Learn More
G418 disulfate, 50mg/ml solution, Thermo Scientific™
G418 sulfate, geneticin, CAS # 108321-42-2, is an antibiotic closely related to Gentamicin B, the common aminoglycoside antibiotic.
Brand: Thermo Scientific Alfa Aesar J63871.AB
| Quantity | 10mL |
|---|
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 108321-42-2 | |
| 692.702 | |
| UHEPSJJJMTWUCP-TUWLDMFGSA-N | |
| 134129582 | |
| CC(C1C(C(C(C(O1)OC2C(CC(C(C2O)OC3C(C(C(CO3)(C)O)NC)O)N)N)N)O)O)O.OS(=O)(=O)O.OS(=O)(=O)O |
| C20H44N4O18S2 | |
| MFCD00058314 | |
| Geneticin | |
| (2R,3R,4R,5R)-2-[(1S,2R,3R,4S,6R)-4,6-diamino-3-[(2S,3S,4R,5S,6R)-3-amino-4,5-dihydroxy-6-[(1R)-1-hydroxyethyl]oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol;sulfuric acid |
Specifications
| 108321-42-2 | |
| 50mg/ml solution | |
| C20H44N4O18S2 | |
| Geneticin | |
| UHEPSJJJMTWUCP-TUWLDMFGSA-N | |
| (2R,3R,4R,5R)-2-[(1S,2R,3R,4S,6R)-4,6-diamino-3-[(2S,3S,4R,5S,6R)-3-amino-4,5-dihydroxy-6-[(1R)-1-hydroxyethyl]oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol;sulfuric acid | |
| 134129582 | |
| G418 disulfate |
| Undesignated | |
| 10mL | |
| MFCD00058314 | |
| Difficult to mix. | |
| CC(C1C(C(C(C(O1)OC2C(CC(C(C2O)OC3C(C(C(CO3)(C)O)NC)O)N)N)N)O)O)O.OS(=O)(=O)O.OS(=O)(=O)O | |
| 692.702 | |
| 692.71 |
Your input is important to us. Please complete this form to provide feedback related to the content on this product.