Other Solvents
Filtered Search Results
1-(2,4-Dimethylphenyl)ethanol, 95%
CAS: 5379-19-1 Molecular Formula: C10H14O Molecular Weight (g/mol): 150.221 MDL Number: MFCD00060890 InChI Key: DNHQUGRUHBFDFT-UHFFFAOYSA-N Synonym: 1-2,4-dimethylphenyl ethanol,1-2,4-dimethylphenyl ethan-1-ol,1-2,4-dimethylbenzene-1-ethanol PubChem CID: 21475 IUPAC Name: 1-(2,4-dimethylphenyl)ethanol SMILES: CC1=CC(=C(C=C1)C(C)O)C
| PubChem CID | 21475 |
|---|---|
| CAS | 5379-19-1 |
| Molecular Weight (g/mol) | 150.221 |
| MDL Number | MFCD00060890 |
| SMILES | CC1=CC(=C(C=C1)C(C)O)C |
| Synonym | 1-2,4-dimethylphenyl ethanol,1-2,4-dimethylphenyl ethan-1-ol,1-2,4-dimethylbenzene-1-ethanol |
| IUPAC Name | 1-(2,4-dimethylphenyl)ethanol |
| InChI Key | DNHQUGRUHBFDFT-UHFFFAOYSA-N |
| Molecular Formula | C10H14O |
1-(2-Chlorophenyl)ethanol, 96%
CAS: 13524-04-4 Molecular Formula: C8H9ClO Molecular Weight (g/mol): 156.609 MDL Number: MFCD00041037 InChI Key: DDUBOVLGCYUYFX-UHFFFAOYSA-N Synonym: 1-2-chlorophenyl ethanol,1-2-chlorophenyl ethan-1-ol,2-chloro-alpha-methylbenzyl alcohol,1-2-chlorophenyl-1-ethanol,benzenemethanol, 2-chloro-.alpha.-methyl,benzenemethanol, 2-chloro-alpha-methyl,benzyl alcohol, o-chloro-.alpha.-methyl,1-2-chloro-phenyl-ethanol,1-2-chlorophenyl ethyl alcohol,1-2'-chlorophenyl-1-hydroxyethane PubChem CID: 26082 IUPAC Name: 1-(2-chlorophenyl)ethanol SMILES: CC(C1=CC=CC=C1Cl)O
| PubChem CID | 26082 |
|---|---|
| CAS | 13524-04-4 |
| Molecular Weight (g/mol) | 156.609 |
| MDL Number | MFCD00041037 |
| SMILES | CC(C1=CC=CC=C1Cl)O |
| Synonym | 1-2-chlorophenyl ethanol,1-2-chlorophenyl ethan-1-ol,2-chloro-alpha-methylbenzyl alcohol,1-2-chlorophenyl-1-ethanol,benzenemethanol, 2-chloro-.alpha.-methyl,benzenemethanol, 2-chloro-alpha-methyl,benzyl alcohol, o-chloro-.alpha.-methyl,1-2-chloro-phenyl-ethanol,1-2-chlorophenyl ethyl alcohol,1-2'-chlorophenyl-1-hydroxyethane |
| IUPAC Name | 1-(2-chlorophenyl)ethanol |
| InChI Key | DDUBOVLGCYUYFX-UHFFFAOYSA-N |
| Molecular Formula | C8H9ClO |
Diethyl ether, ≥99%, for HPLC, stabilized with Ethanol
CAS: 60-29-7 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00011646 InChI Key: RTZKZFJDLAIYFH-UHFFFAOYSA-N Synonym: diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether PubChem CID: 3283 ChEBI: CHEBI:35702 IUPAC Name: ethoxyethane SMILES: CCOCC
| PubChem CID | 3283 |
|---|---|
| CAS | 60-29-7 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35702 |
| MDL Number | MFCD00011646 |
| SMILES | CCOCC |
| Synonym | diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether |
| IUPAC Name | ethoxyethane |
| InChI Key | RTZKZFJDLAIYFH-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
Diethyl Ether, for HPLC, Stabilised with Ethanol, Fisher Chemical™
CAS: 60-29-7 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00011646 InChI Key: RTZKZFJDLAIYFH-UHFFFAOYSA-N Synonym: diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether PubChem CID: 3283 ChEBI: CHEBI:35702 IUPAC Name: ethoxyethane SMILES: CCOCC
| PubChem CID | 3283 |
|---|---|
| CAS | 60-29-7 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35702 |
| MDL Number | MFCD00011646 |
| SMILES | CCOCC |
| Synonym | diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether |
| IUPAC Name | ethoxyethane |
| InChI Key | RTZKZFJDLAIYFH-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
Ethanol-d6, for NMR, anhydrous, 99 atom % D
CAS: 1516-08-1 Molecular Formula: C2H6O Molecular Weight (g/mol): 52.106 MDL Number: MFCD00051020 InChI Key: LFQSCWFLJHTTHZ-LIDOUZCJSA-N Synonym: ethanol-d6,2h6 ethanol,hexadeuteroethanol,2 h? ethan 2 h ol,ethyl-d5 alcohol-d,ethyl alcohol-d6,ethanol d,ethanol-d6 9ci PubChem CID: 102138 IUPAC Name: 1,1,1,2,2-pentadeuterio-2-deuteriooxyethane SMILES: CCO
| PubChem CID | 102138 |
|---|---|
| CAS | 1516-08-1 |
| Molecular Weight (g/mol) | 52.106 |
| MDL Number | MFCD00051020 |
| SMILES | CCO |
| Synonym | ethanol-d6,2h6 ethanol,hexadeuteroethanol,2 h? ethan 2 h ol,ethyl-d5 alcohol-d,ethyl alcohol-d6,ethanol d,ethanol-d6 9ci |
| IUPAC Name | 1,1,1,2,2-pentadeuterio-2-deuteriooxyethane |
| InChI Key | LFQSCWFLJHTTHZ-LIDOUZCJSA-N |
| Molecular Formula | C2H6O |
Ethanol-d, for NMR, 99.5+ atom % D
CAS: 925-93-9 Molecular Formula: C2H6O Molecular Weight (g/mol): 47.075 MDL Number: MFCD00044669 InChI Key: LFQSCWFLJHTTHZ-WFVSFCRTSA-N Synonym: ethanol-d,ethanol-d1,deuteroethanol,ethyl alcohol-d,ethyl 2 alcohol,ethanol-od,etod,ethan ol-d,ethanol-d 9ci,o-2h ethanol PubChem CID: 123093 IUPAC Name: deuteriooxyethane SMILES: CCO
| PubChem CID | 123093 |
|---|---|
| CAS | 925-93-9 |
| Molecular Weight (g/mol) | 47.075 |
| MDL Number | MFCD00044669 |
| SMILES | CCO |
| Synonym | ethanol-d,ethanol-d1,deuteroethanol,ethyl alcohol-d,ethyl 2 alcohol,ethanol-od,etod,ethan ol-d,ethanol-d 9ci,o-2h ethanol |
| IUPAC Name | deuteriooxyethane |
| InChI Key | LFQSCWFLJHTTHZ-WFVSFCRTSA-N |
| Molecular Formula | C2H6O |
Diethyl ether, 99+%, for spectroscopy, stabilized with ethanol
CAS: 60-29-7 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00011646 InChI Key: RTZKZFJDLAIYFH-UHFFFAOYSA-N Synonym: diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether PubChem CID: 3283 ChEBI: CHEBI:35702 IUPAC Name: ethoxyethane SMILES: CCOCC
| PubChem CID | 3283 |
|---|---|
| CAS | 60-29-7 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35702 |
| MDL Number | MFCD00011646 |
| SMILES | CCOCC |
| Synonym | diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether |
| IUPAC Name | ethoxyethane |
| InChI Key | RTZKZFJDLAIYFH-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
Diethyl ether, ACS, 98% min, stab. with 0.001% BHT and 3% ethanol
CAS: 60-29-7 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00011646 InChI Key: RTZKZFJDLAIYFH-UHFFFAOYSA-N Synonym: diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether PubChem CID: 3283 ChEBI: CHEBI:35702 IUPAC Name: ethoxyethane SMILES: CCOCC
| PubChem CID | 3283 |
|---|---|
| CAS | 60-29-7 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35702 |
| MDL Number | MFCD00011646 |
| SMILES | CCOCC |
| Synonym | diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether |
| IUPAC Name | ethoxyethane |
| InChI Key | RTZKZFJDLAIYFH-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
2-Methoxy-d3-ethanol, CDN
Discover 4000+ high-quality deuterated compounds, shipping directly from stock for speed. We offer many unique API’s, including active pharmaceutical ingredients, nitrosoamines, amino acids, steroids, gases, pesticides, and fatty acids.
| Percent Purity | 98 atom % D, min 98% Chemical Purity |
|---|---|
| CAS | 97840-77-2 |
| Molecular Weight (g/mol) | 79.1129 |
| InChI Formula | InChI=1 S/C3H8O2/c1-5-3-2-4/h4H,2-3H2,1H3/i1D3 |
| Chemical Name or Material | 2-Methoxyethanol-D3 (methoxy-D3) |
| SMILES | [2 H]C([2 H])([2 H])OCCO |
| Synonym | Ethanol, 2-(methoxy-d3)- (9 CI),2-Methoxy-d3-ethanol,2-(Methoxy-d3)ethanol,2-Methoxyethanol-d3,2-Methoxyethanol-D3 (methoxy-D3),Ethylene Glycol Monomethyl-d3 Ether |
| Recommended Storage | Room Temperature |
| IUPAC Name | 2-(trideuteriomethoxy)ethanol |
| Molecular Formula | C3 D3 H5 O2 |
| Formula Weight | 79.0713 g/mol |
2-Phenyl-d5-ethanol, CDN
Discover 4000+ high-quality deuterated compounds, shipping directly from stock for speed. We offer many unique API’s, including active pharmaceutical ingredients, nitrosoamines, amino acids, steroids, gases, pesticides, and fatty acids.
| Percent Purity | 98 atom % D, min 98% Chemical Purity |
|---|---|
| CAS | 35845-63-7 |
| Molecular Weight (g/mol) | 127.2 |
| InChI Formula | InChI=1 S/C8H10O/c9-7-6-8-4-2-1-3-5-8/h1-5,9 H,6-7H2/i1D,2 D,3 D,4 D,5 D |
| Chemical Name or Material | Phenethyl Alcohol-d5 |
| SMILES | [2 H]c1c([2 H])c([2 H])c(CCO)c([2 H])c1[2 H] |
| Synonym | Benzeneethanol-d5,(2-Hydroxyethyl)benzene-d5,2-Phenethanol-d5,2-Phenyl-1-ethanol-d5,2-Phenylethanol-d5,Phenylethyl Alcohol-d5,β-Phenethanol-d5,β-Phenethyl Alcohol-d5,β-Phenethylol-d5,β-Phenylethanol-d5,β-Phenylethyl Alcohol-d5,NSC 406252-d5,2-Phenyl-d5-ethanol |
| Recommended Storage | Room Temperature |
| IUPAC Name | 2-(2,3,4,5,6-pentadeuteriophenyl)ethanol |
| Molecular Formula | C8 D5 H5 O |
| Formula Weight | 127.1045 g/mol |
Ethanol-1,1,2,2-d4-amine, CDN
Discover 4000+ high-quality deuterated compounds, shipping directly from stock for speed. We offer many unique API’s, including active pharmaceutical ingredients, nitrosoamines, amino acids, steroids, gases, pesticides, and fatty acids.
| Percent Purity | 99 atom % D, min 98% Chemical Purity |
|---|---|
| CAS | 85047-08-1 |
| Molecular Weight (g/mol) | 65.11 |
| InChI Formula | InChI=1 S/C2H7NO/c3-1-2-4/h4H,1-3H2/i1D2,2D2 |
| Chemical Name or Material | Ethanolamine D4 |
| SMILES | [2 H]C([2 H])(N)C([2 H])([2 H])O |
| Recommended Storage | Room Temperature |
| IUPAC Name | 2-amino-1,1,2,2-tetradeuterioethanol |
| Molecular Formula | C2 2H4 H3 N O |
| Formula Weight | 65.0779 g/mol |
(±)-1-Phenyl-d5-ethanol, CDN
Discover 4000+ high-quality deuterated compounds, shipping directly from stock for speed. We offer many unique API’s, including active pharmaceutical ingredients, nitrosoamines, amino acids, steroids, gases, pesticides, and fatty acids.
| Percent Purity | 98 atom % D, min 98% Chemical Purity |
|---|---|
| CAS | 90162-45-1 |
| Molecular Weight (g/mol) | 127.1952 |
| InChI Formula | InChI=1 S/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9 H,1H3/i2D,3 D,4 D,5 D,6 D |
| Chemical Name or Material | 1-Phenylethanol-D5 (phenyl-D5) |
| SMILES | [2 H]c1c([2 H])c([2 H])c(C(C)O)c([2 H])c1[2 H] |
| Synonym | Benzene-2,3,4,5,6-d5-methanol, α-methyl- (ACI),Benzene-d5-methanol, α-methyl- (9 CI),α-Methylbenzene-2,3,4,5,6-d5-methanol (ACI),1-(2,3,4,5,6-Pentadeuteriophenyl)ethanol,1-(Phenyl-d5)ethanol,(±)-1-Phenyl-d5-ethanol,(±)-1-Phenyl-d5-ethanol,(±)-1-Phenyl-d5-ethanol |
| Recommended Storage | Room Temperature |
| IUPAC Name | 1-(2,3,4,5,6-pentadeuteriophenyl)ethanol |
| Molecular Formula | C8 D5 H5 O |
| Formula Weight | 127.1045 g/mol |
Ethanol-1,1,2,2-d4-amine HCl, CDN
Discover 4000+ high-quality deuterated compounds, shipping directly from stock for speed. We offer many unique API’s, including active pharmaceutical ingredients, nitrosoamines, amino acids, steroids, gases, pesticides, and fatty acids.
| Percent Purity | 98 atom % D, min 98% Chemical Purity |
|---|---|
| CAS | 2483832-03-5 |
| Molecular Weight (g/mol) | 101.5687 |
| InChI Formula | InChI=1 S/C2H7NO.ClH/c3-1-2-4;/h4H,1-3H2;1 H/i1D2,2D2; |
| Chemical Name or Material | 2-Aminoethanol-1,1,2,2-D4 Hydrochloride |
| SMILES | Cl.[2 H]C([2 H])(N)C([2 H])([2 H])O |
| Synonym | Ethan-1,1,2,2-d4-ol, 2-amino-, hydrochloride (1:1) (ACI),2-Aminoethan-1,1,2,2-d4-ol hydrochloride,2-Aminoethanol-d4 hydrochloride,2-Aminoethanol-1,1,2,2-D4 hydrochloride,Ethanolamine-d4 hydrochloride,Ethanol-1,1,2,2-d4-amine hydrochloride |
| Recommended Storage | Room Temperature |
| IUPAC Name | 2-amino-1,1,2,2-tetradeuterioethanol;hydrochloride |
| Molecular Formula | C2 D4 H3 N O . Cl H |
| Formula Weight | 101.0545 g/mol |
2-[(2,6-Dichlorobenzyl)oxy]ethanol-d4, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molecular Weight (g/mol) | 225.11 |
|---|---|
| InChI Formula | InChI=1S/C9H10Cl2O2/c10-8-2-1-3-9(11)7(8)6-13-5-4-12/h1-3,12H,4-6H2/i4D2,5D2 |
| Chemical Name or Material | 2-[(2,6-Dichlorobenzyl)oxy]ethanol-d4 |
| SMILES | ClC1=C(C(Cl)=CC=C1)COC([2H])([2H])C([2H])([2H])O |
| IUPAC Name | 2-((2,6-dichlorobenzyl)oxy)ethan-1,1,2,2-d4-1-ol |
| Molecular Formula | C9H6D4Cl2O2 |
| Formula Weight | 224.03 |