Oxacyclic compounds
Filtered Search Results
2-Amino-5-phenyl-3-furonitrile, 95%, Thermo Scientific™
CAS: 14742-32-6 Molecular Formula: C11H8N2O Molecular Weight (g/mol): 184.20 MDL Number: MFCD00463472 InChI Key: UWTDTJWGYWUILP-UHFFFAOYSA-N Synonym: 2-amino-5-phenyl-3-furonitrile,2-amino-3-cyano-5-phenylfuran,2-amino-5-phenyl-3-furancarbonitrile,3-furancarbonitrile, 2-amino-5-phenyl,maybridge1_000452,2-amino-5-phenyl-furan-3-carbonitrile,3-furancarbonitrile,2-amino-5-phenyl,2-azanyl-5-phenyl-furan-3-carbonitrile PubChem CID: 693961 IUPAC Name: 2-amino-5-phenylfuran-3-carbonitrile SMILES: NC1=C(C=C(O1)C1=CC=CC=C1)C#N
| PubChem CID | 693961 |
|---|---|
| CAS | 14742-32-6 |
| Molecular Weight (g/mol) | 184.20 |
| MDL Number | MFCD00463472 |
| SMILES | NC1=C(C=C(O1)C1=CC=CC=C1)C#N |
| Synonym | 2-amino-5-phenyl-3-furonitrile,2-amino-3-cyano-5-phenylfuran,2-amino-5-phenyl-3-furancarbonitrile,3-furancarbonitrile, 2-amino-5-phenyl,maybridge1_000452,2-amino-5-phenyl-furan-3-carbonitrile,3-furancarbonitrile,2-amino-5-phenyl,2-azanyl-5-phenyl-furan-3-carbonitrile |
| IUPAC Name | 2-amino-5-phenylfuran-3-carbonitrile |
| InChI Key | UWTDTJWGYWUILP-UHFFFAOYSA-N |
| Molecular Formula | C11H8N2O |
6-Amino-1,3-dihydroisobenzofuran-1-one, 95%, Thermo Scientific™
CAS: 57319-65-0 Molecular Formula: C8H7NO2 Molecular Weight (g/mol): 149.149 InChI Key: ZIJZDNKZJZUROE-UHFFFAOYSA-N Synonym: 6-aminophthalide,6-aminoisobenzofuran-1 3h-one,6-amino-1,3-dihydroisobenzofuran-1-one,6-amino-2-benzofuran-1 3h-one,6-amino-3h-isobenzofuran-1-one,1 3h-isobenzofuranone, 6-amino,6-amino-1,3-dihydro-2-benzofuran-1-one,6-amino-1 3h-isobenzofuranone,6-amino-3-hydroisobenzofuran-1-one,6-aminophthalid PubChem CID: 93631 IUPAC Name: 6-amino-3H-2-benzofuran-1-one SMILES: C1C2=C(C=C(C=C2)N)C(=O)O1
| PubChem CID | 93631 |
|---|---|
| CAS | 57319-65-0 |
| Molecular Weight (g/mol) | 149.149 |
| SMILES | C1C2=C(C=C(C=C2)N)C(=O)O1 |
| Synonym | 6-aminophthalide,6-aminoisobenzofuran-1 3h-one,6-amino-1,3-dihydroisobenzofuran-1-one,6-amino-2-benzofuran-1 3h-one,6-amino-3h-isobenzofuran-1-one,1 3h-isobenzofuranone, 6-amino,6-amino-1,3-dihydro-2-benzofuran-1-one,6-amino-1 3h-isobenzofuranone,6-amino-3-hydroisobenzofuran-1-one,6-aminophthalid |
| IUPAC Name | 6-amino-3H-2-benzofuran-1-one |
| InChI Key | ZIJZDNKZJZUROE-UHFFFAOYSA-N |
| Molecular Formula | C8H7NO2 |
Coumalic acid, 97%
CAS: 500-05-0 Molecular Formula: C6H4O4 Molecular Weight (g/mol): 140.09 MDL Number: MFCD00006644 InChI Key: ORGPJDKNYMVLFL-UHFFFAOYSA-N Synonym: coumalic acid,2-oxo-2h-pyran-5-carboxylic acid,cumalic acid,2h-pyran-5-carboxylic acid, 2-oxo,2-oxopyran-5-carboxylic acid,unii-ob1jpy343g,2-pyrone-5-carboxylic acid,alpha-pyrone-5-carboxylic acid,.alpha.-pyrone-5-carboxylic acid,ob1jpy343g PubChem CID: 68141 SMILES: OC(=O)C1=COC(=O)C=C1
| PubChem CID | 68141 |
|---|---|
| CAS | 500-05-0 |
| Molecular Weight (g/mol) | 140.09 |
| MDL Number | MFCD00006644 |
| SMILES | OC(=O)C1=COC(=O)C=C1 |
| Synonym | coumalic acid,2-oxo-2h-pyran-5-carboxylic acid,cumalic acid,2h-pyran-5-carboxylic acid, 2-oxo,2-oxopyran-5-carboxylic acid,unii-ob1jpy343g,2-pyrone-5-carboxylic acid,alpha-pyrone-5-carboxylic acid,.alpha.-pyrone-5-carboxylic acid,ob1jpy343g |
| InChI Key | ORGPJDKNYMVLFL-UHFFFAOYSA-N |
| Molecular Formula | C6H4O4 |
6-amino-1,3-benzoxazol-2(3h)-one, 95%, Thermo Scientific™
CAS: 22876-17-1 Molecular Formula: C7H6N2O2 Molecular Weight (g/mol): 150.137 MDL Number: MFCD00463899 InChI Key: STLPJYGZOIEDAJ-UHFFFAOYSA-N Synonym: 6-aminobenzo d oxazol-2 3h-one,6-amino-1,3-benzoxazol-2 3h-one,2 3h-benzoxazolone, 6-amino,6-amino-2-3h benzoxazolone,6-amino-3h-benzooxazol-2-one,6-amino-2,3-dihydro-1,3-benzoxazol-2-one,6-amino-2-benzoxazolone,6-amino-2-benzoxazolinone,6-amino-3-hydrobenzoxazol-2-one,6-amino-2-hydroxybenzoxazole PubChem CID: 826989 IUPAC Name: 6-amino-3H-1,3-benzoxazol-2-one SMILES: C1=CC2=C(C=C1N)OC(=O)N2
| PubChem CID | 826989 |
|---|---|
| CAS | 22876-17-1 |
| Molecular Weight (g/mol) | 150.137 |
| MDL Number | MFCD00463899 |
| SMILES | C1=CC2=C(C=C1N)OC(=O)N2 |
| Synonym | 6-aminobenzo d oxazol-2 3h-one,6-amino-1,3-benzoxazol-2 3h-one,2 3h-benzoxazolone, 6-amino,6-amino-2-3h benzoxazolone,6-amino-3h-benzooxazol-2-one,6-amino-2,3-dihydro-1,3-benzoxazol-2-one,6-amino-2-benzoxazolone,6-amino-2-benzoxazolinone,6-amino-3-hydrobenzoxazol-2-one,6-amino-2-hydroxybenzoxazole |
| IUPAC Name | 6-amino-3H-1,3-benzoxazol-2-one |
| InChI Key | STLPJYGZOIEDAJ-UHFFFAOYSA-N |
| Molecular Formula | C7H6N2O2 |
Oxazole-4-carboxylic acid, 97%
CAS: 23012-13-7 Molecular Formula: C4H3NO3 Molecular Weight (g/mol): 113.07 MDL Number: MFCD06797151 InChI Key: JBCFJMYPJJWIRG-UHFFFAOYSA-N Synonym: oxazole-4-carboxylic acid,4-oxazolecarboxylic acid,4-oxazolecarboxylicacid,4-carboxy-1,3-oxazole,oxazole-4-carboxylic,4-oxazolecarboxlic acid,pubchem11025,4-carboxyoxazole,4-oxazolecarboxylic acid ep PubChem CID: 14281430 IUPAC Name: 1,3-oxazole-4-carboxylic acid SMILES: C1=C(N=CO1)C(=O)O
| PubChem CID | 14281430 |
|---|---|
| CAS | 23012-13-7 |
| Molecular Weight (g/mol) | 113.07 |
| MDL Number | MFCD06797151 |
| SMILES | C1=C(N=CO1)C(=O)O |
| Synonym | oxazole-4-carboxylic acid,4-oxazolecarboxylic acid,4-oxazolecarboxylicacid,4-carboxy-1,3-oxazole,oxazole-4-carboxylic,4-oxazolecarboxlic acid,pubchem11025,4-carboxyoxazole,4-oxazolecarboxylic acid ep |
| IUPAC Name | 1,3-oxazole-4-carboxylic acid |
| InChI Key | JBCFJMYPJJWIRG-UHFFFAOYSA-N |
| Molecular Formula | C4H3NO3 |
Oxazole-5-carboxylic acid, 98+%
CAS: 118994-90-4 Molecular Formula: C4H3NO3 Molecular Weight (g/mol): 113.072 MDL Number: MFCD04114931 InChI Key: QCGMEWVZBGQOFN-UHFFFAOYSA-N Synonym: oxazole-5-carboxylic acid,5-oxazolecarboxylic acid,5-oxazolecarboxylicacid,5-carboxy-1,3-oxazole,oxazole-5-carboxylicacid,5-carboxyoxazole,acmc-209a0v,ksc173g8b,1,3-oxazole-5-carboxylic acid PubChem CID: 16340557 IUPAC Name: 1,3-oxazole-5-carboxylic acid SMILES: C1=C(OC=N1)C(=O)O
| PubChem CID | 16340557 |
|---|---|
| CAS | 118994-90-4 |
| Molecular Weight (g/mol) | 113.072 |
| MDL Number | MFCD04114931 |
| SMILES | C1=C(OC=N1)C(=O)O |
| Synonym | oxazole-5-carboxylic acid,5-oxazolecarboxylic acid,5-oxazolecarboxylicacid,5-carboxy-1,3-oxazole,oxazole-5-carboxylicacid,5-carboxyoxazole,acmc-209a0v,ksc173g8b,1,3-oxazole-5-carboxylic acid |
| IUPAC Name | 1,3-oxazole-5-carboxylic acid |
| InChI Key | QCGMEWVZBGQOFN-UHFFFAOYSA-N |
| Molecular Formula | C4H3NO3 |
Xanthene-9-carboxylic acid, 98%
CAS: 82-07-5 Molecular Formula: C14H10O3 Molecular Weight (g/mol): 226.231 MDL Number: MFCD00005059 InChI Key: VSBFNCXKYIEYIS-UHFFFAOYSA-N Synonym: xanthene-9-carboxylic acid,xanthanoic acid,xanthenecarboxylic acid,9-xanthenecarboxylic acid,unii-63a81f6a8v,xanthene-9-carboxylicacid,pubchem17697,maybridge1_006340,9-xanthenylcarboxylic acid,chembl520 PubChem CID: 65736 IUPAC Name: 9H-xanthene-9-carboxylic acid SMILES: C1=CC=C2C(=C1)C(C3=CC=CC=C3O2)C(=O)O
| PubChem CID | 65736 |
|---|---|
| CAS | 82-07-5 |
| Molecular Weight (g/mol) | 226.231 |
| MDL Number | MFCD00005059 |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C3O2)C(=O)O |
| Synonym | xanthene-9-carboxylic acid,xanthanoic acid,xanthenecarboxylic acid,9-xanthenecarboxylic acid,unii-63a81f6a8v,xanthene-9-carboxylicacid,pubchem17697,maybridge1_006340,9-xanthenylcarboxylic acid,chembl520 |
| IUPAC Name | 9H-xanthene-9-carboxylic acid |
| InChI Key | VSBFNCXKYIEYIS-UHFFFAOYSA-N |
| Molecular Formula | C14H10O3 |
Chromone-2-carboxylic acid, 97%
CAS: 4940-39-0 Molecular Formula: C10H6O4 Molecular Weight (g/mol): 190.154 MDL Number: MFCD00006838 InChI Key: RVMGXWBCQGAWBR-UHFFFAOYSA-N Synonym: chromocarb,chromone-2-carboxylic acid,4-oxo-4h-chromene-2-carboxylic acid,4-oxo-4h-1-benzopyran-2-carboxylic acid,atremon,chromonecarboxylic acid,lp-1,chromocarb inn:dcf,2-chromonecarboxylic acid,chromocarbe inn-french PubChem CID: 2741 IUPAC Name: 4-oxochromene-2-carboxylic acid SMILES: C1=CC=C2C(=C1)C(=O)C=C(O2)C(=O)O
| PubChem CID | 2741 |
|---|---|
| CAS | 4940-39-0 |
| Molecular Weight (g/mol) | 190.154 |
| MDL Number | MFCD00006838 |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(O2)C(=O)O |
| Synonym | chromocarb,chromone-2-carboxylic acid,4-oxo-4h-chromene-2-carboxylic acid,4-oxo-4h-1-benzopyran-2-carboxylic acid,atremon,chromonecarboxylic acid,lp-1,chromocarb inn:dcf,2-chromonecarboxylic acid,chromocarbe inn-french |
| IUPAC Name | 4-oxochromene-2-carboxylic acid |
| InChI Key | RVMGXWBCQGAWBR-UHFFFAOYSA-N |
| Molecular Formula | C10H6O4 |
Chromone-3-carboxylic acid, 98%
CAS: 39079-62-4 Molecular Formula: C10H6O4 Molecular Weight (g/mol): 190.154 MDL Number: MFCD00017338 InChI Key: PCIITXGDSHXTSN-UHFFFAOYSA-N Synonym: chromone-3-carboxylic acid,4-oxo-4h-chromene-3-carboxylic acid,4-oxo-4h-1-benzopyran-3-carboxylic acid,maybridge1_005842,3-carboxychromone,d04tgn,acmc-1ad65,4-oxo-chromene-3-carboxylic acid,4h-chromen-4-one-3-carboxylic acid PubChem CID: 181620 IUPAC Name: 4-oxochromene-3-carboxylic acid SMILES: C1=CC=C2C(=C1)C(=O)C(=CO2)C(=O)O
| PubChem CID | 181620 |
|---|---|
| CAS | 39079-62-4 |
| Molecular Weight (g/mol) | 190.154 |
| MDL Number | MFCD00017338 |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=CO2)C(=O)O |
| Synonym | chromone-3-carboxylic acid,4-oxo-4h-chromene-3-carboxylic acid,4-oxo-4h-1-benzopyran-3-carboxylic acid,maybridge1_005842,3-carboxychromone,d04tgn,acmc-1ad65,4-oxo-chromene-3-carboxylic acid,4h-chromen-4-one-3-carboxylic acid |
| IUPAC Name | 4-oxochromene-3-carboxylic acid |
| InChI Key | PCIITXGDSHXTSN-UHFFFAOYSA-N |
| Molecular Formula | C10H6O4 |
1-Benzofuran-5-carboxylic acid, Thermo Scientific™
CAS: 90721-27-0 Molecular Formula: C9H6O3 Molecular Weight (g/mol): 162.14 MDL Number: MFCD01006742 InChI Key: GTWXSZIQNTUNKR-UHFFFAOYSA-N Synonym: benzofuran-5-carboxylic acid,5-benzofurancarboxylic acid,benzo b furan-5-carboxylic acid,1-benzofunan-5-carboxylic acid,benzofurane-5-carboxylic acid,4ctj,pubchem7018,5-benzofuran carboxylic,rarechem al be 1369,5-benzofurancarboxylicacid PubChem CID: 595656 IUPAC Name: 1-benzofuran-5-carboxylic acid SMILES: OC(=O)C1=CC=C2OC=CC2=C1
| PubChem CID | 595656 |
|---|---|
| CAS | 90721-27-0 |
| Molecular Weight (g/mol) | 162.14 |
| MDL Number | MFCD01006742 |
| SMILES | OC(=O)C1=CC=C2OC=CC2=C1 |
| Synonym | benzofuran-5-carboxylic acid,5-benzofurancarboxylic acid,benzo b furan-5-carboxylic acid,1-benzofunan-5-carboxylic acid,benzofurane-5-carboxylic acid,4ctj,pubchem7018,5-benzofuran carboxylic,rarechem al be 1369,5-benzofurancarboxylicacid |
| IUPAC Name | 1-benzofuran-5-carboxylic acid |
| InChI Key | GTWXSZIQNTUNKR-UHFFFAOYSA-N |
| Molecular Formula | C9H6O3 |
2-(2-Furyl)benzoic acid, 97%, Thermo Scientific™
CAS: 331942-47-3 Molecular Formula: C11H8O3 Molecular Weight (g/mol): 188.182 InChI Key: QRUHYAWZHFTNEA-UHFFFAOYSA-N Synonym: 2-2-furyl benzoic acid,2-furan-2-yl benzoic acid,2-fur-2-ylbenzoic acid,benzoic acid,2-2-furanyl,2-fur-2-yl benzoic acid,2-furan-2-yl-benzoic acid PubChem CID: 2772293 IUPAC Name: 2-(furan-2-yl)benzoic acid SMILES: C1=CC=C(C(=C1)C2=CC=CO2)C(=O)O
| PubChem CID | 2772293 |
|---|---|
| CAS | 331942-47-3 |
| Molecular Weight (g/mol) | 188.182 |
| SMILES | C1=CC=C(C(=C1)C2=CC=CO2)C(=O)O |
| Synonym | 2-2-furyl benzoic acid,2-furan-2-yl benzoic acid,2-fur-2-ylbenzoic acid,benzoic acid,2-2-furanyl,2-fur-2-yl benzoic acid,2-furan-2-yl-benzoic acid |
| IUPAC Name | 2-(furan-2-yl)benzoic acid |
| InChI Key | QRUHYAWZHFTNEA-UHFFFAOYSA-N |
| Molecular Formula | C11H8O3 |
4-(2-Furyl)benzoic acid, 97%, Thermo Scientific™
CAS: 35461-98-4 Molecular Formula: C11H8O3 Molecular Weight (g/mol): 188.18 MDL Number: MFCD04039073 InChI Key: FOJYVBSPOBUCMV-UHFFFAOYSA-N Synonym: 4-2-furyl benzoic acid,4-furan-2-yl benzoic acid,4-furan-2-yl-benzoic acid,2-4-carboxyphenyl furan,4-fur-2-ylbenzoic acid,p-2-furyl benzoic acid,4-2-furanyl benzoic acid PubChem CID: 5138791 IUPAC Name: 4-(furan-2-yl)benzoic acid SMILES: OC(=O)C1=CC=C(C=C1)C1=CC=CO1
| PubChem CID | 5138791 |
|---|---|
| CAS | 35461-98-4 |
| Molecular Weight (g/mol) | 188.18 |
| MDL Number | MFCD04039073 |
| SMILES | OC(=O)C1=CC=C(C=C1)C1=CC=CO1 |
| Synonym | 4-2-furyl benzoic acid,4-furan-2-yl benzoic acid,4-furan-2-yl-benzoic acid,2-4-carboxyphenyl furan,4-fur-2-ylbenzoic acid,p-2-furyl benzoic acid,4-2-furanyl benzoic acid |
| IUPAC Name | 4-(furan-2-yl)benzoic acid |
| InChI Key | FOJYVBSPOBUCMV-UHFFFAOYSA-N |
| Molecular Formula | C11H8O3 |
Benzo[b]furan-7-carboxylic acid, Thermo Scientific™
CAS: 90484-22-3 Molecular Formula: C9H6O3 Molecular Weight (g/mol): 162.14 MDL Number: MFCD10000617 InChI Key: QMHILIQFOBNARN-UHFFFAOYSA-N Synonym: benzofuran-7-carboxylic acid,benzofuran-7-carboxylicacid,7-benzofuranylcarboxylic acid,benzo b furan-7-carboxylic acid,7-benzofurancarboxylic acid,4ahs,7-benzofurancarboxylicacid,akh PubChem CID: 13307983 IUPAC Name: 1-benzofuran-7-carboxylic acid SMILES: OC(=O)C1=C2OC=CC2=CC=C1
| PubChem CID | 13307983 |
|---|---|
| CAS | 90484-22-3 |
| Molecular Weight (g/mol) | 162.14 |
| MDL Number | MFCD10000617 |
| SMILES | OC(=O)C1=C2OC=CC2=CC=C1 |
| Synonym | benzofuran-7-carboxylic acid,benzofuran-7-carboxylicacid,7-benzofuranylcarboxylic acid,benzo b furan-7-carboxylic acid,7-benzofurancarboxylic acid,4ahs,7-benzofurancarboxylicacid,akh |
| IUPAC Name | 1-benzofuran-7-carboxylic acid |
| InChI Key | QMHILIQFOBNARN-UHFFFAOYSA-N |
| Molecular Formula | C9H6O3 |
3-(2-Furyl)benzoic acid, 97%, Thermo Scientific™
CAS: 35461-99-5 Molecular Formula: C11H8O3 Molecular Weight (g/mol): 188.182 MDL Number: MFCD02690979 InChI Key: RQVVFGRDMHDHNI-UHFFFAOYSA-N Synonym: 3-furan-2-yl benzoic acid,3-2-furyl benzoic acid,3-fur-2-ylbenzoic acid,3-furan-2-yl-benzoic acid,m-2-furyl benzoic acid,benzoic acid, 3-2-furanyl PubChem CID: 5037933 IUPAC Name: 3-(furan-2-yl)benzoic acid SMILES: C1=CC(=CC(=C1)C(=O)O)C2=CC=CO2
| PubChem CID | 5037933 |
|---|---|
| CAS | 35461-99-5 |
| Molecular Weight (g/mol) | 188.182 |
| MDL Number | MFCD02690979 |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC=CO2 |
| Synonym | 3-furan-2-yl benzoic acid,3-2-furyl benzoic acid,3-fur-2-ylbenzoic acid,3-furan-2-yl-benzoic acid,m-2-furyl benzoic acid,benzoic acid, 3-2-furanyl |
| IUPAC Name | 3-(furan-2-yl)benzoic acid |
| InChI Key | RQVVFGRDMHDHNI-UHFFFAOYSA-N |
| Molecular Formula | C11H8O3 |
4-Oxo-4H-1-benzopyran-2-carboxylic acid, 97%
CAS: 4940-39-0 Molecular Formula: C10H6O4 Molecular Weight (g/mol): 190.15 MDL Number: MFCD00006838 InChI Key: RVMGXWBCQGAWBR-UHFFFAOYSA-N Synonym: chromocarb,chromone-2-carboxylic acid,4-oxo-4h-chromene-2-carboxylic acid,4-oxo-4h-1-benzopyran-2-carboxylic acid,atremon,chromonecarboxylic acid,lp-1,chromocarb inn:dcf,2-chromonecarboxylic acid,chromocarbe inn-french PubChem CID: 2741 IUPAC Name: 4-oxochromene-2-carboxylic acid SMILES: C1=CC=C2C(=C1)C(=O)C=C(O2)C(=O)O
| PubChem CID | 2741 |
|---|---|
| CAS | 4940-39-0 |
| Molecular Weight (g/mol) | 190.15 |
| MDL Number | MFCD00006838 |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(O2)C(=O)O |
| Synonym | chromocarb,chromone-2-carboxylic acid,4-oxo-4h-chromene-2-carboxylic acid,4-oxo-4h-1-benzopyran-2-carboxylic acid,atremon,chromonecarboxylic acid,lp-1,chromocarb inn:dcf,2-chromonecarboxylic acid,chromocarbe inn-french |
| IUPAC Name | 4-oxochromene-2-carboxylic acid |
| InChI Key | RVMGXWBCQGAWBR-UHFFFAOYSA-N |
| Molecular Formula | C10H6O4 |