Learn More
Sodium benzoate, 99%, for biochemistry, ACROS Organics™
Brand: Acros Organics 447800010
Code : A0
Additional Details : CAS Number : 532-32-1 Weight : 1.00000kg
Quantity | 1kg |
---|
Chemical Identifiers
532-32-1 | |
144.11 | |
sodium benzoate, benzoic acid, sodium salt, benzoic acid sodium salt, sobenate, antimol, benzoate sodium, benzoate of soda, benzoate, sodium, natrium benzoicum, caswell no. 746 | |
sodium;benzoate |
C7H5NaO2 | |
WXMKPNITSTVMEF-UHFFFAOYSA-M | |
517055 | |
C1=CC=C(C=C1)C(=O)[O-].[Na+] |
Specifications
Sodium benzoate | |
Plastic bottle | |
>300.0°C | |
532-32-1 | |
C7H5NaO2 | |
15,8718 | |
(1 M in water) Clear colorless to light yellow | |
C1=CC=C(C=C1)C(=O)[O-].[Na+] | |
144.11 | |
144.11 | |
Biochemistry |
0.05% max | |
0.05% max | |
1kg | |
99% | |
C6H5CO2Na | |
sodium benzoate, benzoic acid, sodium salt, benzoic acid sodium salt, sobenate, antimol, benzoate sodium, benzoate of soda, benzoate, sodium, natrium benzoicum, caswell no. 746 | |
WXMKPNITSTVMEF-UHFFFAOYSA-M | |
sodium;benzoate | |
517055 | |
99% |