Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
N-Benzyl-tert-butyl-d9-amine, CDN
Discover 4000+ high-quality deuterated compounds, shipping directly from stock for speed. We offer many unique API’s, including active pharmaceutical ingredients, nitrosoamines, amino acids, steroids, gases, pesticides, and fatty acids.
| Percent Purity | 99 atom % D, min 98% Chemical Purity |
|---|---|
| CAS | 1060688-77-8 |
| Molecular Weight (g/mol) | 172.3148 |
| InChI Formula | InChI=1 S/C11H17N/c1-11(2,3)12-9-10-7-5-4-6-8-10/h4-8,12 H,9H2,1-3H3/i1D3,2D3,3D3 |
| Chemical Name or Material | N-Benzyl-tert-butylamine-D9 (tert-butyl-D9) |
| SMILES | [2 H]C([2 H])([2 H])C(NCc1ccccc1)(C([2 H])([2 H])[2 H])C([2 H])([2 H])[2 H] |
| Synonym | Benzenemethanamine, N-[1,1-di(methyl-d3)ethyl-2,2,2-d3]- (ACI),N-[1,1-Di(methyl-d3)ethyl-2,2,2-d3]benzenemethanamine (ACI),N-tert-Butyl-d9-benzylamine,N-Benzyl-tert-butylamine-d9,N-Benzyl-tert-butyl-d9-amine |
| Recommended Storage | Room Temperature |
| IUPAC Name | N-benzyl-1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-amine |
| Molecular Formula | C11 D9 H8 N |
| Formula Weight | 172.1926 g/mol |
N-Benzyl Di-O-TBS Epinephrine-d3, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molecular Weight (g/mol) | 504.867 |
|---|---|
| InChI Formula | InChI=1S/C28H47NO3Si2/c1-27(2,3)33(8,9)31-25-18-17-23(19-26(25)32-34(10,11)28(4,5)6)24(30)21-29(7)20-22-15-13-12-14-16-22/h12-19,24,30H,20-21H2,1-11H3/i7D3 |
| Chemical Name or Material | N-Benzyl Di-O-TBS Epinephrine-d3 |
| SMILES | [2H]C([2H])([2H])N(CC(O)c1ccc(O[Si](C)(C)C(C)(C)C)c(O[Si](C)(C)C(C)(C)C)c1)Cc2ccccc2 |
| IUPAC Name | 2-[benzyl(trideuteriomethyl)amino]-1-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethanol |
| Molecular Formula | C28 D3 H44 N O3 Si2 |
| Formula Weight | 504.328 |
2-(N-Benzyl-N-methyl)aminoethanol-1,1,2,2-d4, CDN
Discover 4000+ high-quality deuterated compounds, shipping directly from stock for speed. We offer many unique API’s, including active pharmaceutical ingredients, nitrosoamines, amino acids, steroids, gases, pesticides, and fatty acids.
| Percent Purity | 99 atom % D, min 98% Chemical Purity |
|---|---|
| CAS | 1219803-10-7 |
| Molecular Weight (g/mol) | 169.26 |
| InChI Formula | InChI=1 S/C10H15NO/c1-11(7-8-12)9-10-5-3-2-4-6-10/h2-6,12 H,7-9H2,1H3/i7D2,8D2 |
| Chemical Name or Material | N-Benzyl-N-methylethanolamine ethyl-1,1,2,2-d4 |
| SMILES | [2 H]C([2 H])(O)C([2 H])([2 H])N(C)Cc1ccccc1 |
| Synonym | Ethan-1,1,2,2-d4-ol, 2-[methyl(phenylmethyl)amino]-,2-[Methyl(phenylmethyl)amino]ethan-1,1,2,2-d4-ol,N-Benzyl-N-methylethanolamine-1,1,2,2-d4,N-Benzyl-N-methylethanolamine-D4 (ethyl-1,1,2,2,-D4) |
| Recommended Storage | Room Temperature |
| IUPAC Name | 2-[benzyl(methyl)amino]-1,1,2,2-tetradeuterioethanol |
| Molecular Formula | C10 2H4 H11 N O |
| Formula Weight | 169.1405 g/mol |
rac N-Benzyl-N-[2-hydroxyl-2-(4-benzyloxy-3-aminophenyl)-ethyl]-3-(4-methoxyphenyl)-2-propylamine-d6, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molecular Weight (g/mol) | 502.677 |
|---|---|
| InChI Formula | InChI=1S/C32H36N2O3/c1-24(19-25-13-16-29(36-2)17-14-25)34(21-26-9-5-3-6-10-26)22-31(35)28-15-18-32(30(33)20-28)37-23-27-11-7-4-8-12-27/h3-18,20,24,31,35H,19,21-23,33H2,1-2H3/i1D3,19D2,24D |
| Chemical Name or Material | rac N-Benzyl-N-[2-hydroxyl-2-(4-benzyloxy-3-aminophenyl)-ethyl]-3-(4-methoxyphenyl)-2-propylamine-d6 |
| SMILES | [2H]C([2H])([2H])C([2H])(N(CC(O)c1ccc(OCc2ccccc2)c(N)c1)Cc3ccccc3)C([2H])([2H])c4ccc(OC)cc4 |
| Synonym | 3-Amino-alpha-[[[2-(4-methoxyphenyl)-1-methylethyl](phenylmethyl)amino]methyl]-4-(phenylmethoxy)-benzenemethanol |
| IUPAC Name | 1-(3-amino-4-phenylmethoxyphenyl)-2-[benzyl-[1,1,1,2,3,3-hexadeuterio-3-(4-methoxyphenyl)propan-2-yl]amino]ethanol |
| Molecular Formula | C32 D6 H30 N2 O3 |
| Formula Weight | 502.31 |
N,N-Dimethylacetamide, HPLC Grade, 99.5+%
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
N,N-Dimethylacetamide, 99.5%, Extra Dry, AcroSeal™
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
N,N-Dimethylformamide, 99.8%, Extra Dry over Molecular Sieve, AcroSeal™
CAS: 68-12-2 Molecular Formula: C3H7NO Molecular Weight (g/mol): 73.10 MDL Number: MFCD00003284 InChI Key: ZMXDDKWLCZADIW-UHFFFAOYSA-N Synonym: dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa PubChem CID: 6228 ChEBI: CHEBI:17741 IUPAC Name: N,N-dimethylformamide SMILES: CN(C)C=O
| PubChem CID | 6228 |
|---|---|
| CAS | 68-12-2 |
| Molecular Weight (g/mol) | 73.10 |
| ChEBI | CHEBI:17741 |
| MDL Number | MFCD00003284 |
| SMILES | CN(C)C=O |
| Synonym | dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa |
| IUPAC Name | N,N-dimethylformamide |
| InChI Key | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO |
Hexanes, ≈95% N-Hexane, for HPLC
CAS: 110-54-3 Molecular Formula: C6H14 MDL Number: MFCD02179311 InChI Key: VLKZOEOYAKHREP-UHFFFAOYSA-N Synonym: n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes PubChem CID: 8058 ChEBI: CHEBI:29021 IUPAC Name: hexane SMILES: CCCCCC
| PubChem CID | 8058 |
|---|---|
| CAS | 110-54-3 |
| ChEBI | CHEBI:29021 |
| MDL Number | MFCD02179311 |
| SMILES | CCCCCC |
| Synonym | n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes |
| IUPAC Name | hexane |
| InChI Key | VLKZOEOYAKHREP-UHFFFAOYSA-N |
| Molecular Formula | C6H14 |
N,N-Dimethylformamide, 99+%, extra pure
CAS: 68-12-2 Molecular Formula: C3H7NO Molecular Weight (g/mol): 73.10 MDL Number: MFCD00003284 InChI Key: ZMXDDKWLCZADIW-UHFFFAOYSA-N Synonym: dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa PubChem CID: 6228 ChEBI: CHEBI:17741 IUPAC Name: N,N-dimethylformamide SMILES: CN(C)C=O
| PubChem CID | 6228 |
|---|---|
| CAS | 68-12-2 |
| Molecular Weight (g/mol) | 73.10 |
| ChEBI | CHEBI:17741 |
| MDL Number | MFCD00003284 |
| SMILES | CN(C)C=O |
| Synonym | dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa |
| IUPAC Name | N,N-dimethylformamide |
| InChI Key | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO |
N,N-Dimethylformamide, 99.8%, Extra Dry, AcroSeal™
CAS: 68-12-2 Molecular Formula: C3H7NO Molecular Weight (g/mol): 73.10 MDL Number: MFCD00003284 InChI Key: ZMXDDKWLCZADIW-UHFFFAOYSA-N Synonym: dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa PubChem CID: 6228 ChEBI: CHEBI:17741 IUPAC Name: N,N-dimethylformamide SMILES: CN(C)C=O
| PubChem CID | 6228 |
|---|---|
| CAS | 68-12-2 |
| Molecular Weight (g/mol) | 73.10 |
| ChEBI | CHEBI:17741 |
| MDL Number | MFCD00003284 |
| SMILES | CN(C)C=O |
| Synonym | dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa |
| IUPAC Name | N,N-dimethylformamide |
| InChI Key | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO |
N-Heptane, Certified AR for Analysis, Fisher Chemical™
CAS: 142-82-5 Molecular Formula: C7H16 Molecular Weight (g/mol): 100.21 MDL Number: MFCD00009544 InChI Key: IMNFDUFMRHMDMM-UHFFFAOYSA-N Synonym: n-heptane,dipropylmethane,heptan,heptyl hydride,dipropyl methane,gettysolve-c,skellysolve c,heptanen,eptani,heptan polish PubChem CID: 8900 ChEBI: CHEBI:43098 IUPAC Name: heptane SMILES: CCCCCCC
| PubChem CID | 8900 |
|---|---|
| CAS | 142-82-5 |
| Molecular Weight (g/mol) | 100.21 |
| ChEBI | CHEBI:43098 |
| MDL Number | MFCD00009544 |
| SMILES | CCCCCCC |
| Synonym | n-heptane,dipropylmethane,heptan,heptyl hydride,dipropyl methane,gettysolve-c,skellysolve c,heptanen,eptani,heptan polish |
| IUPAC Name | heptane |
| InChI Key | IMNFDUFMRHMDMM-UHFFFAOYSA-N |
| Molecular Formula | C7H16 |
n-Heptane, 99%, Optima™ for HPLC and GC, Fisher Chemical™
CAS: 142-82-5 Molecular Formula: C7H16 Molecular Weight (g/mol): 100.21 MDL Number: MFCD00009544 InChI Key: IMNFDUFMRHMDMM-UHFFFAOYSA-N PubChem CID: 8900 ChEBI: CHEBI:43098 IUPAC Name: heptane SMILES: CCCCCCC
| PubChem CID | 8900 |
|---|---|
| CAS | 142-82-5 |
| Molecular Weight (g/mol) | 100.21 |
| ChEBI | CHEBI:43098 |
| MDL Number | MFCD00009544 |
| SMILES | CCCCCCC |
| IUPAC Name | heptane |
| InChI Key | IMNFDUFMRHMDMM-UHFFFAOYSA-N |
| Molecular Formula | C7H16 |
N,N-Dimethylacetamide, 99%, pure
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
n-Pentane, 99+%, extra pure
CAS: 109-66-0 Molecular Formula: C5H12 Molecular Weight (g/mol): 72.15 MDL Number: MFCD00009498 InChI Key: OFBQJSOFQDEBGM-UHFFFAOYSA-N Synonym: n-pentane,pentan,skellysolve a,pentanen,pentani,amyl hydride,tetrafume,tetrakil,tetraspot,pentan polish PubChem CID: 8003 ChEBI: CHEBI:37830 IUPAC Name: pentane SMILES: CCCCC
| PubChem CID | 8003 |
|---|---|
| CAS | 109-66-0 |
| Molecular Weight (g/mol) | 72.15 |
| ChEBI | CHEBI:37830 |
| MDL Number | MFCD00009498 |
| SMILES | CCCCC |
| Synonym | n-pentane,pentan,skellysolve a,pentanen,pentani,amyl hydride,tetrafume,tetrakil,tetraspot,pentan polish |
| IUPAC Name | pentane |
| InChI Key | OFBQJSOFQDEBGM-UHFFFAOYSA-N |
| Molecular Formula | C5H12 |
Hexanes, Certified AR for Analysis, 95% N-Hexane Approx, Fisher Chemical™
CAS: 92112-69-1 Molecular Formula: C6H14 Molecular Weight (g/mol): 86.18 MDL Number: MFCD00009520 InChI Key: VLKZOEOYAKHREP-UHFFFAOYSA-N Synonym: n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes PubChem CID: 8058 ChEBI: CHEBI:29021 IUPAC Name: hexane SMILES: CCCCCC
| PubChem CID | 8058 |
|---|---|
| CAS | 92112-69-1 |
| Molecular Weight (g/mol) | 86.18 |
| ChEBI | CHEBI:29021 |
| MDL Number | MFCD00009520 |
| SMILES | CCCCCC |
| Synonym | n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes |
| IUPAC Name | hexane |
| InChI Key | VLKZOEOYAKHREP-UHFFFAOYSA-N |
| Molecular Formula | C6H14 |