Learn More
1,1,1-Trichloro-2-methyl-2-propanol hemihydrate, 98%, Acros Organics
Brand: Acros Organics 150305000
Code : 29
Additional Details : CAS Number : 6001-64-5 Weight : 0.55000kg
Packaging | Plastic bottle |
---|---|
Quantity | 500g |
Chemical Identifiers
6001-64-5 | |
186.47 | |
HBARVHNVVKZUGS-UHFFFAOYSA-N | |
102594540 | |
[HH].CC(C)(C(Cl)(Cl)Cl)O.O |
0·5 H2O | |
MFCD02179352 | |
c4h7cl3o.1/2h2o, 1,1,1-trichloro-2-methyl-2-propanol hemihydrate, chlorobutanol hydrogen ion hydrate | |
molecular hydrogen;1,1,1-trichloro-2-methylpropan-2-ol;hydrate |
Specifications
1, 1, 1-Trichloro-2-methyl-2-propanol hemihydrate | |
Authentic | |
4.5 to 5.5% (K.F.) | |
White | |
500g | |
6001-64-5 | |
100.0 | |
0·5 H2O | |
MFCD02179352 | |
Solubility in water: 7.7g/L (20°C). Other solubilities: soluble in ethanol,ether,chloroform,glycerol | |
[HH].CC(C)(C(Cl)(Cl)Cl)O.O | |
186.47 | |
186.47 | |
97.5 to 102.5% (ex Cl) |
100°C | |
Plastic bottle | |
173°C to 175°C | |
75°C to 79°C | |
98% | |
97.5 | |
98% | |
0·5H2O | |
c4h7cl3o.1/2h2o, 1,1,1-trichloro-2-methyl-2-propanol hemihydrate, chlorobutanol hydrogen ion hydrate | |
HBARVHNVVKZUGS-UHFFFAOYSA-N | |
molecular hydrogen;1,1,1-trichloro-2-methylpropan-2-ol;hydrate | |
102594540 | |
Crystalline Powder, Crystals and/or Chunks |