Learn More
Glutathione Reduced, Fisher BioReagents
Brand: Fisher Bioreagents BP2521-1
Code : 32
Additional Details : CAS Number : 70-18-8 Weight : 0.05100kg
Packaging | Amber Glass |
---|---|
Quantity | 1g |
Description
Glutathione is a useful tripeptide involved in many aspects of metabolism, including transport of γ-glutamyl amino acids and reductive cleavage of disulfide bonds.Chemical Identifiers
70-18-8 | |
307.321 | |
glutathione, l-glutathione, glutathion, glutathione-sh, glutinal, isethion, tathion, reduced glutathione, deltathione, neuthion | |
CHEBI:16856 | |
C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N |
C10H17N3O6S | |
RWSXRVCMGQZWBV-WDSKDSINSA-N | |
124886 | |
(2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
Specifications
Glutathione Reduced | |
0.01% max. | |
Amber Glass | |
White | |
1g | |
70-18-8 | |
C10H17N3O6S | |
glutathione, l-glutathione, glutathion, glutathione-sh, glutinal, isethion, tathion, reduced glutathione, deltathione, neuthion | |
C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N | |
307.321 | |
CHEBI:16856 | |
Powder/Solid |
Pass Test | |
Report % | |
-21 to -11° (+ or -) | |
182°C | |
3 | |
≥98 % | |
15, 4511 | |
RWSXRVCMGQZWBV-WDSKDSINSA-N | |
(2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid | |
124886 | |
307.3 | |
≥98% |