CAS RN 36051-31-7
CAS RN 36051-31-7
Guanosine-5'-triphosphate Disodium Salt, ≥95%, MP Biomedicals™
CAS: 36051-31-7 Molecular Formula: C10H16MgN5O14P3 Molecular Weight (g/mol): 547.49 MDL Number: MFCD03410297 InChI Key: NMQPZZLDIUETGE-GWTDSMLYSA-N Synonym: guanosine 5'-triphosphate,guanosine-5'-triphosphate disodium salt dihydrate gtp,guanosine-triphosphate,guanosine 5'-triphosphate 4-,gtp 4-,2r,3s,4r,5r-5-2-amino-6-hydroxy-9h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxy phosphonatooxy phosphinate,2r,3s,4r,5r-5-2-amino-6-oxo-3h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methoxy-oxidophosphoryl oxy-oxidophosphoryl phosphate PubChem CID: 131676145 SMILES: [Mg].NC1=NC(=O)C2=C(N1)N(C=N2)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O
Guanosine-5'-Triphosphate Trisodium Salt 98-100%, MP Biomedicals™
CAS: 36051-31-7 Molecular Formula: C10H16MgN5O14P3 Molecular Weight (g/mol): 547.49 MDL Number: MFCD00077781,MFCD00077781 InChI Key: NMQPZZLDIUETGE-GWTDSMLYSA-N Synonym: 5'-gtp trisodium salt,5 acute-gtp trisodium salt PubChem CID: 92044363 SMILES: [Mg].NC1=NC(=O)C2=C(N1)N(C=N2)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O
Guanosine-5'-triphosphate Trisodium Salt, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
MedChemExpress Guanosine 5'-triphosphate trisodium salt
MedChemExpress Guanosine 5'-triphosphate trisodium salt (5'-GTP trisodium salt) is an activator of the signal transducing G proteins which are involved in various cellular processes including proliferation, differentiation, and activation of several intracellular kinase cascades.
MedChemExpress Guanosine 5'-triphosphate trisodium salt
MedChemExpress Guanosine 5'-triphosphate trisodium salt (5'-GTP trisodium salt) is an activator of the signal transducing G proteins which are involved in various cellular processes including proliferation, differentiation, and activation of several intracellular kinase cascades.
MedChemExpress Guanosine 5'-triphosphate trisodium salt
MedChemExpress Guanosine 5'-triphosphate trisodium salt (5'-GTP trisodium salt) is an activator of the signal transducing G proteins which are involved in various cellular processes including proliferation, differentiation, and activation of several intracellular kinase cascades.
MedChemExpress Guanosine 5'-triphosphate trisodium salt
MedChemExpress Guanosine 5'-triphosphate trisodium salt (5'-GTP trisodium salt) is an activator of the signal transducing G proteins which are involved in various cellular processes including proliferation, differentiation, and activation of several intracellular kinase cascades.
MedChemExpress Guanosine 5'-triphosphate trisodium salt
MedChemExpress Guanosine 5'-triphosphate trisodium salt (5'-GTP trisodium salt) is an activator of the signal transducing G proteins which are involved in various cellular processes including proliferation, differentiation, and activation of several intracellular kinase cascades.