Learn More
Tri-o-tolyl phosphate, 96%, ACROS Organics™
Brand: Acros Organics 366460250
Code : 29
Additional Details : CAS Number : 78-30-8 Weight : 0.07500kg Transport : UN number : 2574 Chem class : 6.1 Pack group : II
| Packaging | Glass bottle |
|---|---|
| Quantity | 25g |
Chemical Identifiers
| 78-30-8 | |
| 368.37 | |
| YSMRWXYRXBRSND-UHFFFAOYSA-N | |
| 6527 | |
| CC1=CC=CC=C1OP(=O)(OC1=CC=CC=C1C)OC1=CC=CC=C1C |
| C21H21O4P | |
| MFCD00041906 | |
| tri-o-cresyl phosphate, tri-o-tolyl phosphate, o-tolyl phosphate, tocp, totp, phosphoric acid, tris 2-methylphenyl ester, o-cresyl phosphate, triorthocresyl phosphate, phosflex 179c, tri-2-tolyl phosphate | |
| tris(2-methylphenyl) phosphate |
Specifications
| Tri-o-tolyl phosphate | |
| 225°C | |
| Glass bottle | |
| 1.2 | |
| Colorless to Yellow | |
| 25g | |
| 78-30-8 | |
| C21H21O4P | |
| 15, 9941 | |
| Solubility in water: 0.01g/100mL (25°C). Other solubilities: slightly soluble in alcohol,soluble in ether | |
| CC1=CC=CC=C1OP(=O)(OC1=CC=CC=C1C)OC1=CC=CC=C1C | |
| 368.37 | |
| 368.36 | |
| 96% |
| 1.2000g/mL | |
| Authentic | |
| 1.5580 to 1.561 | |
| 410°C | |
| -25°C | |
| 96% | |
| 95% min. (GC) | |
| MFCD00041906 | |
| tri-o-cresyl phosphate, tri-o-tolyl phosphate, o-tolyl phosphate, tocp, totp, phosphoric acid, tris 2-methylphenyl ester, o-cresyl phosphate, triorthocresyl phosphate, phosflex 179c, tri-2-tolyl phosphate | |
| YSMRWXYRXBRSND-UHFFFAOYSA-N | |
| tris(2-methylphenyl) phosphate | |
| 6527 | |
| Viscous Liquid |
Safety and Handling
- Tri-o-tolyl phosphate
Signal Word
- Danger
Hazard Category
- LONG-TERM AQUATIC HAZARD Chronic 2
- Specific target organ toxicity after single exposure Category 1
Hazard Statement
- H411-Toxic to aquatic life with long lasting effects.
- H370-Causes damage to organs.
Precautionary Statement
- P273-Avoid release to the environment.
- P301+P312-IF SWALLOWED: Call a POISON CENTER or doctor/physician/ if you feel unwell.