Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
| CAS | 9000-01-5 |
|---|---|
| MDL Number | MFCD00081264 |
| Synonym | Acacia |
Cyclohexyl Bromide, 99%
CAS: 108-85-0 Molecular Formula: C6H11Br Molecular Weight (g/mol): 163.06 MDL Number: MFCD00003819 InChI Key: AQNQQHJNRPDOQV-UHFFFAOYSA-N Synonym: cyclohexyl bromide,cyclohexane, bromo,1-bromocyclohexane,unii-ya0ums4rny,bromo-cyclohexane,ya0ums4rny,cyclohexylbromide,bromocylcohexane,bromocyclohexane,ksc178g7n PubChem CID: 7960 IUPAC Name: bromocyclohexane SMILES: BrC1CCCCC1
| PubChem CID | 7960 |
|---|---|
| CAS | 108-85-0 |
| Molecular Weight (g/mol) | 163.06 |
| MDL Number | MFCD00003819 |
| SMILES | BrC1CCCCC1 |
| Synonym | cyclohexyl bromide,cyclohexane, bromo,1-bromocyclohexane,unii-ya0ums4rny,bromo-cyclohexane,ya0ums4rny,cyclohexylbromide,bromocylcohexane,bromocyclohexane,ksc178g7n |
| IUPAC Name | bromocyclohexane |
| InChI Key | AQNQQHJNRPDOQV-UHFFFAOYSA-N |
| Molecular Formula | C6H11Br |
N-Acryloxysuccinimide, 99%
CAS: 38862-24-7 Molecular Formula: C7H7NO4 Molecular Weight (g/mol): 169.14 MDL Number: MFCD00078261 InChI Key: YXMISKNUHHOXFT-UHFFFAOYSA-N Synonym: 2,5-dioxopyrrolidin-1-yl acrylate,n-acryloxysuccinimide,n-succinimidyl acrylate,acrylic acid n-hydroxysuccinimide ester,1-acryloyloxy-2,5-pyrrolidinedione,n-acryloyloxysuccinimide,2,5-pyrrolidinedione, 1-1-oxo-2-propenyl oxy,2,5-dioxopyrrolidin-1-yl prop-2-enoate,poly n-acryloxysuccinimide PubChem CID: 181508 IUPAC Name: (2,5-dioxopyrrolidin-1-yl) prop-2-enoate SMILES: C=CC(=O)ON1C(=O)CCC1=O
| PubChem CID | 181508 |
|---|---|
| CAS | 38862-24-7 |
| Molecular Weight (g/mol) | 169.14 |
| MDL Number | MFCD00078261 |
| SMILES | C=CC(=O)ON1C(=O)CCC1=O |
| Synonym | 2,5-dioxopyrrolidin-1-yl acrylate,n-acryloxysuccinimide,n-succinimidyl acrylate,acrylic acid n-hydroxysuccinimide ester,1-acryloyloxy-2,5-pyrrolidinedione,n-acryloyloxysuccinimide,2,5-pyrrolidinedione, 1-1-oxo-2-propenyl oxy,2,5-dioxopyrrolidin-1-yl prop-2-enoate,poly n-acryloxysuccinimide |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) prop-2-enoate |
| InChI Key | YXMISKNUHHOXFT-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO4 |
4-Aminobenzoic acid, 99%
CAS: 150-13-0 Molecular Formula: C7H7NO2 Molecular Weight (g/mol): 137.14 MDL Number: MFCD00007894 InChI Key: ALYNCZNDIQEVRV-UHFFFAOYSA-N Synonym: p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino PubChem CID: 978 ChEBI: CHEBI:30753 IUPAC Name: 4-aminobenzoic acid SMILES: NC1=CC=C(C=C1)C(O)=O
| PubChem CID | 978 |
|---|---|
| CAS | 150-13-0 |
| Molecular Weight (g/mol) | 137.14 |
| ChEBI | CHEBI:30753 |
| MDL Number | MFCD00007894 |
| SMILES | NC1=CC=C(C=C1)C(O)=O |
| Synonym | p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino |
| IUPAC Name | 4-aminobenzoic acid |
| InChI Key | ALYNCZNDIQEVRV-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO2 |
2-Iminothiolane Hydrochloride, 98%
CAS: 4781-83-3 Molecular Formula: C4H7NS·ClH Molecular Weight (g/mol): 137.63 InChI Key: ATGUDZODTABURZ-UHFFFAOYSA-N Synonym: 2-iminothiolane hydrochloride,2-iminothiolane hcl,thiolan-2-imine hydrochloride,dihydrothiophen-2 3h-imine hydrochloride,2 3h-thiophenimine, dihydro-, hydrochloride,traut's reagent,c4h7ns.clh,traut eo 1/4 a,2-thiolanimine hydrochloride,2 3h-thiophenimine, hydrochloride PubChem CID: 13166855 IUPAC Name: thiolan-2-imine;hydrochloride SMILES: C1CC(=N)SC1.Cl
| PubChem CID | 13166855 |
|---|---|
| CAS | 4781-83-3 |
| Molecular Weight (g/mol) | 137.63 |
| SMILES | C1CC(=N)SC1.Cl |
| Synonym | 2-iminothiolane hydrochloride,2-iminothiolane hcl,thiolan-2-imine hydrochloride,dihydrothiophen-2 3h-imine hydrochloride,2 3h-thiophenimine, dihydro-, hydrochloride,traut's reagent,c4h7ns.clh,traut eo 1/4 a,2-thiolanimine hydrochloride,2 3h-thiophenimine, hydrochloride |
| IUPAC Name | thiolan-2-imine;hydrochloride |
| InChI Key | ATGUDZODTABURZ-UHFFFAOYSA-N |
| Molecular Formula | C4H7NS·ClH |
Benzophenone, 99%, pure
CAS: 119-61-9 Molecular Formula: C13H10O Molecular Weight (g/mol): 182.22 InChI Key: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC Name: diphenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| PubChem CID | 3102 |
|---|---|
| CAS | 119-61-9 |
| Molecular Weight (g/mol) | 182.22 |
| ChEBI | CHEBI:41308 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| IUPAC Name | diphenylmethanone |
| InChI Key | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| Molecular Formula | C13H10O |
Choline Chloride, 99%
CAS: 67-48-1 Molecular Formula: C5H14ClNO Molecular Weight (g/mol): 139.62 MDL Number: MFCD00011721 InChI Key: SGMZJAMFUVOLNK-UHFFFAOYSA-M Synonym: choline chloride,hepacholine,biocolina,biocoline,lipotril,paresan,luridin chloride,choline hydrochloride,cholinium chloride,bilineurin chloride PubChem CID: 6209 ChEBI: CHEBI:133341 IUPAC Name: 2-hydroxyethyl(trimethyl)azanium;chloride SMILES: [Cl-].C[N+](C)(C)CCO
| PubChem CID | 6209 |
|---|---|
| CAS | 67-48-1 |
| Molecular Weight (g/mol) | 139.62 |
| ChEBI | CHEBI:133341 |
| MDL Number | MFCD00011721 |
| SMILES | [Cl-].C[N+](C)(C)CCO |
| Synonym | choline chloride,hepacholine,biocolina,biocoline,lipotril,paresan,luridin chloride,choline hydrochloride,cholinium chloride,bilineurin chloride |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;chloride |
| InChI Key | SGMZJAMFUVOLNK-UHFFFAOYSA-M |
| Molecular Formula | C5H14ClNO |
Antipyrine, 99%
CAS: 60-80-0 Molecular Formula: C11H12N2O Molecular Weight (g/mol): 188.23 MDL Number: MFCD00003146 InChI Key: VEQOALNAAJBPNY-UHFFFAOYSA-N Synonym: antipyrine,phenazone,antipyrin,phenazon,analgesine,anodynine,anodynin,azophen,fenazone,2,3-dimethyl-1-phenyl-5-pyrazolone PubChem CID: 2206 ChEBI: CHEBI:31225 IUPAC Name: 1,5-dimethyl-2-phenylpyrazol-3-one SMILES: CC1=CC(=O)N(N1C)C2=CC=CC=C2
| PubChem CID | 2206 |
|---|---|
| CAS | 60-80-0 |
| Molecular Weight (g/mol) | 188.23 |
| ChEBI | CHEBI:31225 |
| MDL Number | MFCD00003146 |
| SMILES | CC1=CC(=O)N(N1C)C2=CC=CC=C2 |
| Synonym | antipyrine,phenazone,antipyrin,phenazon,analgesine,anodynine,anodynin,azophen,fenazone,2,3-dimethyl-1-phenyl-5-pyrazolone |
| IUPAC Name | 1,5-dimethyl-2-phenylpyrazol-3-one |
| InChI Key | VEQOALNAAJBPNY-UHFFFAOYSA-N |
| Molecular Formula | C11H12N2O |
Benzoic acid, 99.6%, ACS reagent
CAS: 65-85-0 Molecular Formula: C7H6O2 Molecular Weight (g/mol): 122.12 InChI Key: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC Name: benzoic acid SMILES: C1=CC=C(C=C1)C(=O)O
| PubChem CID | 243 |
|---|---|
| CAS | 65-85-0 |
| Molecular Weight (g/mol) | 122.12 |
| ChEBI | CHEBI:30746 |
| SMILES | C1=CC=C(C=C1)C(=O)O |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| IUPAC Name | benzoic acid |
| InChI Key | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| Molecular Formula | C7H6O2 |
Tris(hydroxymethyl)aminomethane, 99%
CAS: 77-86-1 Molecular Formula: C4H11NO3 Molecular Weight (g/mol): 121.136 MDL Number: MFCD00004679 InChI Key: LENZDBCJOHFCAS-UHFFFAOYSA-N Synonym: trometamol,tris,tromethamine,tris hydroxymethyl aminomethane,tham,trisamine,tris buffer,trizma,2-amino-2-hydroxymethyl propane-1,3-diol,tris base PubChem CID: 6503 ChEBI: CHEBI:9754 IUPAC Name: 2-amino-2-(hydroxymethyl)propane-1,3-diol SMILES: C(C(CO)(CO)N)O
| PubChem CID | 6503 |
|---|---|
| CAS | 77-86-1 |
| Molecular Weight (g/mol) | 121.136 |
| ChEBI | CHEBI:9754 |
| MDL Number | MFCD00004679 |
| SMILES | C(C(CO)(CO)N)O |
| Synonym | trometamol,tris,tromethamine,tris hydroxymethyl aminomethane,tham,trisamine,tris buffer,trizma,2-amino-2-hydroxymethyl propane-1,3-diol,tris base |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol |
| InChI Key | LENZDBCJOHFCAS-UHFFFAOYSA-N |
| Molecular Formula | C4H11NO3 |
1,3-Dihydroxynaphthalene, 99+%
CAS: 132-86-5 Molecular Formula: C10H8O2 Molecular Weight (g/mol): 160.17 InChI Key: XOOMNEFVDUTJPP-UHFFFAOYSA-N Synonym: 1,3-naphthalenediol,1,3-dihydroxynaphthalene,naphthoresorcinol,naphthoresoucinol,3-hydroxybenzocyclohexadien-1-one,naphthoresorcin,ccris 7896,unii-5x457yew8y,acmc-1bvwb,naphthalenediol-1,3 PubChem CID: 8601 IUPAC Name: naphthalene-1,3-diol SMILES: C1=CC=C2C(=C1)C=C(C=C2O)O
| PubChem CID | 8601 |
|---|---|
| CAS | 132-86-5 |
| Molecular Weight (g/mol) | 160.17 |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2O)O |
| Synonym | 1,3-naphthalenediol,1,3-dihydroxynaphthalene,naphthoresorcinol,naphthoresoucinol,3-hydroxybenzocyclohexadien-1-one,naphthoresorcin,ccris 7896,unii-5x457yew8y,acmc-1bvwb,naphthalenediol-1,3 |
| IUPAC Name | naphthalene-1,3-diol |
| InChI Key | XOOMNEFVDUTJPP-UHFFFAOYSA-N |
| Molecular Formula | C10H8O2 |
5-Hydroxy-p-naphthoquinone, 97%
CAS: 481-39-0 Molecular Formula: C10H6O3 Molecular Weight (g/mol): 174.16 MDL Number: MFCD00001684 InChI Key: KQPYUDDGWXQXHS-UHFFFAOYSA-N Synonym: juglone,5-hydroxy-1,4-naphthoquinone,5-hydroxy-1,4-naphthalenedione,regianin,walnut extract,juglon,nucin,5-hydroxynaphthoquinone,akhnot,yuglon PubChem CID: 3806 ChEBI: CHEBI:15794 IUPAC Name: 5-hydroxynaphthalene-1,4-dione SMILES: OC1=CC=CC2=C1C(=O)C=CC2=O
| PubChem CID | 3806 |
|---|---|
| CAS | 481-39-0 |
| Molecular Weight (g/mol) | 174.16 |
| ChEBI | CHEBI:15794 |
| MDL Number | MFCD00001684 |
| SMILES | OC1=CC=CC2=C1C(=O)C=CC2=O |
| Synonym | juglone,5-hydroxy-1,4-naphthoquinone,5-hydroxy-1,4-naphthalenedione,regianin,walnut extract,juglon,nucin,5-hydroxynaphthoquinone,akhnot,yuglon |
| IUPAC Name | 5-hydroxynaphthalene-1,4-dione |
| InChI Key | KQPYUDDGWXQXHS-UHFFFAOYSA-N |
| Molecular Formula | C10H6O3 |
Tetramethylammonium hydrogensulfate, 99+%, HPLC grade
Greener Choice Product
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
CAS: 80526-82-5 Molecular Formula: C4H13NO4S Molecular Weight (g/mol): 171.21 MDL Number: MFCD00036149 InChI Key: DWTYPCUOWWOADE-UHFFFAOYSA-M Synonym: tetramethylammonium hydrogen sulfate,tetramethylammonium bisulfate,tetramethylammonium hydrogen sulphate,tetramethylammonium hydrogensulfate,hydrogen sulfate; tetramethylazanium,methanaminium, n,n,n-trimethyl-, sulfate 1:1,hydrogen sulfate; tetramethylammonium,acmc-209pjn,ch3 4n hso4 .h2o,tetramethylammonium bisulfate solution PubChem CID: 157340 IUPAC Name: hydrogen sulfate;tetramethylazanium SMILES: C[N+](C)(C)C.OS(=O)(=O)[O-]
| PubChem CID | 157340 |
|---|---|
| CAS | 80526-82-5 |
| Molecular Weight (g/mol) | 171.21 |
| MDL Number | MFCD00036149 |
| SMILES | C[N+](C)(C)C.OS(=O)(=O)[O-] |
| Synonym | tetramethylammonium hydrogen sulfate,tetramethylammonium bisulfate,tetramethylammonium hydrogen sulphate,tetramethylammonium hydrogensulfate,hydrogen sulfate; tetramethylazanium,methanaminium, n,n,n-trimethyl-, sulfate 1:1,hydrogen sulfate; tetramethylammonium,acmc-209pjn,ch3 4n hso4 .h2o,tetramethylammonium bisulfate solution |
| IUPAC Name | hydrogen sulfate;tetramethylazanium |
| InChI Key | DWTYPCUOWWOADE-UHFFFAOYSA-M |
| Molecular Formula | C4H13NO4S |
n-Butyllithium, 2.5M solution in hexanes, AcroSeal™
CAS: 109-72-8 Molecular Formula: C4H9Li Molecular Weight (g/mol): 64.06 MDL Number: MFCD00009414 InChI Key: MZRVEZGGRBJDDB-UHFFFAOYSA-N Synonym: n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc PubChem CID: 61028 SMILES: [Li]CCCC
| PubChem CID | 61028 |
|---|---|
| CAS | 109-72-8 |
| Molecular Weight (g/mol) | 64.06 |
| MDL Number | MFCD00009414 |
| SMILES | [Li]CCCC |
| Synonym | n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc |
| InChI Key | MZRVEZGGRBJDDB-UHFFFAOYSA-N |
| Molecular Formula | C4H9Li |
Tetrabutylammonium bromide, 99+%
CAS: 1643-19-2 Molecular Formula: C16H36BrN Molecular Weight (g/mol): 322.36 MDL Number: MFCD00011633 InChI Key: JRMUNVKIHCOMHV-UHFFFAOYSA-M Synonym: tetrabutylammonium bromide,tetra-n-butylammonium bromide,tbab,tetrabutylazanium bromide,tetrabutyl ammonium bromide,tetrabutyl-ammonium bromide,aliquat 100,tbabr,ipc-tba-br,unii-vjz168i98r PubChem CID: 74236 ChEBI: CHEBI:51993 IUPAC Name: tetrabutylazanium;bromide SMILES: CCCC[N+](CCCC)(CCCC)CCCC.[Br-]
| PubChem CID | 74236 |
|---|---|
| CAS | 1643-19-2 |
| Molecular Weight (g/mol) | 322.36 |
| ChEBI | CHEBI:51993 |
| MDL Number | MFCD00011633 |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[Br-] |
| Synonym | tetrabutylammonium bromide,tetra-n-butylammonium bromide,tbab,tetrabutylazanium bromide,tetrabutyl ammonium bromide,tetrabutyl-ammonium bromide,aliquat 100,tbabr,ipc-tba-br,unii-vjz168i98r |
| IUPAC Name | tetrabutylazanium;bromide |
| InChI Key | JRMUNVKIHCOMHV-UHFFFAOYSA-M |
| Molecular Formula | C16H36BrN |