Learn More
D(+)-Biotin, 98%, ACROS Organics™
Brand: Acros Organics 230090010
Code : 29
Additional Details : CAS Number : 58-85-5 Weight : 0.05100kg
Packaging | Glass Bottle |
---|---|
Quantity | 1g |
Chemical Identifiers
58-85-5 | |
244.31 | |
YBJHBAHKTGYVGT-ZKWXMUAHSA-N | |
171548 | |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid |
C10H16N2O3S | |
MFCD00005541 | |
biotin, d-biotin, vitamin h, coenzyme r, vitamin b7, bios ii, factor s, bioepiderm, d +-biotin, biodermatin | |
CHEBI:15956 | |
C1C2C(C(S1)CCCCC(=O)O)NC(=O)N2 |
Specifications
D(+)-Biotin | |
+ 89.00 | |
1g | |
98% | |
MFCD00005541 | |
biotin, d-biotin, vitamin h, coenzyme r, vitamin b7, bios ii, factor s, bioepiderm, d +-biotin, biodermatin | |
YBJHBAHKTGYVGT-ZKWXMUAHSA-N | |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid | |
171548 | |
244.31 |
Glass Bottle | |
231.0°C to 233.0°C | |
58-85-5 | |
C10H16N2O3S | |
15,1236 | |
Solubility in water: 0.22g/L (25°C). Other solubilities: more soluble in hot water and dil. alkali,0.8g/L alcohol,insoluble in most other common organic solvents | |
C1C2C(C(S1)CCCCC(=O)O)NC(=O)N2 | |
244.31 | |
CHEBI:15956 | |
98% |