Learn More
Diphenyl Phosphite, Contains Varying Amounts of Phenol and (C6H5O)3P, ACROS Organics™
Brand: Acros Organics 117390010
Code : 29
Additional Details : CAS Number : 4712-55-4 Weight : 1.05000kg Transport : UN number : 3265 Chem class : 8 Pack group : III
Packaging | Glass bottle |
---|---|
Quantity | 1kg |
Chemical Identifiers
4712-55-4 | |
234.19 | |
CDXVUROVRIFQMV-UHFFFAOYSA-N | |
6327546 | |
C1=CC=C(C=C1)O[P+](=O)OC2=CC=CC=C2 |
C12H11O3P | |
MFCD00044497 | |
diphenyl phosphite, diphenyl phosphonate, phosphonic acid, diphenyl ester, diphenoxyphosphine oxide, diphenyl hydrogen phosphite, phosphorous acid, diphenyl ester, unii-5144js6xum, phosphonic acid diphenyl ester, phenyl phosphonate, pho 2hpo, phenyl phosphonate pho 2hpo | |
oxo(diphenoxy)phosphanium |
Specifications
15mg KOH/g max. | |
1.2170g/mL | |
Authentic | |
1.5565 to 1.5585 | |
218°C to 219°C (26.0mmHg) | |
12°C | |
4712-55-4 | |
(C6H5O)2P(O)H | |
06, I, 94 | |
diphenyl phosphite, diphenyl phosphonate, phosphonic acid, diphenyl ester, diphenoxyphosphine oxide, diphenyl hydrogen phosphite, phosphorous acid, diphenyl ester, unii-5144js6xum, phosphonic acid diphenyl ester, phenyl phosphonate, pho 2hpo, phenyl phosphonate pho 2hpo | |
CDXVUROVRIFQMV-UHFFFAOYSA-N | |
oxo(diphenoxy)phosphanium | |
6327546 | |
Liquid |
Diphenyl phosphite | |
176°C | |
Glass bottle | |
1.217 | |
Undesignated | |
1kg | |
C12H11O3P | |
MFCD00044497 | |
04,210 | |
Solubility in water: insoluble | |
C1=CC=C(C=C1)O[P+](=O)OC2=CC=CC=C2 | |
234.19 | |
234.19 |