Learn More
AEBSF Hydrochloride (White to Off-white Crystals), Fisher BioReagents
Brand: Fisher Bioreagents BP635-50
Code : 32
Additional Details : CAS Number : 30827-99-7 Weight : 0.05005kg Transport : UN number : 3261 Chem class : 8 Pack group : II
| Packaging | Poly Micro Tube |
|---|---|
| Quantity | 50mg |
Description
This specific, irreversible inhibitor of serine proteases is a stable, nontoxic alternative to PMSF.Chemical Identifiers
| 30827-99-7 | |
| 239.689 | |
| 4-2-aminoethyl benzenesulfonyl fluoride hydrochloride, aebsf, aebsf hydrochloride, pefabloc sc, aebsf hcl, pefabloc, 4-2-aminoethyl benzene-1-sulfonyl fluoride hydrochloride, aebsf, hydrochloride, benzenesulfonyl fluoride, 4-2-aminoethyl-, hydrochloride, 4-2-aminoethyl benzenesulfonylfluoride hydrochloride | |
| 4-(2-aminoethyl)benzenesulfonyl fluoride;hydrochloride |
| C8H11ClFNO2S | |
| WRDABNWSWOHGMS-UHFFFAOYSA-N | |
| 186136 | |
| C1=CC(=CC=C1CCN)S(=O)(=O)F.Cl |
Specifications
| AEBSF Hydrochloride | |
| Poly Micro Tube | |
| 175°C | |
| 30827-99-7 | |
| C8H11ClFNO2S | |
| WRDABNWSWOHGMS-UHFFFAOYSA-N | |
| 4-(2-aminoethyl)benzenesulfonyl fluoride;hydrochloride | |
| 186136 | |
| Powder/Solid |
| Pass Test | |
| White | |
| 50mg | |
| ≥98.0 % | |
| 4-2-aminoethyl benzenesulfonyl fluoride hydrochloride, aebsf, aebsf hydrochloride, pefabloc sc, aebsf hcl, pefabloc, 4-2-aminoethyl benzene-1-sulfonyl fluoride hydrochloride, aebsf, hydrochloride, benzenesulfonyl fluoride, 4-2-aminoethyl-, hydrochloride, 4-2-aminoethyl benzenesulfonylfluoride hydrochloride | |
| C1=CC(=CC=C1CCN)S(=O)(=O)F.Cl | |
| 239.689 | |
| 239.7 | |
| ≥98 (HPLC) |