (g/mol) | 209.26 |
| ChEBI | CHEBI:44115 |
| MDL Number | MFCD00006183 |
| SMILES | [O-]S(=O)(=O)CCC[NH+]1CCOCC1 |
| Synonym | 4-Morpholinepropanesulfonic acid; 3-(4-Morpholinyl)propanesulfonic acid |
| InChI Key | DVLFYONBTKHTER-UHFFFAOYSA-N |
| Molecular Formula | C7H15NO4S |
HEPES, 1M Solution, pH 7.3, Molecular Biology Grade, Ultrapure
CAS: 7365-45-9 Molecular Formula: C8H18N2O4S Molecular Weight (g/mol): 238.30 MDL Number: MFCD00006158 InChI Key: JKMHFZQWWAIEOD-UHFFFAOYSA-N PubChem CID: 23831 ChEBI: CHEBI:42334 SMILES: OCCN1CCN(CCS(O)(=O)=O)CC1
| PubChem CID | 23831 |
|---|---|
| CAS | 7365-45-9 |
| Molecular Weight (g/mol) | 238.30 |
| ChEBI | CHEBI:42334 |
| MDL Number | MFCD00006158 |
| SMILES | OCCN1CCN(CCS(O)(=O)=O)CC1 |
| InChI Key | JKMHFZQWWAIEOD-UHFFFAOYSA-N |
| Molecular Formula | C8H18N2O4S |
Thermo Scientific Chemicals HEPES sodium salt, 99+%, for molecular biology, DNAse, RNAse and Protease free
CAS: 75277-39-3 Molecular Formula: C8H17N2NaO4S Molecular Weight (g/mol): 260.28 MDL Number: MFCD00036463 InChI Key: RDZTWEVXRGYCFV-UHFFFAOYSA-M Synonym: 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid sodium salt PubChem CID: 2724248 ChEBI: CHEBI:46758 IUPAC Name: sodium;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate SMILES: [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1
| PubChem CID | 2724248 |
|---|---|
| CAS | 75277-39-3 |
| Molecular Weight (g/mol) | 260.28 |
| ChEBI | CHEBI:46758 |
| MDL Number | MFCD00036463 |
| SMILES | [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 |
| Synonym | 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid sodium salt |
| IUPAC Name | sodium;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate |
| InChI Key | RDZTWEVXRGYCFV-UHFFFAOYSA-M |
| Molecular Formula | C8H17N2NaO4S |
Thermo Scientific Chemicals MOPS, 1.0M buffer soln., pH 7.0
CAS: 1132-61-2 Molecular Formula: C7H15NO4S Molecular Weight (g/mol): 209.26 MDL Number: MFCD00006183 InChI Key: DVLFYONBTKHTER-UHFFFAOYSA-N PubChem CID: 70807 ChEBI: CHEBI:44115 IUPAC Name: 3-morpholin-4-ylpropane-1-sulfonic acid SMILES: [O-]S(=O)(=O)CCC[NH+]1CCOCC1
| PubChem CID | 70807 |
|---|---|
| CAS | 1132-61-2 |
| Molecular Weight (g/mol) | 209.26 |
| ChEBI | CHEBI:44115 |
| MDL Number | MFCD00006183 |
| SMILES | [O-]S(=O)(=O)CCC[NH+]1CCOCC1 |
| IUPAC Name | 3-morpholin-4-ylpropane-1-sulfonic acid |
| InChI Key | DVLFYONBTKHTER-UHFFFAOYSA-N |
| Molecular Formula | C7H15NO4S |
Invitrogen™ 20X Bolt™ MOPS SDS Running Buffer
Optimized for use with Bolt™ Bis-Tris Plus gels, and are available in a variety of formats
| For Use With (Equipment) | Bolt |
|---|---|
| Physical Form | Liquid |
| Chemical Name or Material | Running Buffer |
| Concentration | 20X |
| Product Line | Bolt |
Thermo Scientific Chemicals MES monohydrate, 99+%, for biochemistry
CAS: 145224-94-8 Molecular Formula: C6H15NO5S Molecular Weight (g/mol): 195.23 MDL Number: MFCD00149409 InChI Key: MIIIXQJBDGSIKL-UHFFFAOYSA-N Synonym: 2-(N-Morpholino)ethanesulfonic acid monohydrate PubChem CID: 16218417 IUPAC Name: 2-morpholin-4-ylethanesulfonic acid;hydrate SMILES: C1COCCN1CCS(=O)(=O)O.O
| PubChem CID | 16218417 |
|---|---|
| CAS | 145224-94-8 |
| Molecular Weight (g/mol) | 195.23 |
| MDL Number | MFCD00149409 |
| SMILES | C1COCCN1CCS(=O)(=O)O.O |
| Synonym | 2-(N-Morpholino)ethanesulfonic acid monohydrate |
| IUPAC Name | 2-morpholin-4-ylethanesulfonic acid;hydrate |
| InChI Key | MIIIXQJBDGSIKL-UHFFFAOYSA-N |
| Molecular Formula | C6H15NO5S |
Thermo Scientific Chemicals BICINE, 99%
CAS: 150-25-4 Molecular Formula: C6H12NNaO4 Molecular Weight (g/mol): 185.16 MDL Number: MFCD00004295 InChI Key: MFBDBXAVPLFMNJ-UHFFFAOYSA-M PubChem CID: 8761 ChEBI: CHEBI:40957 IUPAC Name: 2-[bis(2-hydroxyethyl)amino]acetic acid SMILES: [Na+].OCCN(CCO)CC([O-])=O
| PubChem CID | 8761 |
|---|---|
| CAS | 150-25-4 |
| Molecular Weight (g/mol) | 185.16 |
| ChEBI | CHEBI:40957 |
| MDL Number | MFCD00004295 |
| SMILES | [Na+].OCCN(CCO)CC([O-])=O |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]acetic acid |
| InChI Key | MFBDBXAVPLFMNJ-UHFFFAOYSA-M |
| Molecular Formula | C6H12NNaO4 |