Chemicals
Filtered Search Results
Sodium Hydroxide Solution 0.1M (0.1N), NIST Standard Solution ready to use, for volumetric analysis, meets analytical specification of Ph.Eur., BP, Fisher Chemical™
CAS: 1310-73-2 Molecular Formula: HNaO Molecular Weight (g/mol): 39.997 MDL Number: 3548 InChI Key: HEMHJVSKTPXQMS-UHFFFAOYSA-M Synonym: sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic PubChem CID: 14798 ChEBI: CHEBI:32145 IUPAC Name: sodium;hydroxide SMILES: [OH-].[Na+]
| PubChem CID | 14798 |
|---|---|
| CAS | 1310-73-2 |
| Molecular Weight (g/mol) | 39.997 |
| ChEBI | CHEBI:32145 |
| MDL Number | 3548 |
| SMILES | [OH-].[Na+] |
| Synonym | sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic |
| IUPAC Name | sodium;hydroxide |
| InChI Key | HEMHJVSKTPXQMS-UHFFFAOYSA-M |
| Molecular Formula | HNaO |
Sodium Thiosulfate Solution 0.1M (0.1N), NIST Standard Solution Ready To Use, for Volumetric Analysis, Fisher Chemical™
CAS: 7772-98-7 Molecular Formula: Na2O3S2 Molecular Weight (g/mol): 158.10 MDL Number: MFCD00003499 InChI Key: AKHNMLFCWUSKQB-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium sulfanidesulfonate SMILES: [Na+].[Na+].[O-]S([S-])(=O)=O
| PubChem CID | 61475 |
|---|---|
| CAS | 7772-98-7 |
| Molecular Weight (g/mol) | 158.10 |
| ChEBI | CHEBI:32150 |
| MDL Number | MFCD00003499 |
| SMILES | [Na+].[Na+].[O-]S([S-])(=O)=O |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium sulfanidesulfonate |
| InChI Key | AKHNMLFCWUSKQB-UHFFFAOYSA-L |
| Molecular Formula | Na2O3S2 |
Iodine, 0.1N (0.05M) standard solution
CAS: 7553-56-2 Molecular Formula: I2 Molecular Weight (g/mol): 253.81 MDL Number: MFCD00011355 MFCD00164163 InChI Key: PNDPGZBMCMUPRI-UHFFFAOYSA-N Synonym: iodine,diiodine,iodine crystals,iodine sublimed,tincture iodine,vistarin,eranol,iodio,iodine solution,iode PubChem CID: 807 ChEBI: CHEBI:17606 IUPAC Name: diiodine SMILES: II
| PubChem CID | 807 |
|---|---|
| CAS | 7553-56-2 |
| Molecular Weight (g/mol) | 253.81 |
| ChEBI | CHEBI:17606 |
| MDL Number | MFCD00011355 MFCD00164163 |
| SMILES | II |
| Synonym | iodine,diiodine,iodine crystals,iodine sublimed,tincture iodine,vistarin,eranol,iodio,iodine solution,iode |
| IUPAC Name | diiodine |
| InChI Key | PNDPGZBMCMUPRI-UHFFFAOYSA-N |
| Molecular Formula | I2 |
Potassium hydrogen phthalate, primary standard, ACS, 99.95-100.05%
CAS: 877-24-7 Molecular Formula: C8H5KO4 Molecular Weight (g/mol): 204.222 MDL Number: MFCD00013070 InChI Key: IWZKICVEHNUQTL-UHFFFAOYSA-M Synonym: potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic PubChem CID: 23676735 IUPAC Name: potassium;2-carboxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+]
| PubChem CID | 23676735 |
|---|---|
| CAS | 877-24-7 |
| Molecular Weight (g/mol) | 204.222 |
| MDL Number | MFCD00013070 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| Synonym | potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic |
| IUPAC Name | potassium;2-carboxybenzoate |
| InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
| Molecular Formula | C8H5KO4 |
| Linear Formula | NaOH |
|---|---|
| Molecular Weight (g/mol) | 39.997 |
| ChEBI | CHEBI:32145 |
| InChI Key | HEMHJVSKTPXQMS-UHFFFAOYSA-M |
| Density | 1.0100g/mL |
| PubChem CID | 14798 |
| Fieser | 01,1083; 05,616; 07,336; 08,460 |
| RTECS Number | WB4900000 |
| Formula Weight | 39.99 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Sodium hydroxide |
| SMILES | [OH-].[Na+] |
| Merck Index | 15, 8761 |
| Concentration | 0.1996 to 0.2004N |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement: Wear protective gloves/protective clothing/eye protection/face protection. IF ON SKIN: Wash with plenty of soap and water. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00003548 |
| Health Hazard 2 | GHS H Statement: Causes skin irritation. Causes serious eye irritation. |
| Packaging | Plastic bottle |
| Solubility Information | Solubility in water: soluble. |
| Health Hazard 1 | Warning |
| Synonym | sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic |
| TSCA | TSCA |
| IUPAC Name | sodium;hydroxide |
| Molecular Formula | HNaO |
| EINECS Number | 215-185-5 |
| Specific Gravity | 1.01 |
Calcium carbonate, chelometric standard, ACS, 99.95-100.05%
CAS: 471-34-1 Molecular Formula: CCaO3 Molecular Weight (g/mol): 100.09 MDL Number: MFCD00010906 InChI Key: VTYYLEPIZMXCLO-UHFFFAOYSA-L Synonym: calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama PubChem CID: 10112 ChEBI: CHEBI:3311 SMILES: [Ca++].[O-]C([O-])=O
| PubChem CID | 10112 |
|---|---|
| CAS | 471-34-1 |
| Molecular Weight (g/mol) | 100.09 |
| ChEBI | CHEBI:3311 |
| MDL Number | MFCD00010906 |
| SMILES | [Ca++].[O-]C([O-])=O |
| Synonym | calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama |
| InChI Key | VTYYLEPIZMXCLO-UHFFFAOYSA-L |
| Molecular Formula | CCaO3 |
Sodium hydroxide, 0.1 N standard solution
Sodium hydroxide, HNaO, CAS Number-1310-73-2, 7732-18-5, aetznatron, ascarite, caustic soda, soda, caustic, soda lye, sodium hydrate, sodium hydroxide, sodium hydroxide na oh, sodium hydroxide solution, white caustic, 1L, CHEBI:32145, Beige to White, 0.0995 to 0.1005N (20 deg.C), 1.0000g/mL | CAS: 1310-73-2 | HNaO | 39.997 g/mol
| Linear Formula | NaOH |
|---|---|
| Molecular Weight (g/mol) | 39.997 |
| ChEBI | CHEBI:32145 |
| Physical Form | Crystalline Powder |
| Grade | Pure |
| SMILES | [OH-].[Na+] |
| Merck Index | 15, 8761 |
| Concentration | 0.0995 to 0.1005N (20°C) |
| InChI Key | HEMHJVSKTPXQMS-UHFFFAOYSA-M |
| Density | 1.0000g/mL |
| PubChem CID | 14798 |
| Name Note | 0.1 N Standard Solution |
| Fieser | 01,1083; 05,616; 07,336; 08,460 |
| CAS | 7732-18-5 |
| MDL Number | MFCD00003548 |
| Synonym | sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic |
| IUPAC Name | sodium;hydroxide |
| Molecular Formula | HNaO |
| Formula Weight | 40 |
| Linear Formula | Na2S2O3 |
|---|---|
| Molecular Weight (g/mol) | 158.10 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Sodium thiosulfate |
| SMILES | [Na+].[Na+].[O-]S([S-])(=O)=O |
| Merck Index | 15, 8821 |
| InChI Key | AKHNMLFCWUSKQB-UHFFFAOYSA-L |
| PubChem CID | 24477 |
| Concentration or Composition (by Analyte or Components) | 0.0950 to 0.1050N (20°C) |
| CAS | 7732-18-5 |
| MDL Number | MFCD00003499 |
| Health Hazard 1 | |
| Synonym | sodium thiosulfate,sodium thiosulphate,disodium thiosulfate,sodium thiosulfate anhydrous,hypo,sodiumthiosulfate,chlorine cure,chlorine control,declor-it,thiosulfuric acid, disodium salt |
| Molecular Formula | Na2O3S2 |
| Formula Weight | 158.11 |
Ethylenediaminetetraacetic Acid Disodium Salt Solution 0.01M (0.02N), NIST Standard Solution ready to use, for volumetric analysis, Fisher Chemical™
CAS: 139-33-3 Molecular Formula: C10H14N2Na2O8 Molecular Weight (g/mol): 336.21 MDL Number: MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 InChI Key: ZGTMUACCHSMWAC-UHFFFAOYSA-L Synonym: ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid PubChem CID: 57339238 ChEBI: CHEBI:64734 IUPAC Name: disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate SMILES: [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 57339238 |
|---|---|
| CAS | 139-33-3 |
| Molecular Weight (g/mol) | 336.21 |
| ChEBI | CHEBI:64734 |
| MDL Number | MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 |
| SMILES | [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid |
| IUPAC Name | disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate |
| InChI Key | ZGTMUACCHSMWAC-UHFFFAOYSA-L |
| Molecular Formula | C10H14N2Na2O8 |
2-Mercaptoethanesulfonic acid sodium salt, 98%, analytical standard
CAS: 19767-45-4 Molecular Formula: C2H5NaO3S2 Molecular Weight (g/mol): 164.18 InChI Key: XOGTZOOQQBDUSI-UHFFFAOYSA-M Synonym: mesna,sodium 2-mercaptoethanesulfonate,mesnex,uromitexan,mitexan,2-mercaptoethanesulfonic acid sodium salt,mistabron,mesnum,mistabronco,mucofluid PubChem CID: 23662354 IUPAC Name: sodium;2-sulfanylethanesulfonate SMILES: C(CS(=O)(=O)[O-])S.[Na+]
| PubChem CID | 23662354 |
|---|---|
| CAS | 19767-45-4 |
| Molecular Weight (g/mol) | 164.18 |
| SMILES | C(CS(=O)(=O)[O-])S.[Na+] |
| Synonym | mesna,sodium 2-mercaptoethanesulfonate,mesnex,uromitexan,mitexan,2-mercaptoethanesulfonic acid sodium salt,mistabron,mesnum,mistabronco,mucofluid |
| IUPAC Name | sodium;2-sulfanylethanesulfonate |
| InChI Key | XOGTZOOQQBDUSI-UHFFFAOYSA-M |
| Molecular Formula | C2H5NaO3S2 |
Ethylenediaminetetraacetic acid disodium salt, 0.100N (0.050M) Standardized solution
CAS: 139-33-3 Molecular Formula: C10H14N2Na2O8 Molecular Weight (g/mol): 336.21 MDL Number: MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 InChI Key: ZGTMUACCHSMWAC-UHFFFAOYSA-L Synonym: ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid PubChem CID: 57339238 ChEBI: CHEBI:64734 IUPAC Name: disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate SMILES: [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 57339238 |
|---|---|
| CAS | 139-33-3 |
| Molecular Weight (g/mol) | 336.21 |
| ChEBI | CHEBI:64734 |
| MDL Number | MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 |
| SMILES | [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid |
| IUPAC Name | disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate |
| InChI Key | ZGTMUACCHSMWAC-UHFFFAOYSA-L |
| Molecular Formula | C10H14N2Na2O8 |
Starch indicator solution 1%, Acculute Standard Volumetric Solution, Final Volume 1L
For Iodometric Titrations | CAS: 9005-84-9
| Concentration or Composition (by Analyte or Components) | Starch: 20%; Water: 80% |
|---|---|
| CAS | 7732-18-5 |
| MDL Number | MFCD00082026 |
| Solubility Information | Miscible with water. |
| Physical Form | Liquid,For iodometric titrations |
| Chemical Name or Material | Starch indicator solution |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Vapor Pressure | 17mm Hg at 20°C |
| Assay Percent Range | 100% |
Nitric Acid Solution 0.1M (0.1N), NIST Standard Solution Ready To Use, for Volumetric Analysis, Fisher Chemical™
CAS: 7697-37-2 Molecular Formula: HNO3 Molecular Weight (g/mol): 63.01 MDL Number: MFCD00011349 InChI Key: GRYLNZFGIOXLOG-UHFFFAOYSA-N Synonym: hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide PubChem CID: 944 ChEBI: CHEBI:48107 IUPAC Name: nitric acid SMILES: O[N+]([O-])=O
| PubChem CID | 944 |
|---|---|
| CAS | 7697-37-2 |
| Molecular Weight (g/mol) | 63.01 |
| ChEBI | CHEBI:48107 |
| MDL Number | MFCD00011349 |
| SMILES | O[N+]([O-])=O |
| Synonym | hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide |
| IUPAC Name | nitric acid |
| InChI Key | GRYLNZFGIOXLOG-UHFFFAOYSA-N |
| Molecular Formula | HNO3 |
Sodium Hydroxide Solution 0.2M (0.2N), NIST Standard Solution Ready To Use, for Volumetric Analysis, Fisher Chemical™
CAS: 1310-73-2 Molecular Formula: HNaO Molecular Weight (g/mol): 39.997 MDL Number: 3548 InChI Key: HEMHJVSKTPXQMS-UHFFFAOYSA-M Synonym: sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic PubChem CID: 14798 ChEBI: CHEBI:32145 IUPAC Name: sodium;hydroxide SMILES: [OH-].[Na+]
| PubChem CID | 14798 |
|---|---|
| CAS | 1310-73-2 |
| Molecular Weight (g/mol) | 39.997 |
| ChEBI | CHEBI:32145 |
| MDL Number | 3548 |
| SMILES | [OH-].[Na+] |
| Synonym | sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic |
| IUPAC Name | sodium;hydroxide |
| InChI Key | HEMHJVSKTPXQMS-UHFFFAOYSA-M |
| Molecular Formula | HNaO |