Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Thermo Scientific Chemicals Guanidine hydrochloride, Molecular Biology Grade
CAS: 50-01-1 Molecular Formula: CH6ClN3 Molecular Weight (g/mol): 95.53 MDL Number: MFCD00013026 InChI Key: PJJJBBJSCAKJQF-UHFFFAOYSA-N Synonym: guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride PubChem CID: 5742 ChEBI: CHEBI:32735 IUPAC Name: guanidine;hydrochloride SMILES: C(=N)(N)N.Cl
| PubChem CID | 5742 |
|---|---|
| CAS | 50-01-1 |
| Molecular Weight (g/mol) | 95.53 |
| ChEBI | CHEBI:32735 |
| MDL Number | MFCD00013026 |
| SMILES | C(=N)(N)N.Cl |
| Synonym | guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride |
| IUPAC Name | guanidine;hydrochloride |
| InChI Key | PJJJBBJSCAKJQF-UHFFFAOYSA-N |
| Molecular Formula | CH6ClN3 |
Guanidine Hydrochloride, >99.5%, Molecular Biology Grade
CAS: 50-01-1 Molecular Formula: CH6ClN3 Molecular Weight (g/mol): 95.53 MDL Number: MFCD00013026 InChI Key: PJJJBBJSCAKJQF-UHFFFAOYSA-N Synonym: guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride PubChem CID: 5742 ChEBI: CHEBI:32735
| PubChem CID | 5742 |
|---|---|
| CAS | 50-01-1 |
| Molecular Weight (g/mol) | 95.53 |
| ChEBI | CHEBI:32735 |
| MDL Number | MFCD00013026 |
| Synonym | guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride |
| InChI Key | PJJJBBJSCAKJQF-UHFFFAOYSA-N |
| Molecular Formula | CH6ClN3 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, disodium salt dihydrate, 99+%, for molecular biology, DNAse, RNAse and Protease free
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Ethylenediaminetetraacetic acid, (EDTA), 0.5M Solution, Molecular Biology Grade, Ultrapure
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.238 MDL Number: MFCD00150037 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)O.O.O.[Na+].[Na+]
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.238 |
| MDL Number | MFCD00150037 |
| SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)O.O.O.[Na+].[Na+] |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Urea, ≥99.5%, Molecular Biology Grade, Ultrapure
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.056 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.056 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Dithiothreitol, >99.5%, Molecular Biology Grade, Ultrapure
CAS: 12-3-3483 Molecular Formula: C4H10O2S2 Molecular Weight (g/mol): 154.24 MDL Number: MFCD00004877 InChI Key: VHJLVAABSRFDPM-IMJSIDKUSA-N Synonym: dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt PubChem CID: 446094 ChEBI: CHEBI:42170 IUPAC Name: (2 S,3 S)-1,4-bis(sulfanyl)butane-2,3-diol SMILES: C(C(C(CS)O)O)S
| PubChem CID | 446094 |
|---|---|
| CAS | 12-3-3483 |
| Molecular Weight (g/mol) | 154.24 |
| ChEBI | CHEBI:42170 |
| MDL Number | MFCD00004877 |
| SMILES | C(C(C(CS)O)O)S |
| Synonym | dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt |
| IUPAC Name | (2 S,3 S)-1,4-bis(sulfanyl)butane-2,3-diol |
| InChI Key | VHJLVAABSRFDPM-IMJSIDKUSA-N |
| Molecular Formula | C4H10O2S2 |
Thermo Scientific Chemicals Tris(2-carboxyethyl)phosphine hydrochloride, 98%, Molecular Biology Grade
CAS: 51805-45-9 Molecular Formula: C9H12O6P Molecular Weight (g/mol): 247.16 MDL Number: MFCD00145469 InChI Key: PZBFGYYEXUXCOF-UHFFFAOYSA-K Synonym: tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride PubChem CID: 2734570 IUPAC Name: 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride SMILES: [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O
| PubChem CID | 2734570 |
|---|---|
| CAS | 51805-45-9 |
| Molecular Weight (g/mol) | 247.16 |
| MDL Number | MFCD00145469 |
| SMILES | [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O |
| Synonym | tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride |
| IUPAC Name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride |
| InChI Key | PZBFGYYEXUXCOF-UHFFFAOYSA-K |
| Molecular Formula | C9H12O6P |
Thermo Scientific Chemicals Guanidine thiocyanate, Molecular Biology Grade
CAS: 593-84-0 Molecular Formula: CH5N3·CHNS MDL Number: MFCD00013027 Synonym: Guanidine rhodanide
| CAS | 593-84-0 |
|---|---|
| MDL Number | MFCD00013027 |
| Synonym | Guanidine rhodanide |
| Molecular Formula | CH5N3·CHNS |
Thermo Scientific Chemicals Acrylamide, 99.5%, Molecular Biology Grade
CAS: 79-06-1 Molecular Formula: C3H5NO Molecular Weight (g/mol): 71.08 MDL Number: MFCD00008032 InChI Key: HRPVXLWXLXDGHG-UHFFFAOYSA-N Synonym: acrylamide,2-propenamide,propenamide,acrylic amide,akrylamid,ethylenecarboxamide,vinyl amide,acrylic acid amide,2-propeneamide,propeneamide PubChem CID: 6579 ChEBI: CHEBI:28619 IUPAC Name: prop-2-enamide SMILES: NC(=O)C=C
| PubChem CID | 6579 |
|---|---|
| CAS | 79-06-1 |
| Molecular Weight (g/mol) | 71.08 |
| ChEBI | CHEBI:28619 |
| MDL Number | MFCD00008032 |
| SMILES | NC(=O)C=C |
| Synonym | acrylamide,2-propenamide,propenamide,acrylic amide,akrylamid,ethylenecarboxamide,vinyl amide,acrylic acid amide,2-propeneamide,propeneamide |
| IUPAC Name | prop-2-enamide |
| InChI Key | HRPVXLWXLXDGHG-UHFFFAOYSA-N |
| Molecular Formula | C3H5NO |
Thermo Scientific Chemicals Urea, 99.5%, for molecular biology, DNAse, RNAse and Protease free
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.06 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.06 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Formaldehyde (37% by Weight/Molecular Biology), Fisher BioReagents
CAS: 50-00-0 Molecular Formula: CH2O Molecular Weight (g/mol): 30.03 MDL Number: MFCD00003274 InChI Key: WSFSSNUMVMOOMR-UHFFFAOYSA-N Synonym: formalin,methanal,formol,methylene oxide,paraformaldehyde,oxomethane,paraform,formic aldehyde,oxymethylene,methyl aldehyde PubChem CID: 712 ChEBI: CHEBI:16842 IUPAC Name: formaldehyde SMILES: C=O
| PubChem CID | 712 |
|---|---|
| CAS | 50-00-0 |
| Molecular Weight (g/mol) | 30.03 |
| ChEBI | CHEBI:16842 |
| MDL Number | MFCD00003274 |
| SMILES | C=O |
| Synonym | formalin,methanal,formol,methylene oxide,paraformaldehyde,oxomethane,paraform,formic aldehyde,oxymethylene,methyl aldehyde |
| IUPAC Name | formaldehyde |
| InChI Key | WSFSSNUMVMOOMR-UHFFFAOYSA-N |
| Molecular Formula | CH2O |
Thermo Scientific Chemicals Sodium n-dodecyl sulfate, 99%, Molecular Biology Grade
CAS: 151-21-3 Molecular Formula: C12H25NaO4S Molecular Weight (g/mol): 288.38 MDL Number: MFCD00036175 InChI Key: DBMJMQXJHONAFJ-UHFFFAOYSA-M Synonym: sodium dodecyl sulfate,sodium lauryl sulfate,sodium dodecylsulfate,sodium lauryl sulphate,sodium dodecyl sulphate,dodecyl sulfate, sodium salt,anticerumen,gardinol,neutrazyme,duponal PubChem CID: 3423265 ChEBI: CHEBI:8984 SMILES: [Na+].CCCCCCCCCCCCOS([O-])(=O)=O
| PubChem CID | 3423265 |
|---|---|
| CAS | 151-21-3 |
| Molecular Weight (g/mol) | 288.38 |
| ChEBI | CHEBI:8984 |
| MDL Number | MFCD00036175 |
| SMILES | [Na+].CCCCCCCCCCCCOS([O-])(=O)=O |
| Synonym | sodium dodecyl sulfate,sodium lauryl sulfate,sodium dodecylsulfate,sodium lauryl sulphate,sodium dodecyl sulphate,dodecyl sulfate, sodium salt,anticerumen,gardinol,neutrazyme,duponal |
| InChI Key | DBMJMQXJHONAFJ-UHFFFAOYSA-M |
| Molecular Formula | C12H25NaO4S |
Thermo Scientific Chemicals Tris(hydroxymethyl)aminomethane, 99.85%, for molecular biology, DNAse, RNAse and Protease free
CAS: 77-86-1 Molecular Formula: C4H11NO3 Molecular Weight (g/mol): 121.14 MDL Number: MFCD00004679 InChI Key: LENZDBCJOHFCAS-UHFFFAOYSA-N Synonym: trometamol,tris,tromethamine,tris hydroxymethyl aminomethane,tham,trisamine,tris buffer,trizma,2-amino-2-hydroxymethyl propane-1,3-diol,tris base PubChem CID: 6503 ChEBI: CHEBI:9754 IUPAC Name: 2-amino-2-(hydroxymethyl)propane-1,3-diol SMILES: C(C(CO)(CO)N)O
| PubChem CID | 6503 |
|---|---|
| CAS | 77-86-1 |
| Molecular Weight (g/mol) | 121.14 |
| ChEBI | CHEBI:9754 |
| MDL Number | MFCD00004679 |
| SMILES | C(C(CO)(CO)N)O |
| Synonym | trometamol,tris,tromethamine,tris hydroxymethyl aminomethane,tham,trisamine,tris buffer,trizma,2-amino-2-hydroxymethyl propane-1,3-diol,tris base |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol |
| InChI Key | LENZDBCJOHFCAS-UHFFFAOYSA-N |
| Molecular Formula | C4H11NO3 |