Learn More
(-)-Erythromycin, 98%, ACROS Organics™
Brand: Acros Organics 227330250
Code : 29
Additional Details : CAS Number : 114-07-8 Weight : 0.08000kg
| Packaging | Plastic bottle |
|---|---|
| Quantity | 25g |
Chemical Identifiers
| 114-07-8 | |
| 733.937 | |
| ULGZDMOVFRHVEP-RWJQBGPGSA-N | |
| CHEBI:42355 | |
| CCC1C(C(C(C(=O)C(CC(C(C(C(C(C(=O)O1)C)OC2CC(C(C(O2)C)O)(C)OC)C)OC3C(C(CC(O3)C)N(C)C)O)(C)O)C)C)O)(C)O |
| C37H67NO13 | |
| MFCD00084654 | |
| 12560 | |
| (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-6-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-7,12,13-trihydroxy-4-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione |
Specifications
| (-)-Erythromycin | |
| 114-07-8 | |
| 98% | |
| MFCD00084654 | |
| Plastic bottle | |
| CCC1C(C(C(C(=O)C(CC(C(C(C(C(C(=O)O1)C)OC2CC(C(C(O2)C)O)(C)OC)C)OC3C(C(CC(O3)C)N(C)C)O)(C)O)C)C)O)(C)O | |
| 733.937 | |
| CHEBI:42355 | |
| Powder | |
| Solubility in water: +/- 2 mg/mg. Other solubilities: freely soluble in alcohols, acetone, chloroform,, acetonitrile, ethyl acetate, moderately soluble in ether, ethylenedichloride, and amyl acetate | |
| 0.2% max. | |
| −74.50° (20°C c=2,ethanol) | |
| 138.0°C to 140.0°C |
| 98% | |
| Authentic | |
| C37H67NO13 | |
| 15, 3739 | |
| ULGZDMOVFRHVEP-RWJQBGPGSA-N | |
| (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-6-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-7,12,13-trihydroxy-4-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione | |
| 12560 | |
| 733.94 | |
| 98% | |
| − 74.50 | |
| 6.5% max. (K.F.) | |
| White to Yellow | |
| 25g |