Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Tetrakis(triphenylphosphine)palladium(0), 99%
CAS: 14221-01-3 Molecular Formula: C72H60P4Pd Molecular Weight (g/mol): 1155.59 MDL Number: MFCD00010012 InChI Key: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC Name: palladium;triphenylphosphane SMILES: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11979704 |
|---|---|
| CAS | 14221-01-3 |
| Molecular Weight (g/mol) | 1155.59 |
| MDL Number | MFCD00010012 |
| SMILES | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| IUPAC Name | palladium;triphenylphosphane |
| InChI Key | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molecular Formula | C72H60P4Pd |
Bis(dibenzylideneacetone)palladium(0)
CAS: 32005-36-0 Molecular Formula: C34H28O2Pd Molecular Weight (g/mol): 575.02 MDL Number: MFCD00051942 InChI Key: UKSZBOKPHAQOMP-SVLSSHOZSA-N Synonym: bis dibenzylideneacetone palladium,bis dibenzylideneacetone palladium 0,pd dba 2,1e,4e-1,5-diphenylpenta-1,4-dien-3-one; palladium,bis dibenzyldeneacetone palladium 0,tris dibenzylideneacetone dipalladium o,palladium 0 bis dibenzylideneacetone,pubchem14428 PubChem CID: 6505921 IUPAC Name: (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium SMILES: [Pd].O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1.O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1
| PubChem CID | 6505921 |
|---|---|
| CAS | 32005-36-0 |
| Molecular Weight (g/mol) | 575.02 |
| MDL Number | MFCD00051942 |
| SMILES | [Pd].O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1.O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1 |
| Synonym | bis dibenzylideneacetone palladium,bis dibenzylideneacetone palladium 0,pd dba 2,1e,4e-1,5-diphenylpenta-1,4-dien-3-one; palladium,bis dibenzyldeneacetone palladium 0,tris dibenzylideneacetone dipalladium o,palladium 0 bis dibenzylideneacetone,pubchem14428 |
| IUPAC Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium |
| InChI Key | UKSZBOKPHAQOMP-SVLSSHOZSA-N |
| Molecular Formula | C34H28O2Pd |
Bis(tricyclohexylphosphine)palladium(0), 97% min
CAS: 33309-88-5 Molecular Formula: C36H66P2Pd Molecular Weight (g/mol): 667.29 MDL Number: MFCD01073796 InChI Key: JGBZTJWQMWZVNX-UHFFFAOYSA-N Synonym: bis tricyclohexylphosphine palladium 0,bis tricyclohexylphosphine palladium o,bis tricyclohexylphosphine palladium,palladium, bis tricyclohexylphosphine,pd pcy3 2,palladium; tricyclohexylphosphane,palladium-tricyclohexylphosphine 1:2,bis tricyclohexylphosphine-palladium o PubChem CID: 2734559 IUPAC Name: palladium;tricyclohexylphosphane SMILES: [Pd].C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1
| PubChem CID | 2734559 |
|---|---|
| CAS | 33309-88-5 |
| Molecular Weight (g/mol) | 667.29 |
| MDL Number | MFCD01073796 |
| SMILES | [Pd].C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1 |
| Synonym | bis tricyclohexylphosphine palladium 0,bis tricyclohexylphosphine palladium o,bis tricyclohexylphosphine palladium,palladium, bis tricyclohexylphosphine,pd pcy3 2,palladium; tricyclohexylphosphane,palladium-tricyclohexylphosphine 1:2,bis tricyclohexylphosphine-palladium o |
| IUPAC Name | palladium;tricyclohexylphosphane |
| InChI Key | JGBZTJWQMWZVNX-UHFFFAOYSA-N |
| Molecular Formula | C36H66P2Pd |
Tetrakis(triphenylphosphine)palladium(0), 99.9%, (trace metal basis)
CAS: 14221-01-3 Molecular Formula: C72H60P4Pd Molecular Weight (g/mol): 1155.59 MDL Number: MFCD00010012 InChI Key: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC Name: palladium;triphenylphosphane SMILES: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11979704 |
|---|---|
| CAS | 14221-01-3 |
| Molecular Weight (g/mol) | 1155.59 |
| MDL Number | MFCD00010012 |
| SMILES | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| IUPAC Name | palladium;triphenylphosphane |
| InChI Key | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molecular Formula | C72H60P4Pd |
Bis(tri-tert-butylphosphine)palladium(0), 98%
CAS: 53199-31-8 Molecular Formula: C24H54P2Pd Molecular Weight (g/mol): 511.06 MDL Number: MFCD03094580 InChI Key: MXQOYLRVSVOCQT-UHFFFAOYSA-N Synonym: bis tri-tert-butylphosphine palladium 0,bis tri-t-butylphosphine palladium 0,bis tri-tert-butylphosphine palladium,bis tri-tert-butylphosphane palladium,palladium; tritert-butylphosphane,palladium, bis tris 1,1-dimethylethyl phosphine,pd p tbu 3 2,pd t-bu3p 2,bis tri-t-butylphosphine palladium,di tri-tert-butylphosphine palladium 0 PubChem CID: 2734558 SMILES: [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C
| PubChem CID | 2734558 |
|---|---|
| CAS | 53199-31-8 |
| Molecular Weight (g/mol) | 511.06 |
| MDL Number | MFCD03094580 |
| SMILES | [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C |
| Synonym | bis tri-tert-butylphosphine palladium 0,bis tri-t-butylphosphine palladium 0,bis tri-tert-butylphosphine palladium,bis tri-tert-butylphosphane palladium,palladium; tritert-butylphosphane,palladium, bis tris 1,1-dimethylethyl phosphine,pd p tbu 3 2,pd t-bu3p 2,bis tri-t-butylphosphine palladium,di tri-tert-butylphosphine palladium 0 |
| InChI Key | MXQOYLRVSVOCQT-UHFFFAOYSA-N |
| Molecular Formula | C24H54P2Pd |
Bis(tri-tert-butylphosphine)palladium(0)
CAS: 53199-31-8 Molecular Formula: C24H54P2Pd Molecular Weight (g/mol): 511.06 MDL Number: MFCD03094580 InChI Key: MXQOYLRVSVOCQT-UHFFFAOYSA-N Synonym: bis tri-tert-butylphosphine palladium 0,bis tri-t-butylphosphine palladium 0,bis tri-tert-butylphosphine palladium,bis tri-tert-butylphosphane palladium,palladium; tritert-butylphosphane,palladium, bis tris 1,1-dimethylethyl phosphine,pd p tbu 3 2,pd t-bu3p 2,bis tri-t-butylphosphine palladium,di tri-tert-butylphosphine palladium 0 PubChem CID: 2734558 IUPAC Name: palladium;tritert-butylphosphane SMILES: [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C
| PubChem CID | 2734558 |
|---|---|
| CAS | 53199-31-8 |
| Molecular Weight (g/mol) | 511.06 |
| MDL Number | MFCD03094580 |
| SMILES | [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C |
| Synonym | bis tri-tert-butylphosphine palladium 0,bis tri-t-butylphosphine palladium 0,bis tri-tert-butylphosphine palladium,bis tri-tert-butylphosphane palladium,palladium; tritert-butylphosphane,palladium, bis tris 1,1-dimethylethyl phosphine,pd p tbu 3 2,pd t-bu3p 2,bis tri-t-butylphosphine palladium,di tri-tert-butylphosphine palladium 0 |
| IUPAC Name | palladium;tritert-butylphosphane |
| InChI Key | MXQOYLRVSVOCQT-UHFFFAOYSA-N |
| Molecular Formula | C24H54P2Pd |
Bis[1,2-bis(diphenylphosphino)ethane]palladium(0)
CAS: 31277-98-2 Molecular Formula: C52H48P4Pd Molecular Weight (g/mol): 903.27 MDL Number: MFCD00009880 InChI Key: FAFGMAGIYHHRKN-UHFFFAOYSA-N Synonym: bis 1,2-bis diphenylphosphino ethane palladium 0,pd dppe 2,pd diphos 2,bis diphos palladium 0,bis 1,2-bis diphenylphosphino ethane palladium,bis diphos palladium,bis 1,2-bis diphenylphosphino ethane-palladium 0,bis 1,2-bis diphenylphosphino ethane-palladium PubChem CID: 2724231 IUPAC Name: 2-diphenylphosphanylethyl(diphenyl)phosphane;palladium SMILES: [Pd].C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 2724231 |
|---|---|
| CAS | 31277-98-2 |
| Molecular Weight (g/mol) | 903.27 |
| MDL Number | MFCD00009880 |
| SMILES | [Pd].C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | bis 1,2-bis diphenylphosphino ethane palladium 0,pd dppe 2,pd diphos 2,bis diphos palladium 0,bis 1,2-bis diphenylphosphino ethane palladium,bis diphos palladium,bis 1,2-bis diphenylphosphino ethane-palladium 0,bis 1,2-bis diphenylphosphino ethane-palladium |
| IUPAC Name | 2-diphenylphosphanylethyl(diphenyl)phosphane;palladium |
| InChI Key | FAFGMAGIYHHRKN-UHFFFAOYSA-N |
| Molecular Formula | C52H48P4Pd |
Bis(3,5,3',5'-dimethoxydibenzylideneacetone)palladium(0), 97%
CAS: 811862-77-8 Molecular Formula: C42H44O10Pd Molecular Weight (g/mol): 815.22 MDL Number: MFCD07369799 InChI Key: RTGAJOPJZJDWAX-UHFFFAOYSA-N Synonym: bis 3,5,3',5'-dimethoxydibenzylideneacetone palladium 0,pd dmdba 2,bis 353'5'-dimethoxydibenzylideneace,bis 3,5,3',5'-dimethoxydibenzylideneacetone palladium PubChem CID: 24777333 SMILES: [Pd].COC1=CC(C=CC(=O)C=CC2=CC(OC)=CC(OC)=C2)=CC(OC)=C1.COC1=CC(C=CC(=O)C=CC2=CC(OC)=CC(OC)=C2)=CC(OC)=C1
| PubChem CID | 24777333 |
|---|---|
| CAS | 811862-77-8 |
| Molecular Weight (g/mol) | 815.22 |
| MDL Number | MFCD07369799 |
| SMILES | [Pd].COC1=CC(C=CC(=O)C=CC2=CC(OC)=CC(OC)=C2)=CC(OC)=C1.COC1=CC(C=CC(=O)C=CC2=CC(OC)=CC(OC)=C2)=CC(OC)=C1 |
| Synonym | bis 3,5,3',5'-dimethoxydibenzylideneacetone palladium 0,pd dmdba 2,bis 353'5'-dimethoxydibenzylideneace,bis 3,5,3',5'-dimethoxydibenzylideneacetone palladium |
| InChI Key | RTGAJOPJZJDWAX-UHFFFAOYSA-N |
| Molecular Formula | C42H44O10Pd |
Bis(tri-o-tolylphosphine)palladium(0), Pd 14.9%
CAS: 69861-71-8 Molecular Formula: C42H42P2Pd Molecular Weight (g/mol): 715.166 MDL Number: MFCD12911908 InChI Key: CUBIJGNGGJBNOC-UHFFFAOYSA-N Synonym: bis tri-o-tolylphosphine palladium 0,pd o-tol 3p 2,bis tris 2-methylphenyl phosphine palladium,bis tris 2-tolyl phosphine palladium,palladium, bis tris 2-methylphenyl phosphine,bis tris 2-methylphenyl phosphane palladium PubChem CID: 10952654 IUPAC Name: palladium;tris(2-methylphenyl)phosphane SMILES: CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.[Pd]
| PubChem CID | 10952654 |
|---|---|
| CAS | 69861-71-8 |
| Molecular Weight (g/mol) | 715.166 |
| MDL Number | MFCD12911908 |
| SMILES | CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.[Pd] |
| Synonym | bis tri-o-tolylphosphine palladium 0,pd o-tol 3p 2,bis tris 2-methylphenyl phosphine palladium,bis tris 2-tolyl phosphine palladium,palladium, bis tris 2-methylphenyl phosphine,bis tris 2-methylphenyl phosphane palladium |
| IUPAC Name | palladium;tris(2-methylphenyl)phosphane |
| InChI Key | CUBIJGNGGJBNOC-UHFFFAOYSA-N |
| Molecular Formula | C42H42P2Pd |
Bis(di-tert-butyl-phenylphosphine)palladium(0), 98%
CAS: 52359-17-8 Molecular Formula: C28H46P2Pd Molecular Weight (g/mol): 551.04 MDL Number: MFCD15071400 InChI Key: KJTQUBRAVOMHKY-UHFFFAOYSA-N Synonym: palladium, bis bis 1,1-dimethylethyl phenylphosphine,di-tert-butyl phenyl phosphane-palladium 2/1,bis di-tert-butyl phenyl phosphane palladium PubChem CID: 71365671 IUPAC Name: ditert-butyl(phenyl)phosphane;palladium SMILES: [Pd].CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C.CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C
| PubChem CID | 71365671 |
|---|---|
| CAS | 52359-17-8 |
| Molecular Weight (g/mol) | 551.04 |
| MDL Number | MFCD15071400 |
| SMILES | [Pd].CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C.CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C |
| Synonym | palladium, bis bis 1,1-dimethylethyl phenylphosphine,di-tert-butyl phenyl phosphane-palladium 2/1,bis di-tert-butyl phenyl phosphane palladium |
| IUPAC Name | ditert-butyl(phenyl)phosphane;palladium |
| InChI Key | KJTQUBRAVOMHKY-UHFFFAOYSA-N |
| Molecular Formula | C28H46P2Pd |
Tetrakis(triphenylphosphine)palladium(0), 99.8% (metals basis), Pd 9% min
CAS: 14221-01-3 Molecular Formula: C72H60P4Pd Molecular Weight (g/mol): 1155.59 MDL Number: MFCD00010012 InChI Key: NFHFRUOZVGFOOS-UHFFFAOYSA-N PubChem CID: 11979704 SMILES: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11979704 |
|---|---|
| CAS | 14221-01-3 |
| Molecular Weight (g/mol) | 1155.59 |
| MDL Number | MFCD00010012 |
| SMILES | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| InChI Key | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molecular Formula | C72H60P4Pd |
Bis[di-tert-butyl(4-dimethylaminophenyl)phosphine]palladium(0), Pd 16.7%
CAS: 1233717-68-4 Molecular Formula: C32H56N2P2Pd Molecular Weight (g/mol): 637.182 MDL Number: MFCD15071402 InChI Key: SSPOQURGNAWORH-UHFFFAOYSA-N Synonym: bis di-tert-butyl 4-dimethylaminophenyl phosphine palladium 0,bis 4-n,n-dimethylamino phenyl di-t-butylphosphino palladium 0,bis 4-di-tert-butylphosphanyl-n,n-dimethylaniline palladium PubChem CID: 46900632 IUPAC Name: 4-ditert-butylphosphanyl-N,N-dimethylaniline;palladium SMILES: CC(C)(C)P(C1=CC=C(C=C1)N(C)C)C(C)(C)C.CC(C)(C)P(C1=CC=C(C=C1)N(C)C)C(C)(C)C.[Pd]
| PubChem CID | 46900632 |
|---|---|
| CAS | 1233717-68-4 |
| Molecular Weight (g/mol) | 637.182 |
| MDL Number | MFCD15071402 |
| SMILES | CC(C)(C)P(C1=CC=C(C=C1)N(C)C)C(C)(C)C.CC(C)(C)P(C1=CC=C(C=C1)N(C)C)C(C)(C)C.[Pd] |
| Synonym | bis di-tert-butyl 4-dimethylaminophenyl phosphine palladium 0,bis 4-n,n-dimethylamino phenyl di-t-butylphosphino palladium 0,bis 4-di-tert-butylphosphanyl-n,n-dimethylaniline palladium |
| IUPAC Name | 4-ditert-butylphosphanyl-N,N-dimethylaniline;palladium |
| InChI Key | SSPOQURGNAWORH-UHFFFAOYSA-N |
| Molecular Formula | C32H56N2P2Pd |
Tetrakis(triphenylphosphine)palladium(0), TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| MDL Number | 3568 |
|---|