missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Nile Red 99%, ACROS Organics™
£67.31 - £375.34
Chemical Identifiers
| CAS | 7385-67-3 |
|---|---|
| Molecular Formula | C20H18N2O2 |
| Molecular Weight (g/mol) | 318.376 |
| MDL Number | MFCD00011639 |
| InChI Key | VOFUROIFQGPCGE-UHFFFAOYSA-N |
| Synonym | Nile blue A oxazone |
| PubChem CID | 65182 |
| ChEBI | CHEBI:52169 |
| IUPAC Name | 9-(diethylamino)benzo[a]phenoxazin-5-one |
| SMILES | CCN(CC)C1=CC2=C(C=C1)N=C3C4=CC=CC=C4C(=O)C=C3O2 |
| Product Code | Brand | Quantity | Packaging | Price | Quantity & Availability | ||||
|---|---|---|---|---|---|---|---|---|---|
| Product Code | Brand | Quantity | Packaging | Price | Quantity & Availability | ||||
|
10464311
|
Acros Organics
415711000 |
100mg | Glass bottle |
£67.31
100mg |
|
||||
|
10658904
|
Acros Organics
415710010 |
1g | Glass bottle |
£375.34
1g |
|
||||
Chemical Identifiers
| 7385-67-3 | |
| 318.376 | |
| VOFUROIFQGPCGE-UHFFFAOYSA-N | |
| 65182 | |
| 9-(diethylamino)benzo[a]phenoxazin-5-one |
| C20H18N2O2 | |
| MFCD00011639 | |
| Nile blue A oxazone | |
| CHEBI:52169 | |
| CCN(CC)C1=CC2=C(C=C1)N=C3C4=CC=CC=C4C(=O)C=C3O2 |
Specifications
| Nile Red | |
| Powder may have a greenish reflective case | |
| 98.5 | |
| 99% | |
| MFCD00011639 | |
| 15, 6628 | |
| VOFUROIFQGPCGE-UHFFFAOYSA-N | |
| CCN(CC)C1=CC2=C(C=C1)N=C3C4=CC=CC=C4C(=O)C=C3O2 | |
| 318.376 | |
| CHEBI:52169 | |
| Powder | |
| Pure | |
| Solubility in water: almost insoluble. Other solubilities: soluble in acetone, acetonitrile, chloroform, thf,, ethanol, dmso, cs2, benzene, nitrobenzene, pyridin, e, hexane, diethyl ether | |
| Complies | |
| Maroon to Red |
| 99% | |
| 7385-67-3 | |
| 100.0 | |
| C20H18N2O2 | |
| 27, II, 468 | |
| Nile blue A oxazone | |
| Authentic | |
| 9-(diethylamino)benzo[a]phenoxazin-5-one | |
| 65182 | |
| 318.38 | |
| 99% | |
| Glass bottle | |
| 98.5% min. | |
| 203.0°C to 205.0°C | |
| 100mg |