Learn More
Thiamine hydrochloride, 98.5-101.5%, Acros Organics
Brand: Acros Organics 148990010
Code : 29
Additional Details : CAS Number : 67-03-8 Weight : 1.00000kg
| Packaging | Plastic bottle |
|---|---|
| Quantity | 1kg |
Chemical Identifiers
| 67-03-8 | |
| 337.263 | |
| DPJRMOMPQZCRJU-UHFFFAOYSA-M | |
| 6202 | |
| 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;chloride;hydrochloride |
| C12H18Cl2N4OS | |
| MFCD00012780 | |
| thiamine hydrochloride, vitamin b1 hydrochloride, thiamine hcl, aneurine hydrochloride, berin, thiamine chloride hydrochloride, trophite, thiamin chloride, thiamine dichloride, thiaminium chloride | |
| CHEBI:49105 | |
| CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO.Cl.[Cl-] |
Specifications
| Thiamine hydrochloride | |
| Plastic bottle | |
| 5% max. (K.F.) | |
| 250.0°C | |
| 98.5-101.5% | |
| 98.5 to 101.5% | |
| MFCD00012780 | |
| 15, 9447 | |
| Solubility in water: 1 g/mL. Other solubilities: 1 g/18 mL glycerol - 1 g/100 mL 95% alcohol, 1 g/315 mL abs. alcohol, soluble in propylene glycol, practically insoluble in hexane, chloroform, insoluble in benzene, diethyl ether | |
| CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO.Cl.[Cl-] | |
| 337.263 | |
| CHEBI:49105 | |
| Crystalline Powder |
| Authentic | |
| 0.1% max. | |
| White | |
| 1kg | |
| 67-03-8 | |
| C12H18Cl2N4OS | |
| 27, IV, 1766 | |
| thiamine hydrochloride, vitamin b1 hydrochloride, thiamine hcl, aneurine hydrochloride, berin, thiamine chloride hydrochloride, trophite, thiamin chloride, thiamine dichloride, thiaminium chloride | |
| DPJRMOMPQZCRJU-UHFFFAOYSA-M | |
| 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;chloride;hydrochloride | |
| 6202 | |
| 337.26 | |
| 98.5 to 101.5% (on anhydrous substance) |