Epoxides
Filtered Search Results
(S)-(-)-Propylene oxide, 99%
CAS: 16088-62-3 Molecular Formula: C3H6O Molecular Weight (g/mol): 58.08 MDL Number: MFCD00064312 InChI Key: GOOHAUXETOMSMM-VKHMYHEASA-N Synonym: s---propylene oxide,s-propylene oxide,2s-2-methyloxirane,s-1,2-epoxypropane,--propylene oxide,s-2-methyloxirane,--methyloxirane,s-methyloxirane,s---1,2-epoxypropane PubChem CID: 146262 ChEBI: CHEBI:28982 IUPAC Name: (2S)-2-methyloxirane SMILES: C[C@H]1CO1
| PubChem CID | 146262 |
|---|---|
| CAS | 16088-62-3 |
| Molecular Weight (g/mol) | 58.08 |
| ChEBI | CHEBI:28982 |
| MDL Number | MFCD00064312 |
| SMILES | C[C@H]1CO1 |
| Synonym | s---propylene oxide,s-propylene oxide,2s-2-methyloxirane,s-1,2-epoxypropane,--propylene oxide,s-2-methyloxirane,--methyloxirane,s-methyloxirane,s---1,2-epoxypropane |
| IUPAC Name | (2S)-2-methyloxirane |
| InChI Key | GOOHAUXETOMSMM-VKHMYHEASA-N |
| Molecular Formula | C3H6O |
(S)-(+)-Epichlorohydrin, 98+%
CAS: 67843-74-7 Molecular Formula: C3H5ClO Molecular Weight (g/mol): 92.52 MDL Number: MFCD00077760 InChI Key: BRLQWZUYTZBJKN-GSVOUGTGSA-N Synonym: s-+-epichlorohydrin,s-epichlorohydrin,2s-2-chloromethyl oxirane,s-chloromethyl oxirane,s-3-chloropropylene oxide,s-2-chloromethyl oxirane,epichlorohydrin, +,unii-scr89b4r6o,ccris 6388 PubChem CID: 149428 ChEBI: CHEBI:37145 IUPAC Name: (2S)-2-(chloromethyl)oxirane SMILES: ClC[C@@H]1CO1
| PubChem CID | 149428 |
|---|---|
| CAS | 67843-74-7 |
| Molecular Weight (g/mol) | 92.52 |
| ChEBI | CHEBI:37145 |
| MDL Number | MFCD00077760 |
| SMILES | ClC[C@@H]1CO1 |
| Synonym | s-+-epichlorohydrin,s-epichlorohydrin,2s-2-chloromethyl oxirane,s-chloromethyl oxirane,s-3-chloropropylene oxide,s-2-chloromethyl oxirane,epichlorohydrin, +,unii-scr89b4r6o,ccris 6388 |
| IUPAC Name | (2S)-2-(chloromethyl)oxirane |
| InChI Key | BRLQWZUYTZBJKN-GSVOUGTGSA-N |
| Molecular Formula | C3H5ClO |
(S)-(-)-Glycidol, 97%, (98% ee)
CAS: 60456-23-7 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.08 MDL Number: MFCD00074874 InChI Key: CTKINSOISVBQLD-VKHMYHEASA-N Synonym: s-glycidol,s-oxiranemethanol,s---glycidol,s-oxiran-2-ylmethanol,s---2,3-epoxy-1-propanol,2s-oxiran-2-ylmethanol,s-+-glycidol,2s-oxiran-2-yl methanol,oxiranemethanol, 2s PubChem CID: 6973630 ChEBI: CHEBI:38690 IUPAC Name: [(2S)-oxiran-2-yl]methanol SMILES: C1C(O1)CO
| PubChem CID | 6973630 |
|---|---|
| CAS | 60456-23-7 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:38690 |
| MDL Number | MFCD00074874 |
| SMILES | C1C(O1)CO |
| Synonym | s-glycidol,s-oxiranemethanol,s---glycidol,s-oxiran-2-ylmethanol,s---2,3-epoxy-1-propanol,2s-oxiran-2-ylmethanol,s-+-glycidol,2s-oxiran-2-yl methanol,oxiranemethanol, 2s |
| IUPAC Name | [(2S)-oxiran-2-yl]methanol |
| InChI Key | CTKINSOISVBQLD-VKHMYHEASA-N |
| Molecular Formula | C3H6O2 |
(S)-Styrene oxide, 94%
CAS: 20780-54-5 Molecular Formula: C8H8O Molecular Weight (g/mol): 120.15 MDL Number: MFCD00064310,MFCD00066210 InChI Key: AWMVMTVKBNGEAK-MRVPVSSYSA-N Synonym: s-styrene oxide,s-2-phenyloxirane,2s-2-phenyloxirane,s-phenyloxirane,s-epoxyethyl benzene,s-+-styrene oxide,styrene oxide, s,unii-av5p894c84,ccris 4094 PubChem CID: 114946 ChEBI: CHEBI:51014 IUPAC Name: (2S)-2-phenyloxirane SMILES: C1O[C@H]1C1=CC=CC=C1
| PubChem CID | 114946 |
|---|---|
| CAS | 20780-54-5 |
| Molecular Weight (g/mol) | 120.15 |
| ChEBI | CHEBI:51014 |
| MDL Number | MFCD00064310,MFCD00066210 |
| SMILES | C1O[C@H]1C1=CC=CC=C1 |
| Synonym | s-styrene oxide,s-2-phenyloxirane,2s-2-phenyloxirane,s-phenyloxirane,s-epoxyethyl benzene,s-+-styrene oxide,styrene oxide, s,unii-av5p894c84,ccris 4094 |
| IUPAC Name | (2S)-2-phenyloxirane |
| InChI Key | AWMVMTVKBNGEAK-MRVPVSSYSA-N |
| Molecular Formula | C8H8O |
(S)-(-)-Glycidol, 99+%, ee 99+%
CAS: 60456-23-7 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.079 MDL Number: MFCD00074874 InChI Key: CTKINSOISVBQLD-VKHMYHEASA-N Synonym: s-glycidol,s-oxiranemethanol,s---glycidol,s-oxiran-2-ylmethanol,s---2,3-epoxy-1-propanol,2s-oxiran-2-ylmethanol,s-+-glycidol,2s-oxiran-2-yl methanol,oxiranemethanol, 2s PubChem CID: 6973630 ChEBI: CHEBI:38690 IUPAC Name: [(2S)-oxiran-2-yl]methanol SMILES: C1C(O1)CO
| PubChem CID | 6973630 |
|---|---|
| CAS | 60456-23-7 |
| Molecular Weight (g/mol) | 74.079 |
| ChEBI | CHEBI:38690 |
| MDL Number | MFCD00074874 |
| SMILES | C1C(O1)CO |
| Synonym | s-glycidol,s-oxiranemethanol,s---glycidol,s-oxiran-2-ylmethanol,s---2,3-epoxy-1-propanol,2s-oxiran-2-ylmethanol,s-+-glycidol,2s-oxiran-2-yl methanol,oxiranemethanol, 2s |
| IUPAC Name | [(2S)-oxiran-2-yl]methanol |
| InChI Key | CTKINSOISVBQLD-VKHMYHEASA-N |
| Molecular Formula | C3H6O2 |
(S)-2-Methyl Glycidol (>90%), TRC
CAS: 86884-90-4 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.11 Synonym: Delamanid Impurity 9 IUPAC Name: [(2S)-2-methyloxiran-2-yl]methanol SMILES: C[C@]1(CO)CO1
| CAS | 86884-90-4 |
|---|---|
| Molecular Weight (g/mol) | 88.11 |
| SMILES | C[C@]1(CO)CO1 |
| Synonym | Delamanid Impurity 9 |
| IUPAC Name | [(2S)-2-methyloxiran-2-yl]methanol |
| Molecular Formula | C4H8O2 |
erythro-N-Boc-3,5-difluoro-L-phenylalanine epoxide, 95%, Thermo Scientific Chemicals
CAS: 388071-27-0 Molecular Formula: C15H19F2NO3 Molecular Weight (g/mol): 299.32 MDL Number: MFCD08061630 InChI Key: NKGKCDXMOMAORK-UHFFFAOYNA-N Synonym: erythro-n-boc-l-3,5-difluorophenylalanine epoxide,tert-butyl s-2-3,5-difluorophenyl-1-s-oxiran-2-yl ethyl carbamate,tert-butyl n-1s-2-3,5-difluorophenyl-1-2s-oxiran-2-yl ethyl carbamate,erythro-n-boc-3,5-difluoro-l-phenylalanine epoxide,tert-butyl 1s-2-3,5-difluorophenyl-1-2s-oxiranyl ethylcarbamate,tert-butyl s-2-3,5-difluorophenyl-1-s-oxiran-2-yl ethylcarbamate,tert-butyl 1s-2-3,5-difluorophenyl-1-2s-oxiran-2-yl ethylcarbamate,tert-butyl 1s-2-3,5-difluorophenyl-1-2s-oxiran-2-yl ethyl carbamate PubChem CID: 9922319 IUPAC Name: tert-butyl N-[(1S)-2-(3,5-difluorophenyl)-1-[(2S)-oxiran-2-yl]ethyl]carbamate SMILES: CC(C)(C)OC(=O)NC(CC1=CC(F)=CC(F)=C1)C1CO1
| PubChem CID | 9922319 |
|---|---|
| CAS | 388071-27-0 |
| Molecular Weight (g/mol) | 299.32 |
| MDL Number | MFCD08061630 |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC(F)=CC(F)=C1)C1CO1 |
| Synonym | erythro-n-boc-l-3,5-difluorophenylalanine epoxide,tert-butyl s-2-3,5-difluorophenyl-1-s-oxiran-2-yl ethyl carbamate,tert-butyl n-1s-2-3,5-difluorophenyl-1-2s-oxiran-2-yl ethyl carbamate,erythro-n-boc-3,5-difluoro-l-phenylalanine epoxide,tert-butyl 1s-2-3,5-difluorophenyl-1-2s-oxiranyl ethylcarbamate,tert-butyl s-2-3,5-difluorophenyl-1-s-oxiran-2-yl ethylcarbamate,tert-butyl 1s-2-3,5-difluorophenyl-1-2s-oxiran-2-yl ethylcarbamate,tert-butyl 1s-2-3,5-difluorophenyl-1-2s-oxiran-2-yl ethyl carbamate |
| IUPAC Name | tert-butyl N-[(1S)-2-(3,5-difluorophenyl)-1-[(2S)-oxiran-2-yl]ethyl]carbamate |
| InChI Key | NKGKCDXMOMAORK-UHFFFAOYNA-N |
| Molecular Formula | C15H19F2NO3 |
(2S,3S)-3-(N-BOC-amino)-1-oxirane-4-phenylbutane, 98%
CAS: 98737-29-2 Molecular Formula: C15H21NO3 Molecular Weight (g/mol): 263.34 MDL Number: MFCD02258997 InChI Key: NVPOUMXZERMIJK-QWHCGFSZSA-N Synonym: 2s,3s-1,2-epoxy-3-boc-amino-4-phenylbutane,2s,3s-n-t-boc-3-amino-1,2-epoxy-4-phenylbutane,tert-butyl s-1-s-oxiran-2-yl-2-phenylethyl carbamate,2s,3s-1,2-epoxy-3-tert-butoxycarbonylamino-4-phenylbutane,tert-butyl n-1s-1-2s-oxiran-2-yl-2-phenylethyl carbamate,tert-butyl s-r*,r*---1-oxiranyl-2-phenylethyl carbamate,tert-butyl n-1s-1-2s-oxiran-2-yl-2-phenyl-ethyl carbamate,2s,3s---3-t-boc-amino-1,2-epoxy-4-phenylbutane,ksc523o6b PubChem CID: 9903372 IUPAC Name: tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-phenylethyl]carbamate SMILES: CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)C2CO2
| PubChem CID | 9903372 |
|---|---|
| CAS | 98737-29-2 |
| Molecular Weight (g/mol) | 263.34 |
| MDL Number | MFCD02258997 |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)C2CO2 |
| Synonym | 2s,3s-1,2-epoxy-3-boc-amino-4-phenylbutane,2s,3s-n-t-boc-3-amino-1,2-epoxy-4-phenylbutane,tert-butyl s-1-s-oxiran-2-yl-2-phenylethyl carbamate,2s,3s-1,2-epoxy-3-tert-butoxycarbonylamino-4-phenylbutane,tert-butyl n-1s-1-2s-oxiran-2-yl-2-phenylethyl carbamate,tert-butyl s-r*,r*---1-oxiranyl-2-phenylethyl carbamate,tert-butyl n-1s-1-2s-oxiran-2-yl-2-phenyl-ethyl carbamate,2s,3s---3-t-boc-amino-1,2-epoxy-4-phenylbutane,ksc523o6b |
| IUPAC Name | tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-phenylethyl]carbamate |
| InChI Key | NVPOUMXZERMIJK-QWHCGFSZSA-N |
| Molecular Formula | C15H21NO3 |
(2R,3S)-3-(N-BOC-amino)-1-oxirane-4-phenylbutane, 98%, Thermo Scientific™
CAS: 98760-08-8 Molecular Formula: C15H21NO3 Molecular Weight (g/mol): 263.34 MDL Number: MFCD00671705,MFCD02258997 InChI Key: NVPOUMXZERMIJK-UHFFFAOYNA-N Synonym: 2r,3s-3-tert-butoxycarbonyl amino-1,2-epoxy-4-phenylbutane,2r,3s-1,2-epoxy-3-boc-amino-4-phenylbutane,tert-butyl s-1-r-oxiran-2-yl-2-phenylethyl carbamate,tert-butyl 1s,2r-oxiranyl-2-phenylethyl carbamate,threo-n-boc-l-phenylalanine epoxide,tert-butyl n-1s-1-2r-oxiran-2-yl-2-phenylethyl carbamate,2r,3s-3-n-boc-amino-1-oxirane-4-phenylbutane,2r,3s-3-tert-boc amino-1,2-epoxy-4-phenylbutane,atazanavir impurity c,pubchem5823 PubChem CID: 9813904 IUPAC Name: tert-butyl N-[(1S)-1-[(2R)-oxiran-2-yl]-2-phenylethyl]carbamate SMILES: CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)C1CO1
| PubChem CID | 9813904 |
|---|---|
| CAS | 98760-08-8 |
| Molecular Weight (g/mol) | 263.34 |
| MDL Number | MFCD00671705,MFCD02258997 |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)C1CO1 |
| Synonym | 2r,3s-3-tert-butoxycarbonyl amino-1,2-epoxy-4-phenylbutane,2r,3s-1,2-epoxy-3-boc-amino-4-phenylbutane,tert-butyl s-1-r-oxiran-2-yl-2-phenylethyl carbamate,tert-butyl 1s,2r-oxiranyl-2-phenylethyl carbamate,threo-n-boc-l-phenylalanine epoxide,tert-butyl n-1s-1-2r-oxiran-2-yl-2-phenylethyl carbamate,2r,3s-3-n-boc-amino-1-oxirane-4-phenylbutane,2r,3s-3-tert-boc amino-1,2-epoxy-4-phenylbutane,atazanavir impurity c,pubchem5823 |
| IUPAC Name | tert-butyl N-[(1S)-1-[(2R)-oxiran-2-yl]-2-phenylethyl]carbamate |
| InChI Key | NVPOUMXZERMIJK-UHFFFAOYNA-N |
| Molecular Formula | C15H21NO3 |
1,2-Epoxy-7-octene, 97%
CAS: 19600-63-6 Molecular Formula: C8H14O Molecular Weight (g/mol): 126.199 MDL Number: MFCD00005156 InChI Key: UKTHULMXFLCNAV-UHFFFAOYSA-N Synonym: 1,2-epoxy-7-octene,oxirane, 5-hexenyl,5-hexenyloxirane,7,8-epoxyoctene,ccris 3749,2-hex-5-en-1-yl oxirane,oxirane, 5-hexenyl-, s,2-hex-5-en-yloxirane,2-5-hexenyl oxirane,acmc-20ap64 PubChem CID: 29678 IUPAC Name: 2-hex-5-enyloxirane SMILES: C=CCCCCC1CO1
| PubChem CID | 29678 |
|---|---|
| CAS | 19600-63-6 |
| Molecular Weight (g/mol) | 126.199 |
| MDL Number | MFCD00005156 |
| SMILES | C=CCCCCC1CO1 |
| Synonym | 1,2-epoxy-7-octene,oxirane, 5-hexenyl,5-hexenyloxirane,7,8-epoxyoctene,ccris 3749,2-hex-5-en-1-yl oxirane,oxirane, 5-hexenyl-, s,2-hex-5-en-yloxirane,2-5-hexenyl oxirane,acmc-20ap64 |
| IUPAC Name | 2-hex-5-enyloxirane |
| InChI Key | UKTHULMXFLCNAV-UHFFFAOYSA-N |
| Molecular Formula | C8H14O |
Isobutylene oxide, 98%
CAS: 558-30-5 Molecular Formula: C4H8O Molecular Weight (g/mol): 72.11 MDL Number: MFCD00066354 InChI Key: GELKGHVAFRCJNA-UHFFFAOYSA-N Synonym: isobutylene oxide,1,2-epoxy-2-methylpropane,isobutene oxide,isobutylene epoxide,isobutyleneoxide,oxirane, 2,2-dimethyl,1,2-epoxyisobutane,1,1-dimethylethylene oxide,1,2-isobutylene oxide,2-methyl-1-propene oxide PubChem CID: 11208 IUPAC Name: 2,2-dimethyloxirane SMILES: CC1(CO1)C
| PubChem CID | 11208 |
|---|---|
| CAS | 558-30-5 |
| Molecular Weight (g/mol) | 72.11 |
| MDL Number | MFCD00066354 |
| SMILES | CC1(CO1)C |
| Synonym | isobutylene oxide,1,2-epoxy-2-methylpropane,isobutene oxide,isobutylene epoxide,isobutyleneoxide,oxirane, 2,2-dimethyl,1,2-epoxyisobutane,1,1-dimethylethylene oxide,1,2-isobutylene oxide,2-methyl-1-propene oxide |
| IUPAC Name | 2,2-dimethyloxirane |
| InChI Key | GELKGHVAFRCJNA-UHFFFAOYSA-N |
| Molecular Formula | C4H8O |
Glucoraphanin, MedChemExpress
MedChemExpress Glucoraphanin, a natural glucosinolate found in cruciferous vegetable, is a stable precursor of the Nrf2 inducer sulforaphane, which possesses antioxidant, anti-inflammatory, and anti-carcinogenic effects.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Molecular Weight (g/mol) | 437.51 |
|---|---|
| Color | White |
| Physical Form | Solid |
| Chemical Name or Material | Glucoraphanin |
| Grade | Research |
| SMILES | CS(CCCC/C(S[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)=N\OS(=O)(O)=O)=O |
| For Use With (Application) | Cancer-programmed cell death |
| Percent Purity | 98.21% |
| CAS | 21414-41-5 |
| Solubility Information | H2O : ≥ 76.5 mg/mL (174.85 mM) |
| Health Hazard 1 | H302∣H315∣H319∣H335 |
| Purity Grade Notes | Research |
| Recommended Storage | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Shelf Life | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Molecular Formula | C12H23NO10S3 |
| Formula Weight | 437.51 |