Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Aluminum isopropoxide, 99.99%, (trace metal basis)
CAS: 555-31-7 Molecular Formula: C9H21AlO3 Molecular Weight (g/mol): 204.25 MDL Number: MFCD00008870 InChI Key: SMZOGRDCAXLAAR-UHFFFAOYSA-N Synonym: aluminum isopropoxide,aluminum isopropoxide,aluminum isopropylate,aluminum triisopropoxide,triisopropoxyaluminum,aliso,aluminum triisopropanolate,2-propanol, aluminum salt,triisopropyloxyaluminum,aluminum triisopropylate PubChem CID: 11143 IUPAC Name: aluminum;propan-2-olate SMILES: CC(C)[O-].CC(C)[O-].CC(C)[O-].[Al+3]
| PubChem CID | 11143 |
|---|---|
| CAS | 555-31-7 |
| Molecular Weight (g/mol) | 204.25 |
| MDL Number | MFCD00008870 |
| SMILES | CC(C)[O-].CC(C)[O-].CC(C)[O-].[Al+3] |
| Synonym | aluminum isopropoxide,aluminum isopropoxide,aluminum isopropylate,aluminum triisopropoxide,triisopropoxyaluminum,aliso,aluminum triisopropanolate,2-propanol, aluminum salt,triisopropyloxyaluminum,aluminum triisopropylate |
| IUPAC Name | aluminum;propan-2-olate |
| InChI Key | SMZOGRDCAXLAAR-UHFFFAOYSA-N |
| Molecular Formula | C9H21AlO3 |
Tetrakis(triphenylphosphine)palladium(0), 99.9%, (trace metal basis)
CAS: 14221-01-3 Molecular Formula: C72H60P4Pd Molecular Weight (g/mol): 1155.59 MDL Number: MFCD00010012 InChI Key: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC Name: palladium;triphenylphosphane SMILES: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11979704 |
|---|---|
| CAS | 14221-01-3 |
| Molecular Weight (g/mol) | 1155.59 |
| MDL Number | MFCD00010012 |
| SMILES | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| IUPAC Name | palladium;triphenylphosphane |
| InChI Key | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molecular Formula | C72H60P4Pd |
Tetraammineplatinum(II) chloride hydrate, 99.995%, (trace metal basis)
CAS: 108374-32-9 Molecular Formula: Cl2H12N4Pt Molecular Weight (g/mol): 334.11 MDL Number: MFCD00149947 InChI Key: KHCPSOMSJYAQSY-UHFFFAOYSA-L Synonym: platinum 4+ ion hydrate hydrochloride tetraazanide IUPAC Name: platinum(2+) tetraamine dichloride SMILES: N.N.N.N.[Cl-].[Cl-].[Pt++]
| CAS | 108374-32-9 |
|---|---|
| Molecular Weight (g/mol) | 334.11 |
| MDL Number | MFCD00149947 |
| SMILES | N.N.N.N.[Cl-].[Cl-].[Pt++] |
| Synonym | platinum 4+ ion hydrate hydrochloride tetraazanide |
| IUPAC Name | platinum(2+) tetraamine dichloride |
| InChI Key | KHCPSOMSJYAQSY-UHFFFAOYSA-L |
| Molecular Formula | Cl2H12N4Pt |
Tris(triphenylphosphine)rhodium(I) chloride, 99.99%, (trace metal basis)
CAS: 14694-95-2 Molecular Formula: C54H45ClP3Rh Molecular Weight (g/mol): 925.23 MDL Number: MFCD00010016 InChI Key: IXAYKDDZKIZSPV-UHFFFAOYSA-M Synonym: chlorotris triphenylphosphine rhodium i,chlorotris triphenylphosphine rhodium,tris triphenylphosphine rhodium i chloride,tris triphenylphosphine chlororhodium,wilkinson's catalyst,unii-0fv534bkev,tris triphenylphosphine rhodium chloride,0fv534bkev,rhodium; triphenylphosphane; chloride PubChem CID: 84599 SMILES: [Cl-].[Rh+].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 84599 |
|---|---|
| CAS | 14694-95-2 |
| Molecular Weight (g/mol) | 925.23 |
| MDL Number | MFCD00010016 |
| SMILES | [Cl-].[Rh+].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | chlorotris triphenylphosphine rhodium i,chlorotris triphenylphosphine rhodium,tris triphenylphosphine rhodium i chloride,tris triphenylphosphine chlororhodium,wilkinson's catalyst,unii-0fv534bkev,tris triphenylphosphine rhodium chloride,0fv534bkev,rhodium; triphenylphosphane; chloride |
| InChI Key | IXAYKDDZKIZSPV-UHFFFAOYSA-M |
| Molecular Formula | C54H45ClP3Rh |
Potassium hydrogen phthalate, 99.99%, acidimetric standard
CAS: 877-24-7 InChI Key: IWZKICVEHNUQTL-UHFFFAOYSA-M Synonym: potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic PubChem CID: 23676735 IUPAC Name: potassium;2-carboxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+]
| PubChem CID | 23676735 |
|---|---|
| CAS | 877-24-7 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| Synonym | potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic |
| IUPAC Name | potassium;2-carboxybenzoate |
| InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
Chloropentaammineiridium(III) chloride, 99.9% (metals basis), Ir 49.6% min
CAS: 15742-38-8 Molecular Formula: Cl3H15IrN5 Molecular Weight (g/mol): 383.722 MDL Number: MFCD00798542 InChI Key: DYGMZANLQHDDSH-UHFFFAOYSA-K Synonym: chloropentaammineiridium iii chloride,cl3ir.5nh3,chloropentaammineiridium iii chloride, ir min,pentaamminechloroiridium iii chloride trace metals basis PubChem CID: 15541975 IUPAC Name: azane;trichloroiridium SMILES: N.N.N.N.N.Cl[Ir](Cl)Cl
| PubChem CID | 15541975 |
|---|---|
| CAS | 15742-38-8 |
| Molecular Weight (g/mol) | 383.722 |
| MDL Number | MFCD00798542 |
| SMILES | N.N.N.N.N.Cl[Ir](Cl)Cl |
| Synonym | chloropentaammineiridium iii chloride,cl3ir.5nh3,chloropentaammineiridium iii chloride, ir min,pentaamminechloroiridium iii chloride trace metals basis |
| IUPAC Name | azane;trichloroiridium |
| InChI Key | DYGMZANLQHDDSH-UHFFFAOYSA-K |
| Molecular Formula | Cl3H15IrN5 |
Bis(4-tert-butylphenyl)iodonium p-toluenesulfonate, Electronic grade, 99+% (metals basis)
CAS: 131717-99-2 Molecular Formula: C27H33IO3S Molecular Weight (g/mol): 564.52 MDL Number: MFCD02683472 InChI Key: UEJFJTOGXLEPIV-UHFFFAOYSA-M Synonym: bis 4-tert-butylphenyl iodanium tosylate,bis 4-tert-butylphenyl iodonium p-toluenesulfonate,4,4-di-tert-butyldiphenyliodonium p-toluenesulfonate,acmc-20n1fr,bis 4-tert-butylphenyl iodonium tosylate,bis 4-tert-butylphenl iodonium p,bis p-tert-butylphenyl iodonium p-toluenesulfonate,bis 4-tert-butylphenyl iodonium p-toluenesulfonate, electronic grade,bis 4-tert-butylphenyl iodonium p-toluenesulfonate, electronic grade trace metals basis PubChem CID: 16216932 IUPAC Name: bis(4-tert-butylphenyl)iodanium;4-methylbenzenesulfonate SMILES: CC1=CC=C(C=C1)S([O-])(=O)=O.CC(C)(C)C1=CC=C([I+]C2=CC=C(C=C2)C(C)(C)C)C=C1
| PubChem CID | 16216932 |
|---|---|
| CAS | 131717-99-2 |
| Molecular Weight (g/mol) | 564.52 |
| MDL Number | MFCD02683472 |
| SMILES | CC1=CC=C(C=C1)S([O-])(=O)=O.CC(C)(C)C1=CC=C([I+]C2=CC=C(C=C2)C(C)(C)C)C=C1 |
| Synonym | bis 4-tert-butylphenyl iodanium tosylate,bis 4-tert-butylphenyl iodonium p-toluenesulfonate,4,4-di-tert-butyldiphenyliodonium p-toluenesulfonate,acmc-20n1fr,bis 4-tert-butylphenyl iodonium tosylate,bis 4-tert-butylphenl iodonium p,bis p-tert-butylphenyl iodonium p-toluenesulfonate,bis 4-tert-butylphenyl iodonium p-toluenesulfonate, electronic grade,bis 4-tert-butylphenyl iodonium p-toluenesulfonate, electronic grade trace metals basis |
| IUPAC Name | bis(4-tert-butylphenyl)iodanium;4-methylbenzenesulfonate |
| InChI Key | UEJFJTOGXLEPIV-UHFFFAOYSA-M |
| Molecular Formula | C27H33IO3S |
Potassium isopropoxide, 99% (metals basis), 5% w/v in isopropanol
CAS: 6831-82-9 Molecular Formula: C3H7KO Molecular Weight (g/mol): 98.186 MDL Number: MFCD00210641 InChI Key: WQKGAJDYBZOFSR-UHFFFAOYSA-N Synonym: potassium isopropoxide,potassium propan-2-olate,koipr,potassium isopropoxide w/v in isopropanol,potassium isopropoxide w/v in 2-propanol trace metals basis 25ml PubChem CID: 23663646 IUPAC Name: potassium;propan-2-olate SMILES: CC(C)[O-].[K+]
| PubChem CID | 23663646 |
|---|---|
| CAS | 6831-82-9 |
| Molecular Weight (g/mol) | 98.186 |
| MDL Number | MFCD00210641 |
| SMILES | CC(C)[O-].[K+] |
| Synonym | potassium isopropoxide,potassium propan-2-olate,koipr,potassium isopropoxide w/v in isopropanol,potassium isopropoxide w/v in 2-propanol trace metals basis 25ml |
| IUPAC Name | potassium;propan-2-olate |
| InChI Key | WQKGAJDYBZOFSR-UHFFFAOYSA-N |
| Molecular Formula | C3H7KO |
Mercury(II) trifluoromethanesulfonate, 98%
CAS: 49540-00-3 Molecular Formula: C2F6HgO6S2 Molecular Weight (g/mol): 498.718 MDL Number: MFCD00144746 InChI Key: BPVYMDMPLCOQPJ-UHFFFAOYSA-L Synonym: mercury ii trifluoromethanesulfonate,mercury triflate,mercury 2+ ditriflate,hg otf 2,ksc491a8p,mercury ii trifluoromethanesulphonate,mercury 2+ ; trifluoromethanesulfonate,mercury 2+ ion ditrifluoromethanesulfonate,mercury ii trifluoromethanesulfonate trace metals basis PubChem CID: 2775250 IUPAC Name: mercury(2+);trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Hg+2]
| PubChem CID | 2775250 |
|---|---|
| CAS | 49540-00-3 |
| Molecular Weight (g/mol) | 498.718 |
| MDL Number | MFCD00144746 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Hg+2] |
| Synonym | mercury ii trifluoromethanesulfonate,mercury triflate,mercury 2+ ditriflate,hg otf 2,ksc491a8p,mercury ii trifluoromethanesulphonate,mercury 2+ ; trifluoromethanesulfonate,mercury 2+ ion ditrifluoromethanesulfonate,mercury ii trifluoromethanesulfonate trace metals basis |
| IUPAC Name | mercury(2+);trifluoromethanesulfonate |
| InChI Key | BPVYMDMPLCOQPJ-UHFFFAOYSA-L |
| Molecular Formula | C2F6HgO6S2 |
Iron(III) ethoxide, 99.6% (metals basis)
CAS: 5058-42-4 Molecular Formula: C6H15FeO3 Molecular Weight (g/mol): 191.028 MDL Number: MFCD00078028 InChI Key: JTPUGUWXHGEEHW-UHFFFAOYSA-N Synonym: iron iii ethoxide,iron 3+ ethanolate,triethoxyiron iii,ethanolate; iron 3+,acmc-1alnr,iron 3+ tris ethoxide,iron 3+ ion tris ethoxide,iron iii ethoxide trace metals basis 500mg PubChem CID: 6452222 IUPAC Name: ethanolate;iron(3+) SMILES: CC[O-].CC[O-].CC[O-].[Fe+3]
| PubChem CID | 6452222 |
|---|---|
| CAS | 5058-42-4 |
| Molecular Weight (g/mol) | 191.028 |
| MDL Number | MFCD00078028 |
| SMILES | CC[O-].CC[O-].CC[O-].[Fe+3] |
| Synonym | iron iii ethoxide,iron 3+ ethanolate,triethoxyiron iii,ethanolate; iron 3+,acmc-1alnr,iron 3+ tris ethoxide,iron 3+ ion tris ethoxide,iron iii ethoxide trace metals basis 500mg |
| IUPAC Name | ethanolate;iron(3+) |
| InChI Key | JTPUGUWXHGEEHW-UHFFFAOYSA-N |
| Molecular Formula | C6H15FeO3 |
Europium(III) acetate hydrate, 99.99%
CAS: 62667-64-5 Molecular Formula: C6H9EuO6 Molecular Weight (g/mol): 329.10 MDL Number: MFCD00150115 InChI Key: LNYNHRRKSYMFHF-UHFFFAOYSA-K Synonym: europium iii acetate hydrate 1:3:x,europium acetate hydrate,europium acetate,hydrate,europium iii acetatehydrate,c6h9euo6.h2o,europium iii acetate hydrate, reacton,europium iii acetate hydrate, reacton?,bis acetyloxy europio acetate hydrate,europium iii acetate hydrate trace metals basis PubChem CID: 16212055 SMILES: [Eu+3].CC([O-])=O.CC([O-])=O.CC([O-])=O
| PubChem CID | 16212055 |
|---|---|
| CAS | 62667-64-5 |
| Molecular Weight (g/mol) | 329.10 |
| MDL Number | MFCD00150115 |
| SMILES | [Eu+3].CC([O-])=O.CC([O-])=O.CC([O-])=O |
| Synonym | europium iii acetate hydrate 1:3:x,europium acetate hydrate,europium acetate,hydrate,europium iii acetatehydrate,c6h9euo6.h2o,europium iii acetate hydrate, reacton,europium iii acetate hydrate, reacton?,bis acetyloxy europio acetate hydrate,europium iii acetate hydrate trace metals basis |
| InChI Key | LNYNHRRKSYMFHF-UHFFFAOYSA-K |
| Molecular Formula | C6H9EuO6 |
Tetraammineplatinum(II) hydrogen carbonate, Thermo Scientific Chemicals
CAS: 123439-82-7 Molecular Formula: C2H16N4O6Pt Molecular Weight (g/mol): 387.26 MDL Number: MFCD03788256 InChI Key: AGUMVCVDCJQCIQ-UHFFFAOYSA-N Synonym: tetraammineplatinum ii hydrogen carbonate,platinum tetrammine hydrogencarbonate,c2h14n4o6pt,tetraammineplatinum ii hydrogencarbonate,carboxyoxy platinio hydrogen carbonate tetraamine,tetraammineplatinum ii hydrogencarbonate trace metals basis IUPAC Name: bis(carbonic acid) tetraamine platinum SMILES: N.N.N.N.[Pt].OC(O)=O.OC(O)=O
| CAS | 123439-82-7 |
|---|---|
| Molecular Weight (g/mol) | 387.26 |
| MDL Number | MFCD03788256 |
| SMILES | N.N.N.N.[Pt].OC(O)=O.OC(O)=O |
| Synonym | tetraammineplatinum ii hydrogen carbonate,platinum tetrammine hydrogencarbonate,c2h14n4o6pt,tetraammineplatinum ii hydrogencarbonate,carboxyoxy platinio hydrogen carbonate tetraamine,tetraammineplatinum ii hydrogencarbonate trace metals basis |
| IUPAC Name | bis(carbonic acid) tetraamine platinum |
| InChI Key | AGUMVCVDCJQCIQ-UHFFFAOYSA-N |
| Molecular Formula | C2H16N4O6Pt |
Iron(III) ethoxide, soluble polymeric mixture, Thermo Scientific™
CAS: 5058-42-4 Molecular Formula: C6H15FeO3 Molecular Weight (g/mol): 191.028 MDL Number: MFCD00078028 InChI Key: JTPUGUWXHGEEHW-UHFFFAOYSA-N Synonym: iron iii ethoxide,iron 3+ ethanolate,triethoxyiron iii,ethanolate; iron 3+,acmc-1alnr,iron 3+ tris ethoxide,iron 3+ ion tris ethoxide,iron iii ethoxide trace metals basis 500mg PubChem CID: 6452222 IUPAC Name: ethanolate;iron(3+) SMILES: CC[O-].CC[O-].CC[O-].[Fe+3]
| PubChem CID | 6452222 |
|---|---|
| CAS | 5058-42-4 |
| Molecular Weight (g/mol) | 191.028 |
| MDL Number | MFCD00078028 |
| SMILES | CC[O-].CC[O-].CC[O-].[Fe+3] |
| Synonym | iron iii ethoxide,iron 3+ ethanolate,triethoxyiron iii,ethanolate; iron 3+,acmc-1alnr,iron 3+ tris ethoxide,iron 3+ ion tris ethoxide,iron iii ethoxide trace metals basis 500mg |
| IUPAC Name | ethanolate;iron(3+) |
| InChI Key | JTPUGUWXHGEEHW-UHFFFAOYSA-N |
| Molecular Formula | C6H15FeO3 |