Resins and Supports
- (1)
- (35)
- (1)
- (1)
- (2)
- (3)
- (2)
- (2)
- (7)
- (1)
- (1)
- (3)
- (3)
- (1)
- (7)
- (4)
- (3)
- (3)
- (8)
- (2)
- (2)
- (10)
- (6)
- (7)
- (1)
- (1)
- (1)
- (1)
- (7)
- (6)
- (1)
- (2)
- (4)
- (2)
- (2)
Filtered Search Results
| MDL Number | 132707 |
|---|
Amberlyst™ 15(H), wet, ion exchange resin
CAS: 39389-20-3 Molecular Formula: C18H18O3S Molecular Weight (g/mol): 314.399 MDL Number: MFCD00145841 InChI Key: SIWVGXQOXWGJCI-UHFFFAOYSA-N Synonym: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 IUPAC Name: 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid SMILES: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
| PubChem CID | 170197 |
|---|---|
| CAS | 39389-20-3 |
| Molecular Weight (g/mol) | 314.399 |
| MDL Number | MFCD00145841 |
| SMILES | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| Synonym | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
| IUPAC Name | 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid |
| InChI Key | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| Molecular Formula | C18H18O3S |
Amberlyst™ 15(H), ion exchange resin
CAS: 39389-20-3 Molecular Formula: C18H18O3S Molecular Weight (g/mol): 314.399 MDL Number: MFCD00145841 InChI Key: SIWVGXQOXWGJCI-UHFFFAOYSA-N Synonym: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 IUPAC Name: 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid SMILES: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
| PubChem CID | 170197 |
|---|---|
| CAS | 39389-20-3 |
| Molecular Weight (g/mol) | 314.399 |
| MDL Number | MFCD00145841 |
| SMILES | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| Synonym | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
| IUPAC Name | 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid |
| InChI Key | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| Molecular Formula | C18H18O3S |
Amberlite™ IRN-77, ion exchange resin, nuclear grade
CAS: 11128-94-2 Molecular Formula: Styrene-DVB MDL Number: MFCD00145822
| CAS | 11128-94-2 |
|---|---|
| MDL Number | MFCD00145822 |
| Molecular Formula | Styrene-DVB |
Amberlite™ IRC120 Na ion exchange resin
CAS: 78922-04-0 Molecular Formula: C13H10ClNO4S Molecular Weight (g/mol): 311.736 MDL Number: MFCD00132707 InChI Key: APBOVLPLJFJSRI-UHFFFAOYSA-N Synonym: 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid PubChem CID: 8190984 IUPAC Name: 3-[(3-chlorophenyl)sulfonylamino]benzoic acid SMILES: C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O
| PubChem CID | 8190984 |
|---|---|
| CAS | 78922-04-0 |
| Molecular Weight (g/mol) | 311.736 |
| MDL Number | MFCD00132707 |
| SMILES | C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O |
| Synonym | 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid |
| IUPAC Name | 3-[(3-chlorophenyl)sulfonylamino]benzoic acid |
| InChI Key | APBOVLPLJFJSRI-UHFFFAOYSA-N |
| Molecular Formula | C13H10ClNO4S |
Amberlite™ IRC-120(H), ion exchange resin
CAS: 78922-04-0 Molecular Formula: C13H10ClNO4S Molecular Weight (g/mol): 311.736 MDL Number: MFCD00132707 InChI Key: APBOVLPLJFJSRI-UHFFFAOYSA-N Synonym: 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid PubChem CID: 8190984 IUPAC Name: 3-[(3-chlorophenyl)sulfonylamino]benzoic acid SMILES: C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O
| PubChem CID | 8190984 |
|---|---|
| CAS | 78922-04-0 |
| Molecular Weight (g/mol) | 311.736 |
| MDL Number | MFCD00132707 |
| SMILES | C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O |
| Synonym | 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid |
| IUPAC Name | 3-[(3-chlorophenyl)sulfonylamino]benzoic acid |
| InChI Key | APBOVLPLJFJSRI-UHFFFAOYSA-N |
| Molecular Formula | C13H10ClNO4S |
Acetate, Ion chromatography standard solution, Specpure™ CH{3}CO{2}∣- 1000μg/mL
CAS: 127-09-3 Molecular Formula: C2H3NaO2 Molecular Weight (g/mol): 82.03 MDL Number: MFCD00012459 InChI Key: VMHLLURERBWHNL-UHFFFAOYSA-M Synonym: sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech PubChem CID: 517045 ChEBI: CHEBI:32954 IUPAC Name: sodium;acetate SMILES: [Na+].CC([O-])=O
| PubChem CID | 517045 |
|---|---|
| CAS | 127-09-3 |
| Molecular Weight (g/mol) | 82.03 |
| ChEBI | CHEBI:32954 |
| MDL Number | MFCD00012459 |
| SMILES | [Na+].CC([O-])=O |
| Synonym | sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech |
| IUPAC Name | sodium;acetate |
| InChI Key | VMHLLURERBWHNL-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO2 |