Xylenes
Xylenes are any one of three isomers of dimethylbenzene, or a combination thereof. All are colorless, flammable liquids composed of a central benzene ring with two methyl groups attached at substituents. They can be applied as precursor chemicals and solvents.
Xylenes are flammable petrochemical products that can be produced via catalytic reforming and coal carbonization during coke production and found in crude oil, gasoline, and aircraft fuel. Xylenes were first isolated from wood tar and named by the French chemist Auguste Cahours.
What Is Xylene?
Xylene, more appropriately called xylenes, refers to any single or combination of the three isomers of dimethylbenzene. The isomeric forms are designated as ortho- (o-), meta- (m-), and para- (p-), a reference to the carbon in the benzene ring to which the two methyl groups are attached.
- o-isomer: 1,2-dimethylbenzene
- m-isomer: 1,3-dimethylbenzene
- p-isomer: 1,4-dimethylbenzene
Xylenes are colorless and can be detected by odor at concentrations as low as 0.08 to 3.7 ppm in air and tasted in water at 0.53 to 1.8 ppm.
Refer to the Certificate of Analysis or the Safety Data Sheet for specific information about xylene density and safety hazards.
What Is Xylene Used For?
Industrial Uses
p-Xylene is a precursor to terephthalic acid and dimethyl terephthalate, used to make polyethylene terephthalate plastic bottles and polyester clothing.
Xylene can be used as a solvent and is a common component of ink, rubber, adhesives, and paint and varnish thinners. Xylenes may be used to clean steel, silicon wafers, and integrated circuits. Medical applications include use as a solvent of dental materials and ear wax.
Laboratory Uses
Xylene can be used with dry ice in baths, to remove oil from microscope objectives, and as a cleaning agent or mounting material in histology procedures.
Filtered Search Results
| CAS | 1330-20-7 |
|---|---|
| MDL Number | MFCD00077264 |
| CAS | 1330-20-7 |
|---|---|
| MDL Number | MFCD00077264 |
2,6-Dimethylbenzoic acid, 98+%
CAS: 632-46-2 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00002483 InChI Key: HCBHQDKBSKYGCK-UHFFFAOYSA-N Synonym: benzoic acid, 2,6-dimethyl,2,6-dimethylbenzoicacid,2,6-dimethyl-benzoic acid,vic-m-xylylic acid,2,6-dimethyl benzoic acid,m-xylene-2-carboxylic acid,2,6-dimethylbenzene carboxylic acid,benzoic acid, 2,6-dimethyl-7ci,8ci,9ci,zlchem 286,vic.-m-xylylic acid PubChem CID: 12439 ChEBI: CHEBI:64827 IUPAC Name: 2,6-dimethylbenzoic acid SMILES: CC1=C(C(=CC=C1)C)C(=O)O
| PubChem CID | 12439 |
|---|---|
| CAS | 632-46-2 |
| Molecular Weight (g/mol) | 150.177 |
| ChEBI | CHEBI:64827 |
| MDL Number | MFCD00002483 |
| SMILES | CC1=C(C(=CC=C1)C)C(=O)O |
| Synonym | benzoic acid, 2,6-dimethyl,2,6-dimethylbenzoicacid,2,6-dimethyl-benzoic acid,vic-m-xylylic acid,2,6-dimethyl benzoic acid,m-xylene-2-carboxylic acid,2,6-dimethylbenzene carboxylic acid,benzoic acid, 2,6-dimethyl-7ci,8ci,9ci,zlchem 286,vic.-m-xylylic acid |
| IUPAC Name | 2,6-dimethylbenzoic acid |
| InChI Key | HCBHQDKBSKYGCK-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
3,4-Dimethylbenzoic acid, 98%
CAS: 619-04-5 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00002524 InChI Key: OPVAJFQBSDUNQA-UHFFFAOYSA-N Synonym: benzoic acid, 3,4-dimethyl,3,4-dimethyl-benzoic acid,1-carboxy-3,4-dimethylbenzene,o-xylene-4-carboxylic acid,3,4-dimethylbenzoicacid,pubchem14893,3,4-dimethyl benzoic acid,asym-o-xylylic acid,acmc-1b5p1,3, 4 dimethyl benzoic acid PubChem CID: 12073 ChEBI: CHEBI:64818 IUPAC Name: 3,4-dimethylbenzoic acid SMILES: CC1=C(C=C(C=C1)C(=O)O)C
| PubChem CID | 12073 |
|---|---|
| CAS | 619-04-5 |
| Molecular Weight (g/mol) | 150.177 |
| ChEBI | CHEBI:64818 |
| MDL Number | MFCD00002524 |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)C |
| Synonym | benzoic acid, 3,4-dimethyl,3,4-dimethyl-benzoic acid,1-carboxy-3,4-dimethylbenzene,o-xylene-4-carboxylic acid,3,4-dimethylbenzoicacid,pubchem14893,3,4-dimethyl benzoic acid,asym-o-xylylic acid,acmc-1b5p1,3, 4 dimethyl benzoic acid |
| IUPAC Name | 3,4-dimethylbenzoic acid |
| InChI Key | OPVAJFQBSDUNQA-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
3,5-Dimethylphenylacetic acid, 98+%
CAS: 42288-46-0 Molecular Formula: C10H11O2 Molecular Weight (g/mol): 163.20 MDL Number: MFCD00082776 InChI Key: HDNBKTWQBJJYPD-UHFFFAOYSA-M Synonym: 3,5-dimethylphenylacetic acid,2-3,5-dimethylphenyl acetic acid,3,5-dimethylphenyl acetic acid,benzeneacetic acid, 3,5-dimethyl,3,5-xylyl acetic acid,acmc-20anc9,ksc238q4h,3,5-dimethylbenzeneacetic acid,3,5-dimethyl-phenyl-acetic acid PubChem CID: 4749495 IUPAC Name: 2-(3,5-dimethylphenyl)acetic acid SMILES: CC1=CC(CC([O-])=O)=CC(C)=C1
| PubChem CID | 4749495 |
|---|---|
| CAS | 42288-46-0 |
| Molecular Weight (g/mol) | 163.20 |
| MDL Number | MFCD00082776 |
| SMILES | CC1=CC(CC([O-])=O)=CC(C)=C1 |
| Synonym | 3,5-dimethylphenylacetic acid,2-3,5-dimethylphenyl acetic acid,3,5-dimethylphenyl acetic acid,benzeneacetic acid, 3,5-dimethyl,3,5-xylyl acetic acid,acmc-20anc9,ksc238q4h,3,5-dimethylbenzeneacetic acid,3,5-dimethyl-phenyl-acetic acid |
| IUPAC Name | 2-(3,5-dimethylphenyl)acetic acid |
| InChI Key | HDNBKTWQBJJYPD-UHFFFAOYSA-M |
| Molecular Formula | C10H11O2 |
2,4-Dimethylbenzoic acid, 97%
CAS: 611-01-8 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002480 InChI Key: BKYWPNROPGQIFZ-UHFFFAOYSA-N Synonym: benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl PubChem CID: 11897 ChEBI: CHEBI:64811 IUPAC Name: 2,4-dimethylbenzoic acid SMILES: CC1=CC=C(C(O)=O)C(C)=C1
| PubChem CID | 11897 |
|---|---|
| CAS | 611-01-8 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64811 |
| MDL Number | MFCD00002480 |
| SMILES | CC1=CC=C(C(O)=O)C(C)=C1 |
| Synonym | benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl |
| IUPAC Name | 2,4-dimethylbenzoic acid |
| InChI Key | BKYWPNROPGQIFZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
2,5-Dimethylbenzoic acid, 98%
CAS: 610-72-0 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002482 InChI Key: XZRHNAFEYMSXRG-UHFFFAOYSA-N Synonym: benzoic acid, 2,5-dimethyl,isoxylic acid,2,5-dimethyl benzoic acid,unii-rke5pmk0h6,2,5-dimethyl-benzoic acid,2-carboxy-1,4-dimethylbenzene,rke5pmk0h6,p-xylene-2-carboxylic acid,2,5-dimethylbenzenecarboxylic acid,2,5-dimethylbenzoicacid PubChem CID: 11892 ChEBI: CHEBI:64825 IUPAC Name: 2,5-dimethylbenzoic acid SMILES: CC1=CC(=C(C=C1)C)C(=O)O
| PubChem CID | 11892 |
|---|---|
| CAS | 610-72-0 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64825 |
| MDL Number | MFCD00002482 |
| SMILES | CC1=CC(=C(C=C1)C)C(=O)O |
| Synonym | benzoic acid, 2,5-dimethyl,isoxylic acid,2,5-dimethyl benzoic acid,unii-rke5pmk0h6,2,5-dimethyl-benzoic acid,2-carboxy-1,4-dimethylbenzene,rke5pmk0h6,p-xylene-2-carboxylic acid,2,5-dimethylbenzenecarboxylic acid,2,5-dimethylbenzoicacid |
| IUPAC Name | 2,5-dimethylbenzoic acid |
| InChI Key | XZRHNAFEYMSXRG-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
2,6-Dimethylbenzeneboronic acid, 97%
CAS: 100379-00-8 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.98 MDL Number: MFCD01009693 InChI Key: ZXDTWWZIHJEZOG-UHFFFAOYSA-N Synonym: 2,6-dimethylphenyl boronic acid,2,6-dimethylbenzeneboronic acid,2,6-dimethylphenyl boranediol,2,6-dimethylboronic acid,m-xylene-2-boronic acid,2,6-dimethyl-phenylboronic acid,boronic acid, 2,6-dimethylphenyl,2-borono-m-xylene,pubchem16357,acmc-1c3za PubChem CID: 583322 IUPAC Name: (2,6-dimethylphenyl)boronic acid SMILES: CC1=CC=CC(C)=C1B(O)O
| PubChem CID | 583322 |
|---|---|
| CAS | 100379-00-8 |
| Molecular Weight (g/mol) | 149.98 |
| MDL Number | MFCD01009693 |
| SMILES | CC1=CC=CC(C)=C1B(O)O |
| Synonym | 2,6-dimethylphenyl boronic acid,2,6-dimethylbenzeneboronic acid,2,6-dimethylphenyl boranediol,2,6-dimethylboronic acid,m-xylene-2-boronic acid,2,6-dimethyl-phenylboronic acid,boronic acid, 2,6-dimethylphenyl,2-borono-m-xylene,pubchem16357,acmc-1c3za |
| IUPAC Name | (2,6-dimethylphenyl)boronic acid |
| InChI Key | ZXDTWWZIHJEZOG-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
3,4-Dimethylbenzeneboronic acid, 98+%
CAS: 55499-43-9 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.98 MDL Number: MFCD01009694 InChI Key: KDVZJKOYSOFXRV-UHFFFAOYSA-N Synonym: 3,4-dimethylphenyl boronic acid,3,4-dimethylbenzeneboronic acid,3,4-dimethylphenyl boranediol,3,4-dimethylphenylboronicacid,4-borono-o-xylene,boronic acid, 3,4-dimethylphenyl,pubchem1832,acmc-209lna,3.4-dimethylbenzeneboronic acid,3,4-dimethyl phenylboronic acid PubChem CID: 2734348 IUPAC Name: (3,4-dimethylphenyl)boronic acid SMILES: CC1=CC=C(C=C1C)B(O)O
| PubChem CID | 2734348 |
|---|---|
| CAS | 55499-43-9 |
| Molecular Weight (g/mol) | 149.98 |
| MDL Number | MFCD01009694 |
| SMILES | CC1=CC=C(C=C1C)B(O)O |
| Synonym | 3,4-dimethylphenyl boronic acid,3,4-dimethylbenzeneboronic acid,3,4-dimethylphenyl boranediol,3,4-dimethylphenylboronicacid,4-borono-o-xylene,boronic acid, 3,4-dimethylphenyl,pubchem1832,acmc-209lna,3.4-dimethylbenzeneboronic acid,3,4-dimethyl phenylboronic acid |
| IUPAC Name | (3,4-dimethylphenyl)boronic acid |
| InChI Key | KDVZJKOYSOFXRV-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
2,3-Dimethylbenzoic acid, 98%
CAS: 603-79-2 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00002479 InChI Key: RIZUCYSQUWMQLX-UHFFFAOYSA-N Synonym: hemellitic acid,benzoic acid, 2,3-dimethyl,2,3-dimethylbenzoicacid,2,3-dimethyl benzoic acid,2,3-dimethyl-benzoic acid,unii-7irp8ca267,2,3-dimethylbenzenecarboxylic acid,vic-o-xylylic acid,methyl m-toluic acid,pubchem2549 PubChem CID: 11782 ChEBI: CHEBI:64823 IUPAC Name: 2,3-dimethylbenzoic acid SMILES: CC1=CC=CC(=C1C)C(=O)O
| PubChem CID | 11782 |
|---|---|
| CAS | 603-79-2 |
| Molecular Weight (g/mol) | 150.177 |
| ChEBI | CHEBI:64823 |
| MDL Number | MFCD00002479 |
| SMILES | CC1=CC=CC(=C1C)C(=O)O |
| Synonym | hemellitic acid,benzoic acid, 2,3-dimethyl,2,3-dimethylbenzoicacid,2,3-dimethyl benzoic acid,2,3-dimethyl-benzoic acid,unii-7irp8ca267,2,3-dimethylbenzenecarboxylic acid,vic-o-xylylic acid,methyl m-toluic acid,pubchem2549 |
| IUPAC Name | 2,3-dimethylbenzoic acid |
| InChI Key | RIZUCYSQUWMQLX-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
3,5-Dimethylbenzoic acid, 98+%
CAS: 499-06-9 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00002525 InChI Key: UMVOQQDNEYOJOK-UHFFFAOYSA-N Synonym: mesitylenic acid,benzoic acid, 3,5-dimethyl,unii-ed8av34n0y,3,5-dimethyl benzoic acid,3,5-dimethyl-benzoic acid,ed8av34n0y,3,5-dimethylbenzoicacid,pubchem15440,3,5-dimethylbezoic acid,3,5 dimethylbenzoic acid PubChem CID: 10356 ChEBI: CHEBI:64821 IUPAC Name: 3,5-dimethylbenzoic acid SMILES: CC1=CC(=CC(=C1)C(=O)O)C
| PubChem CID | 10356 |
|---|---|
| CAS | 499-06-9 |
| Molecular Weight (g/mol) | 150.177 |
| ChEBI | CHEBI:64821 |
| MDL Number | MFCD00002525 |
| SMILES | CC1=CC(=CC(=C1)C(=O)O)C |
| Synonym | mesitylenic acid,benzoic acid, 3,5-dimethyl,unii-ed8av34n0y,3,5-dimethyl benzoic acid,3,5-dimethyl-benzoic acid,ed8av34n0y,3,5-dimethylbenzoicacid,pubchem15440,3,5-dimethylbezoic acid,3,5 dimethylbenzoic acid |
| IUPAC Name | 3,5-dimethylbenzoic acid |
| InChI Key | UMVOQQDNEYOJOK-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
2,6-Dimethylphenylboronic acid, 98%
CAS: 100379-00-8 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.98 MDL Number: MFCD01009693 InChI Key: ZXDTWWZIHJEZOG-UHFFFAOYSA-N Synonym: 2,6-dimethylphenyl boronic acid,2,6-dimethylbenzeneboronic acid,2,6-dimethylphenyl boranediol,2,6-dimethylboronic acid,m-xylene-2-boronic acid,2,6-dimethyl-phenylboronic acid,boronic acid, 2,6-dimethylphenyl,2-borono-m-xylene,pubchem16357,acmc-1c3za PubChem CID: 583322 IUPAC Name: (2,6-dimethylphenyl)boronic acid SMILES: CC1=CC=CC(C)=C1B(O)O
| PubChem CID | 583322 |
|---|---|
| CAS | 100379-00-8 |
| Molecular Weight (g/mol) | 149.98 |
| MDL Number | MFCD01009693 |
| SMILES | CC1=CC=CC(C)=C1B(O)O |
| Synonym | 2,6-dimethylphenyl boronic acid,2,6-dimethylbenzeneboronic acid,2,6-dimethylphenyl boranediol,2,6-dimethylboronic acid,m-xylene-2-boronic acid,2,6-dimethyl-phenylboronic acid,boronic acid, 2,6-dimethylphenyl,2-borono-m-xylene,pubchem16357,acmc-1c3za |
| IUPAC Name | (2,6-dimethylphenyl)boronic acid |
| InChI Key | ZXDTWWZIHJEZOG-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
2,4-Dimethylbenzoic acid, 98%
CAS: 611-01-8 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002480 InChI Key: BKYWPNROPGQIFZ-UHFFFAOYSA-N Synonym: benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl PubChem CID: 11897 ChEBI: CHEBI:64811 IUPAC Name: 2,4-dimethylbenzoic acid SMILES: CC1=CC=C(C(O)=O)C(C)=C1
| PubChem CID | 11897 |
|---|---|
| CAS | 611-01-8 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64811 |
| MDL Number | MFCD00002480 |
| SMILES | CC1=CC=C(C(O)=O)C(C)=C1 |
| Synonym | benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl |
| IUPAC Name | 2,4-dimethylbenzoic acid |
| InChI Key | BKYWPNROPGQIFZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
3,5-Dimethylbenzoic acid, 99%
CAS: 499-06-9 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002525 InChI Key: UMVOQQDNEYOJOK-UHFFFAOYSA-N Synonym: mesitylenic acid,benzoic acid, 3,5-dimethyl,unii-ed8av34n0y,3,5-dimethyl benzoic acid,3,5-dimethyl-benzoic acid,ed8av34n0y,3,5-dimethylbenzoicacid,pubchem15440,3,5-dimethylbezoic acid,3,5 dimethylbenzoic acid PubChem CID: 10356 ChEBI: CHEBI:64821 IUPAC Name: 3,5-dimethylbenzoic acid SMILES: CC1=CC(=CC(=C1)C(=O)O)C
| PubChem CID | 10356 |
|---|---|
| CAS | 499-06-9 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64821 |
| MDL Number | MFCD00002525 |
| SMILES | CC1=CC(=CC(=C1)C(=O)O)C |
| Synonym | mesitylenic acid,benzoic acid, 3,5-dimethyl,unii-ed8av34n0y,3,5-dimethyl benzoic acid,3,5-dimethyl-benzoic acid,ed8av34n0y,3,5-dimethylbenzoicacid,pubchem15440,3,5-dimethylbezoic acid,3,5 dimethylbenzoic acid |
| IUPAC Name | 3,5-dimethylbenzoic acid |
| InChI Key | UMVOQQDNEYOJOK-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
2,4-Dimethylbenzeneboronic acid, 97%
CAS: 55499-44-0 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.984 MDL Number: MFCD02683101 InChI Key: TYONHSPZXLFWKI-UHFFFAOYSA-N Synonym: 2,4-dimethylphenyl boronic acid,2,4-dimethylbenzeneboronic acid,2,4-dimethyl phenyl boronic acid,2,4-dimethylphenylboronicacid,4-dimethylphenylboronic acid,boronic acid, 2,4-dimethylphenyl,4-borono-m-xylene,pubchem9565,m-xylene-4-boronic acid,acmc-1ay9d PubChem CID: 4198739 IUPAC Name: (2,4-dimethylphenyl)boronic acid SMILES: B(C1=C(C=C(C=C1)C)C)(O)O
| PubChem CID | 4198739 |
|---|---|
| CAS | 55499-44-0 |
| Molecular Weight (g/mol) | 149.984 |
| MDL Number | MFCD02683101 |
| SMILES | B(C1=C(C=C(C=C1)C)C)(O)O |
| Synonym | 2,4-dimethylphenyl boronic acid,2,4-dimethylbenzeneboronic acid,2,4-dimethyl phenyl boronic acid,2,4-dimethylphenylboronicacid,4-dimethylphenylboronic acid,boronic acid, 2,4-dimethylphenyl,4-borono-m-xylene,pubchem9565,m-xylene-4-boronic acid,acmc-1ay9d |
| IUPAC Name | (2,4-dimethylphenyl)boronic acid |
| InChI Key | TYONHSPZXLFWKI-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |