Learn More
(+)-cis-Diltiazem hydrochloride, Thermo Scientific™
An L-type calcium channel blocker
Brand: Thermo Scientific Alfa Aesar J63245.09
| Quantity | 10g |
|---|
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 33286-22-5 | |
| 450.978 | |
| HDRXZJPWHTXQRI-BHDTVMLSSA-N | |
| 62920 | |
| [(2S,3S)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate;hydrochloride |
| C22H27ClN2O4S | |
| MFCD00069252 | |
| diltiazem hydrochloride, diltiazem hcl, herbesser, dilzene, lacerol, masdil, tildiem, tiazac, mono-tildiem, bi-tildiem | |
| CHEBI:645509 | |
| CC(=O)OC1C(SC2=CC=CC=C2N(C1=O)CCN(C)C)C3=CC=C(C=C3)OC.Cl |
Specifications
| 33286-22-5 | |
| MFCD00069252 | |
| 4228706 | |
| diltiazem hydrochloride, diltiazem hcl, herbesser, dilzene, lacerol, masdil, tildiem, tiazac, mono-tildiem, bi-tildiem | |
| HDRXZJPWHTXQRI-BHDTVMLSSA-N | |
| [(2S,3S)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate;hydrochloride | |
| 62920 | |
| 450.98 |
| C22H27ClN2O4S | |
| 10g | |
| 14,3202 | |
| Soluble in water at 50mg/ml | |
| CC(=O)OC1C(SC2=CC=CC=C2N(C1=O)CCN(C)C)C3=CC=C(C=C3)OC.Cl | |
| 450.978 | |
| CHEBI:645509 | |
| (+)-cis-Diltiazem hydrochloride |
Your input is important to us. Please complete this form to provide feedback related to the content on this product.