Learn More
4-Methylbenzophenone, 97%, ACROS Organics™
Brand: Acros Organics 126350500
Code : 29
Additional Details : CAS Number : 134-84-9 Weight : 0.10000kg
Packaging | Plastic bottle |
---|---|
Quantity | 50g |
Chemical Identifiers
134-84-9 | |
196.25 | |
WXPWZZHELZEVPO-UHFFFAOYSA-N | |
8652 | |
CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
C14H12O | |
MFCD00008553 | |
4-methylbenzophenone, phenyl p-tolyl methanone, 4-methylphenyl phenyl methanone, p-methylbenzophenone, methanone, 4-methylphenyl phenyl, p-benzoyltoluene, 4-methyl benzophenone, phenyl p-tolyl ketone, benzophenone, 4-methyl, p-benzophenone, methyl | |
(4-methylphenyl)-phenylmethanone |
Specifications
4-Methylbenzophenone | |
Authentic | |
326°C | |
53°C to 57°C | |
97% | |
96.0 | |
96% min. (GC) | |
CH3C6H4COC6H5 | |
07, 440 | |
4-methylbenzophenone, phenyl p-tolyl methanone, 4-methylphenyl phenyl methanone, p-methylbenzophenone, methanone, 4-methylphenyl phenyl, p-benzoyltoluene, 4-methyl benzophenone, phenyl p-tolyl ketone, benzophenone, 4-methyl, p-benzophenone, methyl | |
WXPWZZHELZEVPO-UHFFFAOYSA-N | |
(4-methylphenyl)-phenylmethanone | |
8652 | |
Crystalline Powder or Crystals |
143°C | |
Plastic bottle | |
Beige to White | |
50g | |
134-84-9 | |
100.0 | |
C14H12O | |
MFCD00008553 | |
14, 7317 | |
Solubility in water: insoluble. Other solubilities: soluble in alcohol,ether and chloroform | |
CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 | |
196.25 | |
196.25 | |
97% |