Learn More
2-Hydroxy-p-naphthoquinone, 99%, ACROS Organics™
Brand: Acros Organics 121631000
Code : 29
Additional Details : CAS Number : 83-72-7 Weight : 0.10000kg
Packaging | Glass bottle |
---|---|
Quantity | 100g |
Chemical Identifiers
83-72-7 | |
174.16 | |
WVCHIGAIXREVNS-UHFFFAOYSA-N | |
6755 | |
C1=CC=C2C(=C1)C(=CC(=O)C2=O)O |
C10H6O3 | |
MFCD00001678 | |
lawsone, 2-hydroxy-1,4-naphthoquinone, 2-hydroxynaphthalene-1,4-dione, 2-hydroxynaphthoquinone, henna, mehendi, hana, lawson, mendi, flower of paradise | |
4-hydroxynaphthalene-1,2-dione |
Specifications
2-Hydroxy-p-naphthoquinone | |
Glass bottle | |
192.0°C to 195.0°C | |
99% | |
98.5 | |
98.5% min. (HPLC) | |
MFCD00001678 | |
01,484 | |
lawsone, 2-hydroxy-1,4-naphthoquinone, 2-hydroxynaphthalene-1,4-dione, 2-hydroxynaphthoquinone, henna, mehendi, hana, lawson, mendi, flower of paradise | |
WVCHIGAIXREVNS-UHFFFAOYSA-N | |
4-hydroxynaphthalene-1,2-dione | |
6755 | |
Crystalline Powder | |
Pure |
Authentic | |
Yellow | |
100g | |
83-72-7 | |
100.0 | |
C10H6O3 | |
08, 300 | |
15, 5448 | |
Solubility in water: 2g/L water (20°C). Other solubilities: soluble in benzene,carbon tetrachloride,aceton,,petroleum ether and sodium hydroxide | |
C1=CC=C2C(=C1)C(=CC(=O)C2=O)O | |
174.16 | |
174.16 | |
99% |