Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Potassium formate, 99% (water less than 2%)
CAS: 590-29-4 Molecular Formula: CHKO2 Molecular Weight (g/mol): 84.115 MDL Number: MFCD00013100 InChI Key: WFIZEGIEIOHZCP-UHFFFAOYSA-M Synonym: potassium formate,formic acid potassium salt,formic acid, potassium salt,formic acid, k salt,hcook,mravencan draselny czech,hco2k,formic acid, potassium salt 1:1,potassium formira,64-18-6 parent PubChem CID: 2735122 ChEBI: CHEBI:63316 IUPAC Name: potassium;formate SMILES: C(=O)[O-].[K+]
| PubChem CID | 2735122 |
|---|---|
| CAS | 590-29-4 |
| Molecular Weight (g/mol) | 84.115 |
| ChEBI | CHEBI:63316 |
| MDL Number | MFCD00013100 |
| SMILES | C(=O)[O-].[K+] |
| Synonym | potassium formate,formic acid potassium salt,formic acid, potassium salt,formic acid, k salt,hcook,mravencan draselny czech,hco2k,formic acid, potassium salt 1:1,potassium formira,64-18-6 parent |
| IUPAC Name | potassium;formate |
| InChI Key | WFIZEGIEIOHZCP-UHFFFAOYSA-M |
| Molecular Formula | CHKO2 |
Thermo Scientific Chemicals Glyoxal, pure, 40 wt.% solution in water
CAS: 107-22-2 | C2H2O2 | 58.04 g/mol
| Viscosity | 8 mPa.s (20°C) |
|---|---|
| Linear Formula | HCOCHO |
| Molecular Weight (g/mol) | 58.04 |
| ChEBI | CHEBI:34779 |
| InChI Key | LEQAOMBKQFMDFZ-UHFFFAOYSA-N |
| Density | 1.2650g/mL |
| PubChem CID | 7860 |
| Name Note | 40 wt.% Solution in Water |
| Percent Purity | 39 to 41% (Titrimetry other) |
| Fieser | 01,413 |
| Formula Weight | 58.04 |
| Melting Point | -14.0°C |
| Boiling Point | 104.0°C |
| Color | Colorless to Yellow |
| Physical Form | Liquid |
| Chemical Name or Material | Glyoxal |
| Grade | Pure |
| SMILES | C(=O)C=O |
| Merck Index | 15, 4544 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. Call a POISON CENTER or doctor/physician if you feel unwell. IF ON SKIN: Wash with plenty of soap and water. If skin irritatio |
| MDL Number | MFCD00006957 |
| Health Hazard 2 | GHS H Statement Suspected of causing genetic defects if inhaled. Harmful if inhaled. Causes serious eye irritation. Causes skin irritation. May cause an allergic skin reaction. May cause respiratory irritation. |
| Solubility Information | Solubility in water: miscible. |
| Flash Point | >104°C |
| Health Hazard 1 | GHS Signal Word: Warning |
| Synonym | glyoxal,ethanedial,oxalaldehyde,1,2-ethanedione,glyoxylaldehyde,biformal,biformyl,diformal,diformyl,aerotex glyoxal 40 |
| Recommended Storage | May darken during storage |
| IUPAC Name | oxaldehyde |
| Beilstein | 01, 759 |
| Molecular Formula | C2H2O2 |
| EINECS Number | 203-474-9 |
| Specific Gravity | 1.265 |
Poly(acrylic acid), 25 wt% soln. in water
CAS: 9003-01-4 Molecular Formula: (C3H4O2)n Molecular Weight (g/mol): 72.06 MDL Number: MFCD00084394 InChI Key: NNMHYFLPFNGQFZ-UHFFFAOYSA-M Synonym: acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer PubChem CID: 6581 ChEBI: CHEBI:18308 IUPAC Name: Poly(acrylic acid) SMILES: OC(=O)C(-*)C-*
| PubChem CID | 6581 |
|---|---|
| CAS | 9003-01-4 |
| Molecular Weight (g/mol) | 72.06 |
| ChEBI | CHEBI:18308 |
| MDL Number | MFCD00084394 |
| SMILES | OC(=O)C(-*)C-* |
| Synonym | acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer |
| IUPAC Name | Poly(acrylic acid) |
| InChI Key | NNMHYFLPFNGQFZ-UHFFFAOYSA-M |
| Molecular Formula | (C3H4O2)n |
Paraffin Liquid, Pure, Water White, d=0.83-0.86, Fisher Chemical™
CAS: 8042-47-5 Molecular Formula: C16H10N2Na2O7S2 Molecular Weight (g/mol): 452.363 MDL Number: 131611 InChI Key: AEOVEGJBKQQFOP-DDVLFWKVSA-L Synonym: acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g PubChem CID: 9566064 IUPAC Name: disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate SMILES: C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 9566064 |
|---|---|
| CAS | 8042-47-5 |
| Molecular Weight (g/mol) | 452.363 |
| MDL Number | 131611 |
| SMILES | C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g |
| IUPAC Name | disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate |
| InChI Key | AEOVEGJBKQQFOP-DDVLFWKVSA-L |
| Molecular Formula | C16H10N2Na2O7S2 |
Thiamine hydrochloride, 99% (dry wt.), may cont. up to 5% water
CAS: 67-03-8 Molecular Formula: C12H18Cl2N4OS Molecular Weight (g/mol): 337.263 MDL Number: MFCD00012780 InChI Key: DPJRMOMPQZCRJU-UHFFFAOYSA-M Synonym: thiamine hydrochloride,vitamin b1 hydrochloride,thiamine hcl,aneurine hydrochloride,berin,thiamine chloride hydrochloride,trophite,thiamin chloride,thiamine dichloride,thiaminium chloride PubChem CID: 6202 ChEBI: CHEBI:49105 IUPAC Name: 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;chloride;hydrochloride SMILES: CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO.Cl.[Cl-]
| PubChem CID | 6202 |
|---|---|
| CAS | 67-03-8 |
| Molecular Weight (g/mol) | 337.263 |
| ChEBI | CHEBI:49105 |
| MDL Number | MFCD00012780 |
| SMILES | CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO.Cl.[Cl-] |
| Synonym | thiamine hydrochloride,vitamin b1 hydrochloride,thiamine hcl,aneurine hydrochloride,berin,thiamine chloride hydrochloride,trophite,thiamin chloride,thiamine dichloride,thiaminium chloride |
| IUPAC Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;chloride;hydrochloride |
| InChI Key | DPJRMOMPQZCRJU-UHFFFAOYSA-M |
| Molecular Formula | C12H18Cl2N4OS |
Thermo Scientific Chemicals Methyl cellulose, viscosity 15 cP (2% solution in water)
CAS: 9004-67-5 Molecular Formula: C20H38O11 Molecular Weight (g/mol): 454.513 MDL Number: MFCD00081763 InChI Key: YLGXILFCIXHCMC-JHGZEJCSSA-N PubChem CID: 51063134 IUPAC Name: (5R)-2,3,4-trimethoxy-6-(methoxymethyl)-5-[(2S)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxane SMILES: COCC1C(C(C(C(O1)OC2C(OC(C(C2OC)OC)OC)COC)OC)OC)OC
| PubChem CID | 51063134 |
|---|---|
| CAS | 9004-67-5 |
| Molecular Weight (g/mol) | 454.513 |
| MDL Number | MFCD00081763 |
| SMILES | COCC1C(C(C(C(O1)OC2C(OC(C(C2OC)OC)OC)COC)OC)OC)OC |
| IUPAC Name | (5R)-2,3,4-trimethoxy-6-(methoxymethyl)-5-[(2S)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxane |
| InChI Key | YLGXILFCIXHCMC-JHGZEJCSSA-N |
| Molecular Formula | C20H38O11 |
Paraffin Liquid, Pure, Water White, d=0.83-0.86, Fisher Chemical™
CAS: 8042-47-5 Molecular Formula: C16H10N2Na2O7S2 Molecular Weight (g/mol): 452.363 MDL Number: 131611 InChI Key: AEOVEGJBKQQFOP-DDVLFWKVSA-L Synonym: acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g PubChem CID: 9566064 IUPAC Name: disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate SMILES: C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 9566064 |
|---|---|
| CAS | 8042-47-5 |
| Molecular Weight (g/mol) | 452.363 |
| MDL Number | 131611 |
| SMILES | C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g |
| IUPAC Name | disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate |
| InChI Key | AEOVEGJBKQQFOP-DDVLFWKVSA-L |
| Molecular Formula | C16H10N2Na2O7S2 |
tert-Butyl hydroperoxide, 70% Solution in water
CAS: 75-91-2 Molecular Formula: C4H10O2 Molecular Weight (g/mol): 90.12 InChI Key: CIHOLLKRGTVIJN-UHFFFAOYSA-N Synonym: tert-butyl hydroperoxide,tbhp,t-butyl hydroperoxide,tert-butylhydroperoxide,perbutyl h,t-butylhydroperoxide,cadox tbh,hydroperoxide, 1,1-dimethylethyl,1,1-dimethylethyl hydroperoxide,terc. butylhydroperoxid PubChem CID: 6410 ChEBI: CHEBI:64090 IUPAC Name: 2-hydroperoxy-2-methylpropane SMILES: CC(C)(C)OO
| PubChem CID | 6410 |
|---|---|
| CAS | 75-91-2 |
| Molecular Weight (g/mol) | 90.12 |
| ChEBI | CHEBI:64090 |
| SMILES | CC(C)(C)OO |
| Synonym | tert-butyl hydroperoxide,tbhp,t-butyl hydroperoxide,tert-butylhydroperoxide,perbutyl h,t-butylhydroperoxide,cadox tbh,hydroperoxide, 1,1-dimethylethyl,1,1-dimethylethyl hydroperoxide,terc. butylhydroperoxid |
| IUPAC Name | 2-hydroperoxy-2-methylpropane |
| InChI Key | CIHOLLKRGTVIJN-UHFFFAOYSA-N |
| Molecular Formula | C4H10O2 |
Ethylamine, pure, 70% in water
CAS: 75-04-7 Molecular Formula: C2H7N Molecular Weight (g/mol): 45.09 InChI Key: QUSNBJAOOMFDIB-UHFFFAOYSA-N IUPAC Name: ethanamine SMILES: CCN
| CAS | 75-04-7 |
|---|---|
| Molecular Weight (g/mol) | 45.09 |
| SMILES | CCN |
| IUPAC Name | ethanamine |
| InChI Key | QUSNBJAOOMFDIB-UHFFFAOYSA-N |
| Molecular Formula | C2H7N |
Methylamine, extra pure, 40 wt% solution in water
CAS: 74-89-5 Molecular Formula: CH5N Molecular Weight (g/mol): 31.06 InChI Key: BAVYZALUXZFZLV-UHFFFAOYSA-N IUPAC Name: methanamine SMILES: CN
| CAS | 74-89-5 |
|---|---|
| Molecular Weight (g/mol) | 31.06 |
| SMILES | CN |
| IUPAC Name | methanamine |
| InChI Key | BAVYZALUXZFZLV-UHFFFAOYSA-N |
| Molecular Formula | CH5N |
| Linear Formula | (CH3)4NOH |
|---|---|
| Molecular Weight (g/mol) | 91.15 |
| InChI Key | WGTYBPLFGIVFAS-UHFFFAOYSA-M |
| Density | 1.0000g/mL |
| PubChem CID | 60966 |
| Name Note | 10% in Water |
| Percent Purity | 9.5 to 10.5% |
| Fieser | 11,514 |
| RTECS Number | PA0875000 |
| Formula Weight | 91.15 |
| Boiling Point | 100.0°C |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Tetramethylammonium hydroxide |
| SMILES | C[N+](C)(C)C.[OH-] |
| Merck Index | 15, 9371 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Do not breathe dust/fume/gas/mist/vapors/spray. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediat |
| MDL Number | MFCD00008280 |
| Health Hazard 2 | GHS H Statement Harmful if swallowed. Toxic in contact with skin. Causes severe skin burns and eye damage. |
| Solubility Information | Solubility in water: soluble. |
| Packaging | Plastic bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetramethylammonium hydroxide,tmah,hydroxyde de tetramethylammonium,nmw-w,nmd 3,tetramethyl ammonium hydroxide,unii-5gkp7317q2,ammonium, tetramethyl-, hydroxide,methanaminium, n,n,n-trimethyl-, hydroxide,tetramethylammoniumhydroxide |
| TSCA | TSCA |
| IUPAC Name | tetramethylazanium;hydroxide |
| Beilstein | 04, 50 |
| Molecular Formula | C4H13NO |
| EINECS Number | 200-882-9 |
| Specific Gravity | 1 |
| Viscosity | 20 mPa.s (50°C) |
|---|---|
| Linear Formula | OHC(CH2)3CHO |
| Molecular Weight (g/mol) | 100.12 |
| ChEBI | CHEBI:64276 |
| InChI Key | SXRSQZLOMIGNAQ-UHFFFAOYSA-N |
| Density | 1.1300g/mL |
| PubChem CID | 3485 |
| Name Note | 50 wt% Solution in Water |
| Fieser | 01,411 |
| pH | 3.2 to 4.2 |
| Formula Weight | 100.12 |
| Melting Point | -33.0°C |
| Boiling Point | 101.5°C (740.0 mmHg) |
| Physical Form | Solution |
| Chemical Name or Material | Glutaric dialdehyde |
| SMILES | O=CCCCC=O |
| Merck Index | 15, 4508 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. IF IN EYES: Rinse cautiously with water for several minu |
| MDL Number | MFCD00007025 |
| Health Hazard 2 | GHS H Statement Toxic if swallowed. Fatal if inhaled. Causes severe skin burns and eye damage. May cause allergy or asthma symptoms or breathing difficulties if inhaled. May cause an allergic skin reaction. Very toxic |
| Solubility Information | Solubility in water: soluble |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | glutaraldehyde,glutaral,glutaric dialdehyde,cidex,glutardialdehyde,1,5-pentanedial,sonacide,glutarol,aldesan,glutaric aldehyde |
| IUPAC Name | pentanedial |
| Beilstein | 01, 776 |
| Molecular Formula | C5H8O2 |
| EINECS Number | 203-856-5 |
| Specific Gravity | 1.13 |
3-Chloroperoxybenzoic Acid, 70-75%, balance 3-Chlorobenzoic Acid and water
3-Chloroperoxybenzoic acid, 70-75%, C7H5ClO3, CAS Number-937-14-4, 535-80-8, 7732-18-5 | CAS: 937-14-4 | C7H5ClO3 | 172.56 g/mol
| Linear Formula | ClC6H4CO3H |
|---|---|
| Molecular Weight (g/mol) | 172.56 |
| ChEBI | CHEBI:52091 |
| CAS Min % | 25.0 |
| InChI Key | NHQDETIJWKXCTC-UHFFFAOYSA-N |
| Density | 0.5600g/mL |
| PubChem CID | 70297 |
| Name Note | 70 - 75% |
| Percent Purity | 70-75% |
| Fieser | 01,135; 02,68; 03,49; 04,85; 05,120; 06,110; 07,62; 08,97; 09,108; 10,92; 11,122; 12,118; 13,76; 15,86; 16,80; 17,76 |
| RTECS Number | SD9470000 |
| Formula Weight | 172.57 |
| Melting Point | 92.0°C to 94.0°C |
| CAS Max % | 30.0 |
| Color | White |
| Physical Form | Moist Powder |
| SMILES | OOC(=O)C1=CC=CC(Cl)=C1 |
| Merck Index | 15,2154 |
| Assay Percent Range | di-m-Chlorobenzoyl peroxide: < 0.1% Typical (HPLC) |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Keep/Store away from clothing/ combustible materials. IF SWALLOWED: rin |
| MDL Number | MFCD00002127 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. Heating may cause a fire. |
| Solubility Information | Solubility in water: insoluble. Other solubilities: soluble in koh, soluble in chloroform and acetone |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | 3-chloroperoxybenzoic acid,3-chloroperbenzoic acid,mcpba,m-chloroperbenzoic acid,m-chloroperoxybenzoic acid,meta-chloroperoxybenzoic acid,benzenecarboperoxoic acid, 3-chloro,m-chlorobenzoyl hydroperoxide,meta-chloroperbenzoic acid,3-chlorobenzoperoxoic acid |
| TSCA | TSCA |
| IUPAC Name | 3-chlorobenzenecarboperoxoic acid |
| Beilstein | 09,IV,972 |
| Molecular Formula | C7H5ClO3 |
| EINECS Number | 213-322-3 |
| Specific Gravity | 0.56 |
Sulfuric acid, for analysis, ca. 96% solution in water
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N Synonym: oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| Synonym | oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
| Viscosity | 3.13 mPa.s (19°C) |
|---|---|
| Linear Formula | (CH3)4NOH |
| Molecular Weight (g/mol) | 91.15 |
| InChI Key | WGTYBPLFGIVFAS-UHFFFAOYSA-M |
| Density | 1.0140g/mL |
| PubChem CID | 60966 |
| Name Note | 25% in Water |
| Percent Purity | 23 to 27% |
| Fieser | 11,514 |
| RTECS Number | PA0875000 |
| Formula Weight | 91.15 |
| Melting Point | -25.0°C |
| Boiling Point | 102.0°C |
| Color | Colorless to Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Tetramethylammonium hydroxide |
| SMILES | C[N+](C)(C)C.[OH-] |
| Merck Index | 15,9371 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Rinse mouth. IF IN EYES: Rinse cautiously with water for several minutes. Remove con |
| MDL Number | MFCD00008280 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Toxic if swallowed. Fatal in contact with skin. Causes damage to organs. Causes damage to organs through prolonged or repeated exposure. Toxic to aquatic life w |
| Solubility Information | Solubility in water: soluble. |
| Packaging | Plastic bottle |
| Flash Point | >95°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Refractive Index | 1.3780 to 1.3840 (20°C, 589nm) |
| Synonym | tetramethylammonium hydroxide,tmah,hydroxyde de tetramethylammonium,nmw-w,nmd 3,tetramethyl ammonium hydroxide,unii-5gkp7317q2,ammonium, tetramethyl-, hydroxide,methanaminium, n,n,n-trimethyl-, hydroxide,tetramethylammoniumhydroxide |
| TSCA | TSCA |
| IUPAC Name | tetramethylazanium;hydroxide |
| Beilstein | 04,5 |
| Molecular Formula | C4H13NO |
| EINECS Number | 200-882-9 |
| Specific Gravity | 1.014 |