Learn More
Rhodamine B, 98+%, Acros Organics™
Brand: Acros Organics 296571000
Code : 29
Additional Details : CAS Number : 81-88-9 Weight : 0.15000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 100g |
Chemical Identifiers
| 81-88-9 | |
| 479.017 | |
| PYWVYCXTNDRMGF-UHFFFAOYSA-N | |
| 6694 | |
| [9-(2-carboxyphenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium;chloride |
| C28H31ClN2O3 | |
| MFCD00011931 | |
| Basic Violet 10, C.I. 45170 | |
| CHEBI:52334 | |
| CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=CC=CC=C4C(=O)O.[Cl-] |
Specifications
| Rhodamine B | |
| Vapor Pressure: Negligible | |
| ≥98% | |
| MFCD00011931 | |
| 15, 8307 | |
| PYWVYCXTNDRMGF-UHFFFAOYSA-N | |
| CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=CC=CC=C4C(=O)O.[Cl-] | |
| 479.017 | |
| CHEBI:52334 | |
| Powder | |
| Pure | |
| Solubility in water: soluble. Other solubilities: slightly soluble in hcl and naoh, soluble in alcohol | |
| 210.0°C to 211.0°C | |
| 100g |
| Pure | |
| 81-88-9 | |
| C28H31ClN2O3 | |
| 19, V,8, 669 | |
| Basic Violet 10, C.I. 45170 | |
| Authentic | |
| [9-(2-carboxyphenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium;chloride | |
| 6694 | |
| 479.01 | |
| ≥98% | |
| Glass bottle | |
| >255°C | |
| Green |
Safety and Handling
- Rhodamine B
Signal Word
- Danger
Hazard Category
- Acute toxicity Category 4
- LONG-TERM AQUATIC HAZARD Chronic 3
- Serious eye damage/eye irritation Category 1
Hazard Statement
- H318-Causes serious eye damage.
- H412-Harmful to aquatic life with long lasting effects.
- H302-Harmful if swallowed.
Precautionary Statement
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P301+P330+P331-IF SWALLOWED: rinse mouth. Do NOT induce vomiting.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
- P310-Immediately call a POISON CENTER/doctor/.