Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Acetic acid, glacial, 99+%
CAS: 64-19-7 Molecular Formula: C2H4O2 Molecular Weight (g/mol): 60.05 MDL Number: MFCD00036152 InChI Key: QTBSBXVTEAMEQO-UHFFFAOYSA-N Synonym: ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure PubChem CID: 176 ChEBI: CHEBI:15366 IUPAC Name: acetic acid SMILES: CC(O)=O
| PubChem CID | 176 |
|---|---|
| CAS | 64-19-7 |
| Molecular Weight (g/mol) | 60.05 |
| ChEBI | CHEBI:15366 |
| MDL Number | MFCD00036152 |
| SMILES | CC(O)=O |
| Synonym | ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure |
| IUPAC Name | acetic acid |
| InChI Key | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2 |
Acetic acid, ammonium salt, 98%, pure
CAS: 631-61-8 Molecular Formula: C2H7NO2 Molecular Weight (g/mol): 77.08 InChI Key: USFZMSVCRYTOJT-UHFFFAOYSA-N Synonym: ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 PubChem CID: 517165 ChEBI: CHEBI:62947 IUPAC Name: azanium;acetate SMILES: CC(=O)[O-].[NH4+]
| PubChem CID | 517165 |
|---|---|
| CAS | 631-61-8 |
| Molecular Weight (g/mol) | 77.08 |
| ChEBI | CHEBI:62947 |
| SMILES | CC(=O)[O-].[NH4+] |
| Synonym | ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 |
| IUPAC Name | azanium;acetate |
| InChI Key | USFZMSVCRYTOJT-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO2 |
Acetic acid, sodium salt, 99%, for HPLC, anhydrous
Greener Choice Product
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
CAS: 127-09-3 Molecular Formula: C2H3NaO2 Molecular Weight (g/mol): 82.03 MDL Number: MFCD00012459 InChI Key: VMHLLURERBWHNL-UHFFFAOYSA-M Synonym: sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech PubChem CID: 517045 ChEBI: CHEBI:32954 SMILES: [Na+].CC([O-])=O
| PubChem CID | 517045 |
|---|---|
| CAS | 127-09-3 |
| Molecular Weight (g/mol) | 82.03 |
| ChEBI | CHEBI:32954 |
| MDL Number | MFCD00012459 |
| SMILES | [Na+].CC([O-])=O |
| Synonym | sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech |
| InChI Key | VMHLLURERBWHNL-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO2 |
(Phenylsulfonyl)acetic acid, 97%
CAS: 3959-23-7 Molecular Formula: C8H8O4S Molecular Weight (g/mol): 200.208 MDL Number: MFCD00025042 InChI Key: YTEFAALYDTWTLB-UHFFFAOYSA-N Synonym: phenylsulfonyl acetic acid,2-phenylsulfonyl acetic acid,2-benzenesulfonyl acetic acid,phenylsulfonylacetic acid,acetic acid, phenylsulfonyl,benzenesulfonyl-acetic acid,benzenesulfonyl acetic acid,2-phenylsulphonyl acetic acid,benzenesulfonylacetic acid,phenyl sulfonylacetic acid PubChem CID: 59543 IUPAC Name: 2-(benzenesulfonyl)acetic acid SMILES: C1=CC=C(C=C1)S(=O)(=O)CC(=O)O
| PubChem CID | 59543 |
|---|---|
| CAS | 3959-23-7 |
| Molecular Weight (g/mol) | 200.208 |
| MDL Number | MFCD00025042 |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CC(=O)O |
| Synonym | phenylsulfonyl acetic acid,2-phenylsulfonyl acetic acid,2-benzenesulfonyl acetic acid,phenylsulfonylacetic acid,acetic acid, phenylsulfonyl,benzenesulfonyl-acetic acid,benzenesulfonyl acetic acid,2-phenylsulphonyl acetic acid,benzenesulfonylacetic acid,phenyl sulfonylacetic acid |
| IUPAC Name | 2-(benzenesulfonyl)acetic acid |
| InChI Key | YTEFAALYDTWTLB-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4S |
(Phenylthio)acetic acid, 97%
CAS: 103-04-8 Molecular Formula: C8H7O2S Molecular Weight (g/mol): 167.20 MDL Number: MFCD00004355 InChI Key: MOTOSAGBNXXRRE-UHFFFAOYSA-M Synonym: phenylthio acetic acid,thiophenoxyacetic acid,2-phenylthio acetic acid,phenylthioglycolic acid,phenylmercaptoacetic acid,2-phenylsulfanyl acetic acid,phenylsulfanyl acetic acid,acetic acid, phenylthio,phenylmercapto acetic acid,carboxymethyl phenyl sulfide PubChem CID: 59541 IUPAC Name: 2-phenylsulfanylacetic acid SMILES: [O-]C(=O)CSC1=CC=CC=C1
| PubChem CID | 59541 |
|---|---|
| CAS | 103-04-8 |
| Molecular Weight (g/mol) | 167.20 |
| MDL Number | MFCD00004355 |
| SMILES | [O-]C(=O)CSC1=CC=CC=C1 |
| Synonym | phenylthio acetic acid,thiophenoxyacetic acid,2-phenylthio acetic acid,phenylthioglycolic acid,phenylmercaptoacetic acid,2-phenylsulfanyl acetic acid,phenylsulfanyl acetic acid,acetic acid, phenylthio,phenylmercapto acetic acid,carboxymethyl phenyl sulfide |
| IUPAC Name | 2-phenylsulfanylacetic acid |
| InChI Key | MOTOSAGBNXXRRE-UHFFFAOYSA-M |
| Molecular Formula | C8H7O2S |
Indole-3-acetic acid, 98+%
CAS: 87-51-4 Molecular Formula: C10H9NO2 Molecular Weight (g/mol): 175.19 MDL Number: MFCD00005636 InChI Key: SEOVTRFCIGRIMH-UHFFFAOYSA-N Synonym: indole-3-acetic acid,3-indoleacetic acid,heteroauxin,indoleacetic acid,1h-indole-3-acetic acid,2-1h-indol-3-yl acetic acid,rhizopin,1h-indol-3-ylacetic acid,indol-3-ylacetic acid,rhizopon a PubChem CID: 802 ChEBI: CHEBI:16411 IUPAC Name: 2-(1H-indol-3-yl)acetic acid SMILES: OC(=O)CC1=CNC2=CC=CC=C12
| PubChem CID | 802 |
|---|---|
| CAS | 87-51-4 |
| Molecular Weight (g/mol) | 175.19 |
| ChEBI | CHEBI:16411 |
| MDL Number | MFCD00005636 |
| SMILES | OC(=O)CC1=CNC2=CC=CC=C12 |
| Synonym | indole-3-acetic acid,3-indoleacetic acid,heteroauxin,indoleacetic acid,1h-indole-3-acetic acid,2-1h-indol-3-yl acetic acid,rhizopin,1h-indol-3-ylacetic acid,indol-3-ylacetic acid,rhizopon a |
| IUPAC Name | 2-(1H-indol-3-yl)acetic acid |
| InChI Key | SEOVTRFCIGRIMH-UHFFFAOYSA-N |
| Molecular Formula | C10H9NO2 |
1H-Indole-3-acetic acid, 98%
CAS: 87-51-4 Molecular Formula: C10H9NO2 Molecular Weight (g/mol): 175.19 MDL Number: MFCD00005636 InChI Key: SEOVTRFCIGRIMH-UHFFFAOYSA-N Synonym: indole-3-acetic acid,3-indoleacetic acid,heteroauxin,indoleacetic acid,1h-indole-3-acetic acid,2-1h-indol-3-yl acetic acid,rhizopin,1h-indol-3-ylacetic acid,indol-3-ylacetic acid,rhizopon a PubChem CID: 802 ChEBI: CHEBI:16411 IUPAC Name: 2-(1H-indol-3-yl)acetic acid SMILES: OC(=O)CC1=CNC2=CC=CC=C12
| PubChem CID | 802 |
|---|---|
| CAS | 87-51-4 |
| Molecular Weight (g/mol) | 175.19 |
| ChEBI | CHEBI:16411 |
| MDL Number | MFCD00005636 |
| SMILES | OC(=O)CC1=CNC2=CC=CC=C12 |
| Synonym | indole-3-acetic acid,3-indoleacetic acid,heteroauxin,indoleacetic acid,1h-indole-3-acetic acid,2-1h-indol-3-yl acetic acid,rhizopin,1h-indol-3-ylacetic acid,indol-3-ylacetic acid,rhizopon a |
| IUPAC Name | 2-(1H-indol-3-yl)acetic acid |
| InChI Key | SEOVTRFCIGRIMH-UHFFFAOYSA-N |
| Molecular Formula | C10H9NO2 |
Fluorene-9-acetic acid, 99+%
CAS: 6284-80-6 Molecular Formula: C15H12O2 Molecular Weight (g/mol): 224.259 MDL Number: MFCD00013262 InChI Key: WFSMJMTYIMFHPV-UHFFFAOYSA-N Synonym: 9-fluoreneacetic acid,fluorene-9-acetic acid,9h-fluorene-9-acetic acid,2-9h-fluoren-9-yl acetic acid,9h-fluorene-9-aceticacid,9h-fluoren-9-ylacetic acid,chembl44381,2-fluoren-9-ylacetic acid,9-fluoreneacetate,9-fluorene acetic acid PubChem CID: 94852 IUPAC Name: 2-(9H-fluoren-9-yl)acetic acid SMILES: C1=CC=C2C(=C1)C(C3=CC=CC=C32)CC(=O)O
| PubChem CID | 94852 |
|---|---|
| CAS | 6284-80-6 |
| Molecular Weight (g/mol) | 224.259 |
| MDL Number | MFCD00013262 |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)CC(=O)O |
| Synonym | 9-fluoreneacetic acid,fluorene-9-acetic acid,9h-fluorene-9-acetic acid,2-9h-fluoren-9-yl acetic acid,9h-fluorene-9-aceticacid,9h-fluoren-9-ylacetic acid,chembl44381,2-fluoren-9-ylacetic acid,9-fluoreneacetate,9-fluorene acetic acid |
| IUPAC Name | 2-(9H-fluoren-9-yl)acetic acid |
| InChI Key | WFSMJMTYIMFHPV-UHFFFAOYSA-N |
| Molecular Formula | C15H12O2 |
(Boc-aminooxy)acetic acid, 98+%
CAS: 42989-85-5 Molecular Formula: C7H13NO5 Molecular Weight (g/mol): 191.183 MDL Number: MFCD01632027 InChI Key: QBXODCKYUZNZCY-UHFFFAOYSA-N Synonym: boc-aminooxy acetic acid,2-tert-butoxycarbonyl amino oxy acetic acid,boc-aoa-oh,boc-aminooxyacetic acid,boc-aoac-oh,n-boc-carboxymethoxy amine,boc-aminooxy aceticacid,2-tert-butoxy carbonyl amino oxy acetic acid,2-2-methylpropan-2-yl oxycarbonylamino oxyacetic acid,tert-butoxycarbonyl aminooxy acetic acid PubChem CID: 2755974 IUPAC Name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetic acid SMILES: CC(C)(C)OC(=O)NOCC(=O)O
| PubChem CID | 2755974 |
|---|---|
| CAS | 42989-85-5 |
| Molecular Weight (g/mol) | 191.183 |
| MDL Number | MFCD01632027 |
| SMILES | CC(C)(C)OC(=O)NOCC(=O)O |
| Synonym | boc-aminooxy acetic acid,2-tert-butoxycarbonyl amino oxy acetic acid,boc-aoa-oh,boc-aminooxyacetic acid,boc-aoac-oh,n-boc-carboxymethoxy amine,boc-aminooxy aceticacid,2-tert-butoxy carbonyl amino oxy acetic acid,2-2-methylpropan-2-yl oxycarbonylamino oxyacetic acid,tert-butoxycarbonyl aminooxy acetic acid |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetic acid |
| InChI Key | QBXODCKYUZNZCY-UHFFFAOYSA-N |
| Molecular Formula | C7H13NO5 |
(3,4-Dimethoxyphenyl)acetic acid, 99%
CAS: 93-40-3 Molecular Formula: C10H12O4 Molecular Weight (g/mol): 196.2 MDL Number: MFCD00004335 InChI Key: WUAXWQRULBZETB-UHFFFAOYSA-N Synonym: homoveratric acid,3,4-dimethoxyphenylacetic acid,3,4-dimethoxyphenyl acetic acid,2-3,4-dimethoxyphenyl acetic acid,benzeneacetic acid, 3,4-dimethoxy,3,4-dimethoxybenzeneacetic acid,3,4-dimethoxy-phenyl-acetic acid,acetic acid, 3,4-dimethoxyphenyl PubChem CID: 7139 ChEBI: CHEBI:86655 IUPAC Name: 2-(3,4-dimethoxyphenyl)acetic acid SMILES: COC1=C(C=C(C=C1)CC(=O)O)OC
| PubChem CID | 7139 |
|---|---|
| CAS | 93-40-3 |
| Molecular Weight (g/mol) | 196.2 |
| ChEBI | CHEBI:86655 |
| MDL Number | MFCD00004335 |
| SMILES | COC1=C(C=C(C=C1)CC(=O)O)OC |
| Synonym | homoveratric acid,3,4-dimethoxyphenylacetic acid,3,4-dimethoxyphenyl acetic acid,2-3,4-dimethoxyphenyl acetic acid,benzeneacetic acid, 3,4-dimethoxy,3,4-dimethoxybenzeneacetic acid,3,4-dimethoxy-phenyl-acetic acid,acetic acid, 3,4-dimethoxyphenyl |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)acetic acid |
| InChI Key | WUAXWQRULBZETB-UHFFFAOYSA-N |
| Molecular Formula | C10H12O4 |
7-Methoxycoumarin-4-acetic acid
CAS: 62935-72-2 Molecular Formula: C12H10O5 Molecular Weight (g/mol): 234.21 MDL Number: MFCD00009774 InChI Key: ZEKAXIFHLIITGV-UHFFFAOYSA-N Synonym: 7-methoxycoumarin-4-acetic acid,2-7-methoxy-2-oxo-2h-chromen-4-yl acetic acid,7-methoxy-2-oxo-2h-chromen-4-yl acetic acid,7-methoxy-2-oxo-2h-1-benzopyran-4-acetic acid,2h-1-benzopyran-4-acetic acid, 7-methoxy-2-oxo,2-7-methoxy-2-oxochromen-4-yl acetic acid,7-methoxy-2-oxo-2h-chromen-4-yl-acetic acid,7-methoxycoumarin-4-yl acetic acid,7-methoxy-2-oxochromen-4-yl acetic acid,mca-oh PubChem CID: 342221 ChEBI: CHEBI:51666 IUPAC Name: 2-(7-methoxy-2-oxochromen-4-yl)acetic acid SMILES: COC1=CC=C2C(CC(O)=O)=CC(=O)OC2=C1
| PubChem CID | 342221 |
|---|---|
| CAS | 62935-72-2 |
| Molecular Weight (g/mol) | 234.21 |
| ChEBI | CHEBI:51666 |
| MDL Number | MFCD00009774 |
| SMILES | COC1=CC=C2C(CC(O)=O)=CC(=O)OC2=C1 |
| Synonym | 7-methoxycoumarin-4-acetic acid,2-7-methoxy-2-oxo-2h-chromen-4-yl acetic acid,7-methoxy-2-oxo-2h-chromen-4-yl acetic acid,7-methoxy-2-oxo-2h-1-benzopyran-4-acetic acid,2h-1-benzopyran-4-acetic acid, 7-methoxy-2-oxo,2-7-methoxy-2-oxochromen-4-yl acetic acid,7-methoxy-2-oxo-2h-chromen-4-yl-acetic acid,7-methoxycoumarin-4-yl acetic acid,7-methoxy-2-oxochromen-4-yl acetic acid,mca-oh |
| IUPAC Name | 2-(7-methoxy-2-oxochromen-4-yl)acetic acid |
| InChI Key | ZEKAXIFHLIITGV-UHFFFAOYSA-N |
| Molecular Formula | C12H10O5 |
(4-Chlorophenylthio)acetic acid, 98%
CAS: 3405-88-7 Molecular Formula: C8H7ClO2S Molecular Weight (g/mol): 202.652 MDL Number: MFCD00021762 InChI Key: YPKLXLYGMAWXDO-UHFFFAOYSA-N Synonym: 4-chlorophenylthio acetic acid,2-4-chlorophenyl thio acetic acid,4-chlorophenyl thio acetic acid,p-chlorophenylmercaptoacetic acid,2-4-chlorophenyl sulfanyl acetic acid,2-p-chlorophenylthio acetic acid,p-chlorophenylthioacetic acid,4-chlorophenyl sulfanyl acetic acid,acetic acid, p-chlorophenyl thio,acetic acid, 4-chlorophenyl thio PubChem CID: 55471 IUPAC Name: 2-(4-chlorophenyl)sulfanylacetic acid SMILES: C1=CC(=CC=C1SCC(=O)O)Cl
| PubChem CID | 55471 |
|---|---|
| CAS | 3405-88-7 |
| Molecular Weight (g/mol) | 202.652 |
| MDL Number | MFCD00021762 |
| SMILES | C1=CC(=CC=C1SCC(=O)O)Cl |
| Synonym | 4-chlorophenylthio acetic acid,2-4-chlorophenyl thio acetic acid,4-chlorophenyl thio acetic acid,p-chlorophenylmercaptoacetic acid,2-4-chlorophenyl sulfanyl acetic acid,2-p-chlorophenylthio acetic acid,p-chlorophenylthioacetic acid,4-chlorophenyl sulfanyl acetic acid,acetic acid, p-chlorophenyl thio,acetic acid, 4-chlorophenyl thio |
| IUPAC Name | 2-(4-chlorophenyl)sulfanylacetic acid |
| InChI Key | YPKLXLYGMAWXDO-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO2S |
(4-Fluorophenylthio)acetic acid, 97%
CAS: 332-51-4 Molecular Formula: C8H7FO2S Molecular Weight (g/mol): 186.2 MDL Number: MFCD00219825 InChI Key: HQEROVXUKINLPI-UHFFFAOYSA-N Synonym: 4-fluorophenylthio acetic acid,2-4-fluorophenylthio acetic acid,2-4-fluorophenyl thio acetic acid,4-fluorophenyl thio acetic acid,4-fluorophenyl sulfanyl acetic acid,maybridge1_004918,acmc-20apn5,4-fluoro-phenylsulfanyl-acetic acid,2-4-fluorophenyl sulfanylacetic acid PubChem CID: 736197 IUPAC Name: 2-(4-fluorophenyl)sulfanylacetic acid SMILES: C1=CC(=CC=C1F)SCC(=O)O
| PubChem CID | 736197 |
|---|---|
| CAS | 332-51-4 |
| Molecular Weight (g/mol) | 186.2 |
| MDL Number | MFCD00219825 |
| SMILES | C1=CC(=CC=C1F)SCC(=O)O |
| Synonym | 4-fluorophenylthio acetic acid,2-4-fluorophenylthio acetic acid,2-4-fluorophenyl thio acetic acid,4-fluorophenyl thio acetic acid,4-fluorophenyl sulfanyl acetic acid,maybridge1_004918,acmc-20apn5,4-fluoro-phenylsulfanyl-acetic acid,2-4-fluorophenyl sulfanylacetic acid |
| IUPAC Name | 2-(4-fluorophenyl)sulfanylacetic acid |
| InChI Key | HQEROVXUKINLPI-UHFFFAOYSA-N |
| Molecular Formula | C8H7FO2S |
(BOC-aminooxy)acetic acid, 98%
CAS: 42989-85-5 Molecular Formula: C7H13NO5 Molecular Weight (g/mol): 191.19 MDL Number: MFCD01632027 InChI Key: QBXODCKYUZNZCY-UHFFFAOYSA-N Synonym: boc-aminooxy acetic acid,2-tert-butoxycarbonyl amino oxy acetic acid,boc-aoa-oh,boc-aminooxyacetic acid,boc-aoac-oh,n-boc-carboxymethoxy amine,boc-aminooxy aceticacid,2-tert-butoxy carbonyl amino oxy acetic acid,2-2-methylpropan-2-yl oxycarbonylamino oxyacetic acid,tert-butoxycarbonyl aminooxy acetic acid PubChem CID: 2755974 IUPAC Name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetic acid SMILES: CC(C)(C)OC(=O)NOCC(=O)O
| PubChem CID | 2755974 |
|---|---|
| CAS | 42989-85-5 |
| Molecular Weight (g/mol) | 191.19 |
| MDL Number | MFCD01632027 |
| SMILES | CC(C)(C)OC(=O)NOCC(=O)O |
| Synonym | boc-aminooxy acetic acid,2-tert-butoxycarbonyl amino oxy acetic acid,boc-aoa-oh,boc-aminooxyacetic acid,boc-aoac-oh,n-boc-carboxymethoxy amine,boc-aminooxy aceticacid,2-tert-butoxy carbonyl amino oxy acetic acid,2-2-methylpropan-2-yl oxycarbonylamino oxyacetic acid,tert-butoxycarbonyl aminooxy acetic acid |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetic acid |
| InChI Key | QBXODCKYUZNZCY-UHFFFAOYSA-N |
| Molecular Formula | C7H13NO5 |
1-Cyclohexene-1-acetic acid
CAS: 18294-87-6 Molecular Formula: C8H12O2 Molecular Weight (g/mol): 140.182 MDL Number: MFCD00015482 InChI Key: KDFBPHXESBPHTK-UHFFFAOYSA-N Synonym: 1-cyclohexenylacetic acid,1-cyclohexene-1-acetic acid,2-cyclohex-1-en-1-yl acetic acid,cyclohex-1-enylacetic acid,1-cyclohexene-1-aceticacid,2-cyclohexen-1-yl acetic acid,2-cyclohex-1-enylacetic acid,cyclohex-1-en-1-ylacetic acid,1-cyclohexenylacetate,cyclohexenylacetic acid PubChem CID: 86699 IUPAC Name: 2-(cyclohexen-1-yl)acetic acid SMILES: C1CCC(=CC1)CC(=O)O
| PubChem CID | 86699 |
|---|---|
| CAS | 18294-87-6 |
| Molecular Weight (g/mol) | 140.182 |
| MDL Number | MFCD00015482 |
| SMILES | C1CCC(=CC1)CC(=O)O |
| Synonym | 1-cyclohexenylacetic acid,1-cyclohexene-1-acetic acid,2-cyclohex-1-en-1-yl acetic acid,cyclohex-1-enylacetic acid,1-cyclohexene-1-aceticacid,2-cyclohexen-1-yl acetic acid,2-cyclohex-1-enylacetic acid,cyclohex-1-en-1-ylacetic acid,1-cyclohexenylacetate,cyclohexenylacetic acid |
| IUPAC Name | 2-(cyclohexen-1-yl)acetic acid |
| InChI Key | KDFBPHXESBPHTK-UHFFFAOYSA-N |
| Molecular Formula | C8H12O2 |