Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Magnesium sulfate, anhydrous, 99.5% min
CAS: 7487-88-9 Molecular Formula: MgO4S Molecular Weight (g/mol): 120.36 MDL Number: MFCD00011110 InChI Key: CSNNHWWHGAXBCP-UHFFFAOYSA-L Synonym: magnesium sulfate,magnesium sulphate,magnesium sulfate anhydrous,sulfuric acid magnesium salt 1:1,bitter salt,sal angalis,magnesium sulfate 1:1,mgso4,sal de sedlitz,tomix ot PubChem CID: 24083 ChEBI: CHEBI:32599 SMILES: [Mg++].[O-]S([O-])(=O)=O
| PubChem CID | 24083 |
|---|---|
| CAS | 7487-88-9 |
| Molecular Weight (g/mol) | 120.36 |
| ChEBI | CHEBI:32599 |
| MDL Number | MFCD00011110 |
| SMILES | [Mg++].[O-]S([O-])(=O)=O |
| Synonym | magnesium sulfate,magnesium sulphate,magnesium sulfate anhydrous,sulfuric acid magnesium salt 1:1,bitter salt,sal angalis,magnesium sulfate 1:1,mgso4,sal de sedlitz,tomix ot |
| InChI Key | CSNNHWWHGAXBCP-UHFFFAOYSA-L |
| Molecular Formula | MgO4S |
Sodium thiosulfate pentahydrate, 99+%
CAS: 10102-17-7 Molecular Formula: H10Na2O8S2 Molecular Weight (g/mol): 248.172 MDL Number: MFCD00149186 InChI Key: PODWXQQNRWNDGD-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane;pentahydrate SMILES: O.O.O.O.O.[O-]S(=O)(=S)[O-].[Na+].[Na+]
| PubChem CID | 61475 |
|---|---|
| CAS | 10102-17-7 |
| Molecular Weight (g/mol) | 248.172 |
| ChEBI | CHEBI:32150 |
| MDL Number | MFCD00149186 |
| SMILES | O.O.O.O.O.[O-]S(=O)(=S)[O-].[Na+].[Na+] |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane;pentahydrate |
| InChI Key | PODWXQQNRWNDGD-UHFFFAOYSA-L |
| Molecular Formula | H10Na2O8S2 |
Iron(II) sulfate heptahydrate, 98%
CAS: 7782-63-0 Molecular Formula: FeH14O11S Molecular Weight (g/mol): 278.01 MDL Number: MFCD00149719 InChI Key: SURQXAFEQWPFPV-UHFFFAOYSA-L Synonym: iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate PubChem CID: 62662 ChEBI: CHEBI:75836 SMILES: O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O
| PubChem CID | 62662 |
|---|---|
| CAS | 7782-63-0 |
| Molecular Weight (g/mol) | 278.01 |
| ChEBI | CHEBI:75836 |
| MDL Number | MFCD00149719 |
| SMILES | O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O |
| Synonym | iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate |
| InChI Key | SURQXAFEQWPFPV-UHFFFAOYSA-L |
| Molecular Formula | FeH14O11S |
Copper turnings, 99+% (metals basis)
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Potassium hydrogen phthalate, primary standard, ACS, 99.95-100.05%
CAS: 877-24-7 Molecular Formula: C8H5KO4 Molecular Weight (g/mol): 204.222 MDL Number: MFCD00013070 InChI Key: IWZKICVEHNUQTL-UHFFFAOYSA-M Synonym: potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic PubChem CID: 23676735 IUPAC Name: potassium;2-carboxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+]
| PubChem CID | 23676735 |
|---|---|
| CAS | 877-24-7 |
| Molecular Weight (g/mol) | 204.222 |
| MDL Number | MFCD00013070 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| Synonym | potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic |
| IUPAC Name | potassium;2-carboxybenzoate |
| InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
| Molecular Formula | C8H5KO4 |
Soda lime, indicator grade
CAS: 8006-28-8 Molecular Formula: CaHNaO2 Molecular Weight (g/mol): 96.074 MDL Number: MFCD00134094 InChI Key: HUAUNKAZQWMVFY-UHFFFAOYSA-M Synonym: soda lime,soda-lime,sodasorb,soda lime nf,sodium hydroxide na oh , mixt. with lime,soda-lime, granular,soda lime, indicating,soda lime, indicator grade,soda lime with sodium hydroxide,soda lime, indicating 8-12 mesh PubChem CID: 66545795 IUPAC Name: sodium;oxocalcium;hydroxide SMILES: [OH-].O=[Ca].[Na+]
| PubChem CID | 66545795 |
|---|---|
| CAS | 8006-28-8 |
| Molecular Weight (g/mol) | 96.074 |
| MDL Number | MFCD00134094 |
| SMILES | [OH-].O=[Ca].[Na+] |
| Synonym | soda lime,soda-lime,sodasorb,soda lime nf,sodium hydroxide na oh , mixt. with lime,soda-lime, granular,soda lime, indicating,soda lime, indicator grade,soda lime with sodium hydroxide,soda lime, indicating 8-12 mesh |
| IUPAC Name | sodium;oxocalcium;hydroxide |
| InChI Key | HUAUNKAZQWMVFY-UHFFFAOYSA-M |
| Molecular Formula | CaHNaO2 |
Ammonium molybdate (para) tetrahydrate, 99%
CAS: 12054-85-2 Molecular Formula: (NH4)6Mo7O24·4H2O MDL Number: MFCD00167059 Synonym: Ammonium heptamolybdate tetrahydrate; Ammonium paramolybdate tetrahydrate
| CAS | 12054-85-2 |
|---|---|
| MDL Number | MFCD00167059 |
| Synonym | Ammonium heptamolybdate tetrahydrate; Ammonium paramolybdate tetrahydrate |
| Molecular Formula | (NH4)6Mo7O24·4H2O |
Sodium hydrogen phosphate, 98+%
CAS: 7558-79-4 Molecular Formula: HNa2O4P Molecular Weight (g/mol): 141.96 MDL Number: MFCD00003496 InChI Key: BNIILDVGGAEEIG-UHFFFAOYSA-L Synonym: disodium hydrogen phosphate,disodium phosphate,disodium hydrogenorthophosphate,sodium phosphate dibasic,dibasic sodium phosphate,acetest,soda phosphate,disodium orthophosphate,sodium hydrogen phosphate,phosphoric acid, disodium salt PubChem CID: 24203 ChEBI: CHEBI:34683 SMILES: [Na+].[Na+].OP([O-])([O-])=O
| PubChem CID | 24203 |
|---|---|
| CAS | 7558-79-4 |
| Molecular Weight (g/mol) | 141.96 |
| ChEBI | CHEBI:34683 |
| MDL Number | MFCD00003496 |
| SMILES | [Na+].[Na+].OP([O-])([O-])=O |
| Synonym | disodium hydrogen phosphate,disodium phosphate,disodium hydrogenorthophosphate,sodium phosphate dibasic,dibasic sodium phosphate,acetest,soda phosphate,disodium orthophosphate,sodium hydrogen phosphate,phosphoric acid, disodium salt |
| InChI Key | BNIILDVGGAEEIG-UHFFFAOYSA-L |
| Molecular Formula | HNa2O4P |
Ammonium chloride, 98+%
CAS: 12125-02-9 Molecular Formula: ClH4N Molecular Weight (g/mol): 53.49 MDL Number: MFCD00011420 InChI Key: NLXLAEXVIDQMFP-UHFFFAOYSA-N Synonym: ammonium chloride,salmiac,sal ammoniac,ammonium muriate,ammoniumchlorid,ammoneric,darammon,amchlor,ammonium chloride nh4 cl,ammoniumklorid PubChem CID: 25517 ChEBI: CHEBI:31206 SMILES: N.Cl
| PubChem CID | 25517 |
|---|---|
| CAS | 12125-02-9 |
| Molecular Weight (g/mol) | 53.49 |
| ChEBI | CHEBI:31206 |
| MDL Number | MFCD00011420 |
| SMILES | N.Cl |
| Synonym | ammonium chloride,salmiac,sal ammoniac,ammonium muriate,ammoniumchlorid,ammoneric,darammon,amchlor,ammonium chloride nh4 cl,ammoniumklorid |
| InChI Key | NLXLAEXVIDQMFP-UHFFFAOYSA-N |
| Molecular Formula | ClH4N |
Calcium hydroxide, 95%
CAS: 1305-62-0 Molecular Formula: CaH2O2 Molecular Weight (g/mol): 74.09 MDL Number: MFCD00010901 InChI Key: AXCZMVOFGPJBDE-UHFFFAOYSA-L Synonym: calcium hydroxide,slaked lime,hydrated lime,calcium dihydroxide,calcium ii hydroxide,calcium oxide, hydrated,kalziumhydroxid,loeschkalk,pickling lime,calciumdihydroxid PubChem CID: 6093208 ChEBI: CHEBI:31341 IUPAC Name: calcium;dihydroxide SMILES: [OH-].[OH-].[Ca++]
| PubChem CID | 6093208 |
|---|---|
| CAS | 1305-62-0 |
| Molecular Weight (g/mol) | 74.09 |
| ChEBI | CHEBI:31341 |
| MDL Number | MFCD00010901 |
| SMILES | [OH-].[OH-].[Ca++] |
| Synonym | calcium hydroxide,slaked lime,hydrated lime,calcium dihydroxide,calcium ii hydroxide,calcium oxide, hydrated,kalziumhydroxid,loeschkalk,pickling lime,calciumdihydroxid |
| IUPAC Name | calcium;dihydroxide |
| InChI Key | AXCZMVOFGPJBDE-UHFFFAOYSA-L |
| Molecular Formula | CaH2O2 |
Sodium pyrophosphate, 98%
CAS: 7722-88-5 Molecular Formula: Na4O7P2 Molecular Weight (g/mol): 265.90 MDL Number: MFCD00003513 InChI Key: FQENQNTWSFEDLI-UHFFFAOYSA-J Synonym: tetrasodium pyrophosphate,sodium pyrophosphate,tspp,phosphotex,tetrasodium diphosphate,diphosphoric acid, tetrasodium salt,sodium diphosphate,victor tspp,natrium pyrophosphat,caswell no. 847 PubChem CID: 24403 ChEBI: CHEBI:71240 IUPAC Name: tetrasodium;phosphonato phosphate SMILES: [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O
| PubChem CID | 24403 |
|---|---|
| CAS | 7722-88-5 |
| Molecular Weight (g/mol) | 265.90 |
| ChEBI | CHEBI:71240 |
| MDL Number | MFCD00003513 |
| SMILES | [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O |
| Synonym | tetrasodium pyrophosphate,sodium pyrophosphate,tspp,phosphotex,tetrasodium diphosphate,diphosphoric acid, tetrasodium salt,sodium diphosphate,victor tspp,natrium pyrophosphat,caswell no. 847 |
| IUPAC Name | tetrasodium;phosphonato phosphate |
| InChI Key | FQENQNTWSFEDLI-UHFFFAOYSA-J |
| Molecular Formula | Na4O7P2 |
| Percent Purity | 97% |
|---|---|
| CAS | 7778-53-2 |
| Physical Form | Solid |
| Synonym | Potassium phosphate, tribasic;Tripotassium phosphate |
| Molecular Formula | K{3}O{4}P |
| Melting Point | 1340°C |
Calcium chloride, 1M aq. soln.
CAS: 10043-52-4 Molecular Formula: CaCl2 Molecular Weight (g/mol): 110.98 MDL Number: MFCD00010903 InChI Key: UXVMQQNJUSDDNG-UHFFFAOYSA-L Synonym: calcium chloride,calcium dichloride,calcium chloride anhydrous,calcium ii chloride,calciumchloride,caloride,liquical,calcium chloride pellets,isocal,jarcal PubChem CID: 5284359 ChEBI: CHEBI:3312 IUPAC Name: calcium dichloride SMILES: [Cl-].[Cl-].[Ca++]
| PubChem CID | 5284359 |
|---|---|
| CAS | 10043-52-4 |
| Molecular Weight (g/mol) | 110.98 |
| ChEBI | CHEBI:3312 |
| MDL Number | MFCD00010903 |
| SMILES | [Cl-].[Cl-].[Ca++] |
| Synonym | calcium chloride,calcium dichloride,calcium chloride anhydrous,calcium ii chloride,calciumchloride,caloride,liquical,calcium chloride pellets,isocal,jarcal |
| IUPAC Name | calcium dichloride |
| InChI Key | UXVMQQNJUSDDNG-UHFFFAOYSA-L |
| Molecular Formula | CaCl2 |
Ammonium bromide, 99%
CAS: 12124-97-9 Molecular Formula: BrH4N Molecular Weight (g/mol): 97.94 MDL Number: MFCD00011419 InChI Key: SWLVFNYSXGMGBS-UHFFFAOYSA-N IUPAC Name: ammonium bromide SMILES: [NH4+].[Br-]
| CAS | 12124-97-9 |
|---|---|
| Molecular Weight (g/mol) | 97.94 |
| MDL Number | MFCD00011419 |
| SMILES | [NH4+].[Br-] |
| IUPAC Name | ammonium bromide |
| InChI Key | SWLVFNYSXGMGBS-UHFFFAOYSA-N |
| Molecular Formula | BrH4N |