Benzene and substituted derivatives
Filtered Search Results
Diphenyl carbonate, 99%
CAS: 102-09-0 Molecular Formula: C13H10O3 Molecular Weight (g/mol): 214.22 InChI Key: ROORDVPLFPIABK-UHFFFAOYSA-N Synonym: carbonic acid, diphenyl ester,phenyl carbonate,diphenylcarbonate,carbonic acid diphenyl ester,phenyl carbonate pho 2co,unii-ywv401idyn,ph2co3,pho 2co,ywv401idyn,phenyl phenoxyformate PubChem CID: 7597 ChEBI: CHEBI:34722 IUPAC Name: diphenyl carbonate SMILES: C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2
| PubChem CID | 7597 |
|---|---|
| CAS | 102-09-0 |
| Molecular Weight (g/mol) | 214.22 |
| ChEBI | CHEBI:34722 |
| SMILES | C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2 |
| Synonym | carbonic acid, diphenyl ester,phenyl carbonate,diphenylcarbonate,carbonic acid diphenyl ester,phenyl carbonate pho 2co,unii-ywv401idyn,ph2co3,pho 2co,ywv401idyn,phenyl phenoxyformate |
| IUPAC Name | diphenyl carbonate |
| InChI Key | ROORDVPLFPIABK-UHFFFAOYSA-N |
| Molecular Formula | C13H10O3 |
Diphenyl carbonate, 99%
CAS: 102-09-0 Molecular Formula: C13H10O3 Molecular Weight (g/mol): 214.22 MDL Number: MFCD00003037 InChI Key: ROORDVPLFPIABK-UHFFFAOYSA-N Synonym: carbonic acid, diphenyl ester,phenyl carbonate,diphenylcarbonate,carbonic acid diphenyl ester,phenyl carbonate pho 2co,unii-ywv401idyn,ph2co3,pho 2co,ywv401idyn,phenyl phenoxyformate PubChem CID: 7597 ChEBI: CHEBI:34722 IUPAC Name: diphenyl carbonate SMILES: C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2
| PubChem CID | 7597 |
|---|---|
| CAS | 102-09-0 |
| Molecular Weight (g/mol) | 214.22 |
| ChEBI | CHEBI:34722 |
| MDL Number | MFCD00003037 |
| SMILES | C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2 |
| Synonym | carbonic acid, diphenyl ester,phenyl carbonate,diphenylcarbonate,carbonic acid diphenyl ester,phenyl carbonate pho 2co,unii-ywv401idyn,ph2co3,pho 2co,ywv401idyn,phenyl phenoxyformate |
| IUPAC Name | diphenyl carbonate |
| InChI Key | ROORDVPLFPIABK-UHFFFAOYSA-N |
| Molecular Formula | C13H10O3 |
Bis(pentafluorophenyl) carbonate, 98+%
CAS: 59483-84-0 Molecular Formula: C13F10O3 Molecular Weight (g/mol): 394.12 MDL Number: MFCD00368353 InChI Key: IOVVFSGCNWQFQT-UHFFFAOYSA-N Synonym: bis pentafluorophenyl carbonate,bis perfluorophenyl carbonate,dipentafluorophenylcarbonate,pentafluorophenyl carbonate,di-pentafluorophenyl carbonate,bis 2,3,4,5,6-pentafluorophenyl carbonate,carbonic acid bis pentafluorophenyl ester,dpfpc,acmc-209mds PubChem CID: 2734833 IUPAC Name: bis(2,3,4,5,6-pentafluorophenyl) carbonate SMILES: FC1=C(F)C(F)=C(OC(=O)OC2=C(F)C(F)=C(F)C(F)=C2F)C(F)=C1F
| PubChem CID | 2734833 |
|---|---|
| CAS | 59483-84-0 |
| Molecular Weight (g/mol) | 394.12 |
| MDL Number | MFCD00368353 |
| SMILES | FC1=C(F)C(F)=C(OC(=O)OC2=C(F)C(F)=C(F)C(F)=C2F)C(F)=C1F |
| Synonym | bis pentafluorophenyl carbonate,bis perfluorophenyl carbonate,dipentafluorophenylcarbonate,pentafluorophenyl carbonate,di-pentafluorophenyl carbonate,bis 2,3,4,5,6-pentafluorophenyl carbonate,carbonic acid bis pentafluorophenyl ester,dpfpc,acmc-209mds |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl) carbonate |
| InChI Key | IOVVFSGCNWQFQT-UHFFFAOYSA-N |
| Molecular Formula | C13F10O3 |
Methyl phenyl carbonate, 97%
CAS: 13509-27-8 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD04039782 InChI Key: XTBFPVLHGVYOQH-UHFFFAOYSA-N Synonym: carbonic acid, methyl phenyl ester,phenyl methyl carbonate,phenyl methoxyformate,acmc-20akf2,carbonic acid methyl phenyl PubChem CID: 139482 IUPAC Name: methyl phenyl carbonate SMILES: COC(=O)OC1=CC=CC=C1
| PubChem CID | 139482 |
|---|---|
| CAS | 13509-27-8 |
| Molecular Weight (g/mol) | 152.15 |
| MDL Number | MFCD04039782 |
| SMILES | COC(=O)OC1=CC=CC=C1 |
| Synonym | carbonic acid, methyl phenyl ester,phenyl methyl carbonate,phenyl methoxyformate,acmc-20akf2,carbonic acid methyl phenyl |
| IUPAC Name | methyl phenyl carbonate |
| InChI Key | XTBFPVLHGVYOQH-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
tert-Butyl phenyl carbonate, 97%
CAS: 6627-89-0 Molecular Formula: C11H14O3 Molecular Weight (g/mol): 194.23 MDL Number: MFCD00008804 InChI Key: UXWVQHXKKOGTSY-UHFFFAOYSA-N Synonym: t-butyl phenyl carbonate,tert-butylphenylcarbonate,2-methyl-2-propanyl phenyl carbonate,carbonic acid, 1,1-dimethylethyl phenyl ester,pubchem13300,acmc-209nuo,phenyl t-butyl carbonate,uxwvqhxkkogtsy-uhfffaoysa,tert-butyl phenyl carbonate,carbonic acid tert-butylphenyl ester PubChem CID: 81113 IUPAC Name: tert-butyl phenyl carbonate SMILES: CC(C)(C)OC(=O)OC1=CC=CC=C1
| PubChem CID | 81113 |
|---|---|
| CAS | 6627-89-0 |
| Molecular Weight (g/mol) | 194.23 |
| MDL Number | MFCD00008804 |
| SMILES | CC(C)(C)OC(=O)OC1=CC=CC=C1 |
| Synonym | t-butyl phenyl carbonate,tert-butylphenylcarbonate,2-methyl-2-propanyl phenyl carbonate,carbonic acid, 1,1-dimethylethyl phenyl ester,pubchem13300,acmc-209nuo,phenyl t-butyl carbonate,uxwvqhxkkogtsy-uhfffaoysa,tert-butyl phenyl carbonate,carbonic acid tert-butylphenyl ester |
| IUPAC Name | tert-butyl phenyl carbonate |
| InChI Key | UXWVQHXKKOGTSY-UHFFFAOYSA-N |
| Molecular Formula | C11H14O3 |
| CAS | 2687-12-9 |
|---|
Methyl pentafluorophenyl carbonate, 97%, Thermo Scientific Chemicals
CAS: 36919-03-6 Molecular Formula: C8H3F5O3 Molecular Weight (g/mol): 242.10 MDL Number: MFCD01075723 InChI Key: HGYOVHMDBHQLOE-UHFFFAOYSA-N Synonym: methyl pentafluorophenyl carbonate,carbonic acid, methyl pentafluorophenyl ester,acmc-20akf4,pentafluorophenoxy methoxy ketone,methyl perfluorophenyl carbonate,carbonic acid methyl pentafluorophenyl ester PubChem CID: 14189360 SMILES: COC(=O)OC1=C(F)C(F)=C(F)C(F)=C1F
| PubChem CID | 14189360 |
|---|---|
| CAS | 36919-03-6 |
| Molecular Weight (g/mol) | 242.10 |
| MDL Number | MFCD01075723 |
| SMILES | COC(=O)OC1=C(F)C(F)=C(F)C(F)=C1F |
| Synonym | methyl pentafluorophenyl carbonate,carbonic acid, methyl pentafluorophenyl ester,acmc-20akf4,pentafluorophenoxy methoxy ketone,methyl perfluorophenyl carbonate,carbonic acid methyl pentafluorophenyl ester |
| InChI Key | HGYOVHMDBHQLOE-UHFFFAOYSA-N |
| Molecular Formula | C8H3F5O3 |
Lodenafil Carbonate, TRC
CAS: 398507-55-6 Molecular Formula: C47 H62 N12 O11 S2 Molecular Weight (g/mol): 1035.2 Synonym: 7H-Pyrazolo[4,3-d]pyrimidin-7-one, 5,5'-[carbonylbis[oxy-2,1-ethanediyl-4,1-piperazinediylsulfonyl(6-ethoxy-3,1-phenylene)]]bis[1,6-dihydro-1-methyl-3-propyl-,1-Piperazineethanol, 4-[[3-(4,7-dihydro-1-methyl-7-oxo-3-propyl-1H-pyrazolo[4,3-d]pyrimidin-5-yl)-4-ethoxyphenyl]sulfonyl]-, carbonate (2:1) (ester) (9CI),Lodenafil carbonate IUPAC Name: bis[2-[4-[4-ethoxy-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,3-d]pyrimidin-5-yl)phenyl]sulfonylpiperazin-1-yl]ethyl] carbonate SMILES: CCCc1nn(C)c2C(=O)NC(=Nc12)c3cc(ccc3OCC)S(=O)(=O)N4CCN(CCOC(=O)OCCN5CCN(CC5)S(=O)(=O)c6ccc(OCC)c(c6)C7=Nc8c(CCC)nn(C)c8C(=O)N7)CC4
| CAS | 398507-55-6 |
|---|---|
| Molecular Weight (g/mol) | 1035.2 |
| SMILES | CCCc1nn(C)c2C(=O)NC(=Nc12)c3cc(ccc3OCC)S(=O)(=O)N4CCN(CCOC(=O)OCCN5CCN(CC5)S(=O)(=O)c6ccc(OCC)c(c6)C7=Nc8c(CCC)nn(C)c8C(=O)N7)CC4 |
| Synonym | 7H-Pyrazolo[4,3-d]pyrimidin-7-one, 5,5'-[carbonylbis[oxy-2,1-ethanediyl-4,1-piperazinediylsulfonyl(6-ethoxy-3,1-phenylene)]]bis[1,6-dihydro-1-methyl-3-propyl-,1-Piperazineethanol, 4-[[3-(4,7-dihydro-1-methyl-7-oxo-3-propyl-1H-pyrazolo[4,3-d]pyrimidin-5-yl)-4-ethoxyphenyl]sulfonyl]-, carbonate (2:1) (ester) (9CI),Lodenafil carbonate |
| IUPAC Name | bis[2-[4-[4-ethoxy-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,3-d]pyrimidin-5-yl)phenyl]sulfonylpiperazin-1-yl]ethyl] carbonate |
| Molecular Formula | C47 H62 N12 O11 S2 |
2,3,4,6-Tetra-O-benzyl-Alpha-D-glucopyranosyl Bromide 90%Stabilized with Calcium Carbonate, TRC
CAS: 4196-35-4 Molecular Formula: C34H35BrO5 Molecular Weight (g/mol): 603.54 Synonym: 2,3,4,6-Tetrakis-O-(phenylmethyl)-alpha-D-glucopyranosyl Bromide,,2,3,4,6-Tetra-O-benzyl-glucopyranosyl Bromide,alpha-D-2,3,4,6-Tetra-O-benzyl-glucopyranosyl Bromide,2,3,4,6-Tetra-O-benzyl-1-bromo-1-deoxy-alpha-D-glucopyranose,2,3,4,6-Tetra-O-benzyl-alpha-D-bromoglucopyranoside,2,3,4,6-Tetra-O-benzyl-alpha-D-glucopyranosyl Bromide,Tetra-O-benzyl-alpha-D-glucopyranosyl Bromide IUPAC Name: (2R,3R,4S,5R,6R)-2-bromo-3,4,5-tris(phenylmethoxy)-6-(3-phenylpropyl)oxane SMILES: Br[C@H]1O[C@H](CCCc2ccccc2)[C@@H](OCc3ccccc3)[C@H](OCc4ccccc4)[C@H]1OCc5ccccc5
| CAS | 4196-35-4 |
|---|---|
| Molecular Weight (g/mol) | 603.54 |
| SMILES | Br[C@H]1O[C@H](CCCc2ccccc2)[C@@H](OCc3ccccc3)[C@H](OCc4ccccc4)[C@H]1OCc5ccccc5 |
| Synonym | 2,3,4,6-Tetrakis-O-(phenylmethyl)-alpha-D-glucopyranosyl Bromide,,2,3,4,6-Tetra-O-benzyl-glucopyranosyl Bromide,alpha-D-2,3,4,6-Tetra-O-benzyl-glucopyranosyl Bromide,2,3,4,6-Tetra-O-benzyl-1-bromo-1-deoxy-alpha-D-glucopyranose,2,3,4,6-Tetra-O-benzyl-alpha-D-bromoglucopyranoside,2,3,4,6-Tetra-O-benzyl-alpha-D-glucopyranosyl Bromide,Tetra-O-benzyl-alpha-D-glucopyranosyl Bromide |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-bromo-3,4,5-tris(phenylmethoxy)-6-(3-phenylpropyl)oxane |
| Molecular Formula | C34H35BrO5 |
Triphenylphosphine, 99+%
CAS: 603-35-0 Molecular Formula: C18H15P Molecular Weight (g/mol): 262.29 MDL Number: MFCD00003043 MFCD20489348 InChI Key: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC Name: triphenylphosphane SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11776 |
|---|---|
| CAS | 603-35-0 |
| Molecular Weight (g/mol) | 262.29 |
| MDL Number | MFCD00003043 MFCD20489348 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| IUPAC Name | triphenylphosphane |
| InChI Key | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| Molecular Formula | C18H15P |
1,5-Diphenylcarbazide, ACS
CAS: 140-22-7 Molecular Formula: C13H14N4O Molecular Weight (g/mol): 242.282 MDL Number: MFCD00003013 InChI Key: KSPIHGBHKVISFI-UHFFFAOYSA-N Synonym: 1,5-diphenylcarbazide,diphenylcarbazide,1,5-diphenylcarbohydrazide,carbonic dihydrazide, 2,2'-diphenyl,1,5-diphenylcarbonohydrazide,1,5-diphenylcabohydrazide,sym-diphenylcarbazide,n,n'-diphenylcarbazide,2,2'-diphenylcarbazide,carbohydrazide, 1,5-diphenyl PubChem CID: 8789 ChEBI: CHEBI:4641 IUPAC Name: 1,3-dianilinourea SMILES: C1=CC=C(C=C1)NNC(=O)NNC2=CC=CC=C2
| PubChem CID | 8789 |
|---|---|
| CAS | 140-22-7 |
| Molecular Weight (g/mol) | 242.282 |
| ChEBI | CHEBI:4641 |
| MDL Number | MFCD00003013 |
| SMILES | C1=CC=C(C=C1)NNC(=O)NNC2=CC=CC=C2 |
| Synonym | 1,5-diphenylcarbazide,diphenylcarbazide,1,5-diphenylcarbohydrazide,carbonic dihydrazide, 2,2'-diphenyl,1,5-diphenylcarbonohydrazide,1,5-diphenylcabohydrazide,sym-diphenylcarbazide,n,n'-diphenylcarbazide,2,2'-diphenylcarbazide,carbohydrazide, 1,5-diphenyl |
| IUPAC Name | 1,3-dianilinourea |
| InChI Key | KSPIHGBHKVISFI-UHFFFAOYSA-N |
| Molecular Formula | C13H14N4O |
Diethyl phthalate, 99%
CAS: 84-66-2 Molecular Formula: C12H14O4 Molecular Weight (g/mol): 222.24 MDL Number: MFCD00009111 InChI Key: FLKPEMZONWLCSK-UHFFFAOYSA-N Synonym: diethyl phthalate,phthalic acid diethyl ester,ethyl phthalate,anozol,neantine,phthalol,solvanol,diethyl o-phthalate,palatinol a,placidol e PubChem CID: 6781 ChEBI: CHEBI:34698 IUPAC Name: diethyl benzene-1,2-dicarboxylate SMILES: CCOC(=O)C1=CC=CC=C1C(=O)OCC
| PubChem CID | 6781 |
|---|---|
| CAS | 84-66-2 |
| Molecular Weight (g/mol) | 222.24 |
| ChEBI | CHEBI:34698 |
| MDL Number | MFCD00009111 |
| SMILES | CCOC(=O)C1=CC=CC=C1C(=O)OCC |
| Synonym | diethyl phthalate,phthalic acid diethyl ester,ethyl phthalate,anozol,neantine,phthalol,solvanol,diethyl o-phthalate,palatinol a,placidol e |
| IUPAC Name | diethyl benzene-1,2-dicarboxylate |
| InChI Key | FLKPEMZONWLCSK-UHFFFAOYSA-N |
| Molecular Formula | C12H14O4 |
1,5-Diphenylcarbazide, 97+%
CAS: 140-22-7 Molecular Formula: C13H14N4O Molecular Weight (g/mol): 242.282 MDL Number: MFCD00003013 InChI Key: KSPIHGBHKVISFI-UHFFFAOYSA-N Synonym: 1,5-diphenylcarbazide,diphenylcarbazide,1,5-diphenylcarbohydrazide,carbonic dihydrazide, 2,2'-diphenyl,1,5-diphenylcarbonohydrazide,1,5-diphenylcabohydrazide,sym-diphenylcarbazide,n,n'-diphenylcarbazide,2,2'-diphenylcarbazide,carbohydrazide, 1,5-diphenyl PubChem CID: 8789 ChEBI: CHEBI:4641 IUPAC Name: 1,3-dianilinourea SMILES: C1=CC=C(C=C1)NNC(=O)NNC2=CC=CC=C2
| PubChem CID | 8789 |
|---|---|
| CAS | 140-22-7 |
| Molecular Weight (g/mol) | 242.282 |
| ChEBI | CHEBI:4641 |
| MDL Number | MFCD00003013 |
| SMILES | C1=CC=C(C=C1)NNC(=O)NNC2=CC=CC=C2 |
| Synonym | 1,5-diphenylcarbazide,diphenylcarbazide,1,5-diphenylcarbohydrazide,carbonic dihydrazide, 2,2'-diphenyl,1,5-diphenylcarbonohydrazide,1,5-diphenylcabohydrazide,sym-diphenylcarbazide,n,n'-diphenylcarbazide,2,2'-diphenylcarbazide,carbohydrazide, 1,5-diphenyl |
| IUPAC Name | 1,3-dianilinourea |
| InChI Key | KSPIHGBHKVISFI-UHFFFAOYSA-N |
| Molecular Formula | C13H14N4O |
Ethyl 4-hydroxybenzoate, 99%
CAS: 120-47-8 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00002353 InChI Key: NUVBSKCKDOMJSU-UHFFFAOYSA-N Synonym: ethylparaben,ethyl paraben,ethyl p-hydroxybenzoate,mycocten,ethyl parasept,4-hydroxybenzoic acid ethyl ester,easeptol,ethyl butex,ethyl parahydroxybenzoate,tegosept e PubChem CID: 8434 ChEBI: CHEBI:86616 IUPAC Name: ethyl 4-hydroxybenzoate SMILES: CCOC(=O)C1=CC=C(C=C1)O
| PubChem CID | 8434 |
|---|---|
| CAS | 120-47-8 |
| Molecular Weight (g/mol) | 166.18 |
| ChEBI | CHEBI:86616 |
| MDL Number | MFCD00002353 |
| SMILES | CCOC(=O)C1=CC=C(C=C1)O |
| Synonym | ethylparaben,ethyl paraben,ethyl p-hydroxybenzoate,mycocten,ethyl parasept,4-hydroxybenzoic acid ethyl ester,easeptol,ethyl butex,ethyl parahydroxybenzoate,tegosept e |
| IUPAC Name | ethyl 4-hydroxybenzoate |
| InChI Key | NUVBSKCKDOMJSU-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
Benzoic acid, 99.6%, ACS reagent
CAS: 65-85-0 Molecular Formula: C7H6O2 Molecular Weight (g/mol): 122.12 InChI Key: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC Name: benzoic acid SMILES: C1=CC=C(C=C1)C(=O)O
| PubChem CID | 243 |
|---|---|
| CAS | 65-85-0 |
| Molecular Weight (g/mol) | 122.12 |
| ChEBI | CHEBI:30746 |
| SMILES | C1=CC=C(C=C1)C(=O)O |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| IUPAC Name | benzoic acid |
| InChI Key | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| Molecular Formula | C7H6O2 |